Product Search
Looking for a specific product? Use our product filter to find it!
The search field below was designed to enable our customers to conveniently search our products using product codes, CAS numbers, or product descriptions.
- Simply enter a Product Code, CAS number, or Description into the search box and the table will be filtered to display only the most applicable items.
- Please note that CAS numbers are only listed for individual component solutions
(M/C = multiple components, N/A = not available). - All products are sold as dilute solutions of known concentration and purity (≥98% chemical purity unless otherwise stated) in an appropriate solvent.
For more information on specific products, view our catalogue
| Product Code | CAS number | Description |
|---|---|---|
| EPA-1613CVS | M/C | U.S. EPA Method 1613 PCDD/PCDF Calibration Kit |
| EPA-1613CSL | M/C | U.S. EPA Method 1613 PCDD/PCDF Extended Calibration/Low Level Solution/Mixture – CSL |
| EPA-1613CS0.5 | M/C | U.S. EPA Method 1613 PCDD/PCDF Extended Calibration/Low Level Solution/Mixture – CS0.5 |
| EPA-1613LCS | M/C | U.S. EPA Method 1613 Mass-Labelled PCDD/PCDF Stock Solution/Mixture |
| EPA-1613CSS | 85508-50-5 | U.S. EPA Method 1613 Mass-Labelled PCDD/PCDF Cleanup Standard Spiking Solution |
| EPA-1613ISS | M/C | U.S. EPA Method 1613 Mass-Labelled PCDD/PCDF Internal Standard Spiking Solution/Mixture |
| EPA-1613PAR | M/C | U.S. EPA Method 1613 Native PCDD/PCDF Precision and Recovery Stock Solution/Mixture |
| EPA-1613STOCK | M/C | U.S. EPA Method 1613 Native PCDD/PCDF Stock Solution/Mixture |
| CS3WT | M/C | EPA-1613CS3 + Window Defining & 2,3,7,8-TCDD Specificity Solution/Mixture (DB-5, HP-5MS, or equivalent) |
| EPA-513CVS | M/C | U.S. EPA Method 513 TCDD/TCDF Calibration Kit |
| 513-CS0.25 | M/C | U.S. EPA Method 513 TCDD/TCDF Extended Calibration/Low Level Solution/Mixture – CS0.25 |
| EPA-513LCSS | M/C | U.S. EPA Method 513 Mass-Labelled TCDD/TCDF Spiking Solution/Mixture |
| EPA-513ISS | M/C | U.S. EPA Method 513 Mass-Labelled TCDD/TCDF Internal Standard Spiking Solution/Mixture |
| EPA-513CSSA | M/C | U.S. EPA Method 513 Mass-Labelled TCDD/TCDF Cleanup Standard Spiking Solution |
| EPA-513CSSB | M/C | U.S. EPA Method 513 Mass-Labelled TCDD/TCDF Alternative Cleanup Standard Spiking Solution/Mixture |
| EPA-513PAR | M/C | U.S. EPA Method 513 Native TCDD/TCDF Precision and Recovery Solution/Mixture |
| EPA-8280CVS | M/C | U.S. EPA Method 8280 PCDD/PCDF Calibration Kit |
| EPA-8280IS | M/C | U.S. EPA Method 8280 Mass-Labelled PCDD/PCDF Internal Standard Solution/Mixture |
| EPA-8280ISB | M/C | U.S. EPA Method 8280 Mass-Labelled PCDD/PCDF Additional Internal Standard Solution/Mixture |
| EPA-8280CS | M/C | U.S. EPA Method 8280 Mass-Labelled PCDD/PCDF Cleanup Standard Solution |
| EPA-8280RS | M/C | U.S. EPA Method 8280 Mass-Labelled PCDD/PCDF Recovery Standard Solution/Mixture |
| EPA-8280MSS | M/C | U.S. EPA Method 8280 Native PCDD/PCDF Matrix Spiking Solution/Mixture |
| EPA-8290HRCC1-5 | M/C | U.S. EPA Method 8290 PCDD/PCDF Calibration Kit |
| EPA-8290HRCC0.25 | M/C | U.S. EPA Method 8290 PCDD/PCDF Extended Calibration/Low Level Solution/Mixture – CS0.25 |
| EPA-8290HRCC0.5 | M/C | U.S. EPA Method 8290 PCDD/PCDF Extended Calibration/Low Level Solution/Mixture – CS0.5 |
| EPA-8290SFS | M/C | U.S. EPA Method 8290 Mass-Labelled PCDD/PCDF Sample Fortification Solution/Mixture |
| EPA-8290RSS | M/C | U.S. EPA Method 8290 Mass-Labelled PCDD/PCDF Recovery Standard Solution/Mixture |
| EPA-8290MSS | M/C | U.S. EPA Method 8290 Native PCDD/PCDF Matrix Spiking Solution/Mixture |
| EPA-8290STN | M/C | U.S. EPA Method 8290 Native PCDD/PCDF Stock Solution/Mixture |
| EPA-23CS1-5 | M/C | U.S. EPA Method 23 PCDD/PCDF Calibration Kit |
| EPA-23IS | M/C | U.S. EPA Method 23 Mass-Labelled PCDD/PCDF Internal Standard Solution/Mixture |
| EPA-23ISS | M/C | U.S. EPA Method 23 Mass-Labelled PCDD/PCDF Internal Standard Stock Solution/Mixture |
| EPA-23SS | M/C | U.S. EPA Method 23 Mass-Labelled PCDD/PCDF Surrogate Standard Solution/Mixture |
| EPA-23SSS | M/C | U.S. EPA Method 23 Mass-Labelled PCDD/PCDF Surrogate Standard Stock Solution/Mixture |
| EPA-23RS | M/C | U.S. EPA Method 23 Mass-Labelled PCDD/PCDF Recovery Standard Solution/Mixture |
| EPA-23AS | M/C | U.S. EPA Method 23 Mass-Labelled PCDD/PCDF Alternative Standard Solution |
| EN-1948CVS | M/C | European Standard Method EN 1948-4 PCDD/PCDF Calibration Kit |
| EN-1948CSL | M/C | European Standard Method EN 1948-4 PCDD/PCDF Extended Calibration/Low Level Solution/Mixture – CSL |
| EN-1948ES | M/C | European Standard Method EN 1948-4 Mass-Labelled PCDD/PCDF Extraction Standard Solution/Mixture |
| EN-1948IS | M/C | European Standard Method EN 1948-4 Mass-Labelled PCDD/PCDF Recovery Standard Solution/Mixture |
| EN-1948SS | M/C | European Standard Method EN 1948-4 Mass-Labelled PCDD/PCDF Sampling Standard Solution/Mixture |
| EN-1948STK | M/C | European Standard Method EN 1948-4 Native PCDD/PCDF Stock Solution/Mixture |
| 5CWDS | M/C | PCDD/PCDF Window Defining Solution/Mixture (DB-5, HP-5MS, or equivalent) |
| 5TCDD | M/C | 2,3,7,8-TCDD Specificity Solution/Mixture (DB-5, HP-5MS, or equivalent) |
| 225TCDF | M/C | 2,3,7,8-TCDF Specificity Solution/Mixture (DB-5, HP-5MS, or equivalent) |
| 5TDWD | M/C | PCDD/PCDF Window Defining & 2,3,7,8-TCDD Specificity Solution/Mixture (DB-5, HP-5MS, or equivalent) |
| TDTFWD | M/C | PCDD/PCDF Window Defining & 2,3,7,8-TCDD/TCDF Specificity Solution/Mixture (DB-5, HP-5MS, Rtx-Dioxin2, or equivalent) |
| DD-0-S | 262-12-4 | Dibenzo-p-dioxin Solution |
| DD-1-S | 39227-53-7 | 1-Chlorodibenzo-p-dioxin Solution |
| DD-2-S | 39227-54-8 | 2-Chlorodibenzo-p-dioxin Solution |
| DD-23-S | 29446-15-9 | 2,3-Dichlorodibenzo-p-dioxin Solution |
| DD-27-S | 33857-26-0 | 2,7-Dichlorodibenzo-p-dioxin Solution |
| DD-28-S | 38964-22-6 | 2,8-Dichlorodibenzo-p-dioxin Solution |
| DD-123-S | 54536-17-3 | 1,2,3-Trichlorodibenzo-p-dioxin Solution |
| DD-124-S | 39227-58-2 | 1,2,4-Trichlorodibenzo-p-dioxin Solution |
| DD-237-S | 33857-28-2 | 2,3,7-Trichlorodibenzo-p-dioxin Solution |
| DD-1234-S | 30746-58-8 | 1,2,3,4-Tetrachlorodibenzo-p-dioxin Solution |
| DD-1247/1248-S | 71669-28-8; 71669-29-9 |
1,2,4,7/1,2,4,8-Tetrachlorodibenzo-p-dioxin Solution/Mixture |
| DD-1278-S | 34816-53-0 | 1,2,7,8-Tetrachlorodibenzo-p-dioxin Solution |
| DD-1289-S | 62470-54-6 | 1,2,8,9-Tetrachlorodibenzo-p-dioxin Solution |
| DD-1368-S | 33423-92-6 | 1,3,6,8-Tetrachlorodibenzo-p-dioxin Solution |
| DD-1378-S | 50585-46-1 | 1,3,7,8-Tetrachlorodibenzo-p-dioxin Solution |
| DD-1379-S | 62470-53-5 | 1,3,7,9-Tetrachlorodibenzo-p-dioxin Solution |
| DD-1478-S | 40581-94-0 | 1,4,7,8-Tetrachlorodibenzo-p-dioxin Solution |
| DD-2378-S | 1746-01-6 | 2,3,7,8-Tetrachlorodibenzo-p-dioxin Solution |
| DD-12378-S | 40321-76-4 | 1,2,3,7,8-Pentachlorodibenzo-p-dioxin Solution |
| DD-12478-S | 58802-08-7 | 1,2,4,7,8-Pentachlorodibenzo-p-dioxin Solution |
| DD-123467-S | 58200-66-1 | 1,2,3,4,6,7-Hexachlorodibenzo-p-dioxin Solution |
| DD-123468-S | 58200-67-2 | 1,2,3,4,6,8-Hexachlorodibenzo-p-dioxin Solution |
| DD-123478-S | 39227-28-6 | 1,2,3,4,7,8-Hexachlorodibenzo-p-dioxin Solution |
| DD-123678-S | 57653-85-7 | 1,2,3,6,7,8-Hexachlorodibenzo-p-dioxin Solution |
| DD-123789-S | 19408-74-3 | 1,2,3,7,8,9-Hexachlorodibenzo-p-dioxin Solution |
| DD-124679-S | 39227-62-8 | 1,2,4,6,7,9-Hexachlorodibenzo-p-dioxin Solution |
| DD-1234678-S | 35822-46-9 | 1,2,3,4,6,7,8-Heptachlorodibenzo-p-dioxin Solution |
| DD-12346789-S | 3268-87-9 | Octachlorodibenzo-p-dioxin Solution |
| DF-0-S | 132-64-9 | Dibenzofuran Solution |
| DF-2-S | 51230-49-0 | 2-Chlorodibenzofuran Solution |
| DF-4-S | 74992-96-4 | 4-Chlorodibenzofuran Solution |
| DF-23-S | 64126-86-9 | 2,3-Dichlorodibenzofuran Solution |
| DF-24-S | 24478-74-8 | 2,4-Dichlorodibenzofuran Solution |
| DF-26-S | 60390-27-4 | 2,6-Dichlorodibenzofuran Solution |
| DF-27-S | 74992-98-6 | 2,7-Dichlorodibenzofuran Solution |
| DF-28-S | 5409-83-6 | 2,8-Dichlorodibenzofuran Solution |
| DF-136-S | 83704-39-6 | 1,3,6-Trichlorodibenzofuran Solution |
| DF-138-S | 76621-12-0 | 1,3,8-Trichlorodibenzofuran Solution |
| DF-146-S | 82911-60-2 | 1,4,6-Trichlorodibenzofuran Solution |
| DF-147-S | 83704-41-0 | 1,4,7-Trichlorodibenzofuran Solution |
| DF-149-S | 70648-13-4 | 1,4,9-Trichlorodibenzofuran Solution |
| DF-234-S | 57117-34-7 | 2,3,4-Trichlorodibenzofuran Solution |
| DF-236-S | 57117-33-6 | 2,3,6-Trichlorodibenzofuran Solution |
| DF-238-S | 57117-32-5 | 2,3,8-Trichlorodibenzofuran Solution |
| DF-246-S | 58802-14-5 | 2,4,6-Trichlorodibenzofuran Solution |
| DF-247-S | 83704-42-1 | 2,4,7-Trichlorodibenzofuran Solution |
| DF-248-S | 54589-71-8 | 2,4,8-Trichlorodibenzofuran Solution |
| DF-267-S | 83704-45-4 | 2,6,7-Trichlorodibenzofuran Solution |
| DF-1236-S | 83704-21-6 | 1,2,3,6-Tetrachlorodibenzofuran Solution |
| DF-1238-S | 62615-08-1 | 1,2,3,8-Tetrachlorodibenzofuran Solution |
| DF-1239-S | 83704-23-8 | 1,2,3,9-Tetrachlorodibenzofuran Solution |
| DF-1246-S | 71998-73-7 | 1,2,4,6-Tetrachlorodibenzofuran Solution |
| DF-1247-S | 83719-40-8 | 1,2,4,7-Tetrachlorodibenzofuran Solution |
| DF-1248-S | 64126-87-0 | 1,2,4,8-Tetrachlorodibenzofuran Solution |
| DF-1267-S | 83704-25-0 | 1,2,6,7-Tetrachlorodibenzofuran Solution |
| DF-1278-S | 58802-20-3 | 1,2,7,8-Tetrachlorodibenzofuran Solution |
| DF-1279-S | 83704-26-1 | 1,2,7,9-Tetrachlorodibenzofuran Solution |
| DF-1347-S | 70648-16-7 | 1,3,4,7-Tetrachlorodibenzofuran Solution |
| DF-1348-S | 92341-04-3 | 1,3,4,8-Tetrachlorodibenzofuran Solution |
| DF-1349-S | 83704-28-3 | 1,3,4,9-Tetrachlorodibenzofuran Solution |
| DF-1367-S | 57117-36-9 | 1,3,6,7-Tetrachlorodibenzofuran Solution |
| DF-1368-S | 71998-72-6 | 1,3,6,8-Tetrachlorodibenzofuran Solution |
| DF-1369-S | 83690-98-6 | 1,3,6,9-Tetrachlorodibenzofuran Solution |
| DF-1378-S | 57117-35-8 | 1,3,7,8-Tetrachlorodibenzofuran Solution |
| DF-1467-S | 66794-59-0 | 1,4,6,7-Tetrachlorodibenzofuran Solution |
| DF-1478-S | 83704-29-4 | 1,4,7,8-Tetrachlorodibenzofuran Solution |
| DF-2346-S | 83704-30-7 | 2,3,4,6-Tetrachlorodibenzofuran Solution |
| DF-2347-S | 83704-31-8 | 2,3,4,7-Tetrachlorodibenzofuran Solution |
| DF-2348-S | 83704-32-9 | 2,3,4,8-Tetrachlorodibenzofuran Solution |
| DF-2368-S | 57117-37-0 | 2,3,6,8-Tetrachlorodibenzofuran Solution |
| DF-2378-S | 51207-31-9 | 2,3,7,8-Tetrachlorodibenzofuran Solution |
| DF-2467-S | 57117-38-1 | 2,4,6,7-Tetrachlorodibenzofuran Solution |
| DF-2468-S | 58802-19-0 | 2,4,6,8-Tetrachlorodibenzofuran Solution |
| DF-3467-S | 57117-40-5 | 3,4,6,7-Tetrachlorodibenzofuran Solution |
| DF-12347-S | 83704-48-7 | 1,2,3,4,7-Pentachlorodibenzofuran Solution |
| DF-12348-S | 67517-48-0 | 1,2,3,4,8-Pentachlorodibenzofuran Solution |
| DF-12367-S | 57117-42-7 | 1,2,3,6,7-Pentachlorodibenzofuran Solution |
| DF-12378-S | 57117-41-6 | 1,2,3,7,8-Pentachlorodibenzofuran Solution |
| DF-12379-S | 83704-53-4 | 1,2,3,7,9-Pentachlorodibenzofuran Solution |
| DF-12389-S | 83704-54-5 | 1,2,3,8,9-Pentachlorodibenzofuran Solution |
| DF-12467-S | 83704-50-1 | 1,2,4,6,7-Pentachlorodibenzofuran Solution |
| DF-12468-S | 69698-57-3 | 1,2,4,6,8-Pentachlorodibenzofuran Solution |
| DF-12478-S | 58802-15-6 | 1,2,4,7,8-Pentachlorodibenzofuran Solution |
| DF-13467-S | 83704-36-3 | 1,3,4,6,7-Pentachlorodibenzofuran Solution |
| DF-13478-S | 58802-16-7 | 1,3,4,7,8-Pentachlorodibenzofuran Solution |
| DF-13479-S | 70648-20-3 | 1,3,4,7,9-Pentachlorodibenzofuran Solution |
| DF-13678-S | 70648-21-4 | 1,3,6,7,8-Pentachlorodibenzofuran Solution (≥96%) |
| DF-23467-S | 57117-43-8 | 2,3,4,6,7-Pentachlorodibenzofuran Solution |
| DF-23478-S | 57117-31-4 | 2,3,4,7,8-Pentachlorodibenzofuran Solution |
| DF-123467-S | 79060-60-9 | 1,2,3,4,6,7-Hexachlorodibenzofuran Solution |
| DF-123468-S | 69698-60-8 | 1,2,3,4,6,8-Hexachlorodibenzofuran Solution |
| DF-123478-S | 70648-26-9 | 1,2,3,4,7,8-Hexachlorodibenzofuran Solution |
| DF-123489-S | 92341-07-6 | 1,2,3,4,8,9-Hexachlorodibenzofuran Solution |
| DF-123678-S | 57117-44-9 | 1,2,3,6,7,8-Hexachlorodibenzofuran Solution |
| DF-123789-S | 72918-21-9 | 1,2,3,7,8,9-Hexachlorodibenzofuran Solution |
| DF-234678-S | 60851-34-5 | 2,3,4,6,7,8-Hexachlorodibenzofuran Solution |
| DF-1234678-S | 67562-39-4 | 1,2,3,4,6,7,8-Heptachlorodibenzofuran Solution |
| DF-1234689-S | 69698-58-4 | 1,2,3,4,6,8,9-Heptachlorodibenzofuran Solution |
| DF-1234789-S | 55673-89-7 | 1,2,3,4,7,8,9-Heptachlorodibenzofuran Solution |
| DF-12346789-S | 39001-02-0 | Octachlorodibenzofuran Solution |
| MDD-0 | 125749-32-8 | (13C12)Dibenzo-p-dioxin Solution |
| MDD-2 | N/A | 2-Chloro(13C12)dibenzo-p-dioxin Solution |
| MDD-23 | N/A | 2,3-Dichloro(13C12)dibenzo-p-dioxin Solution |
| MDD-237 | N/A | 2,3,7-Trichloro(13C12)dibenzo-p-dioxin Solution |
| MDD-1234 | 114423-99-3 | 1,2,3,4-Tetrachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-1278 | N/A | 1,2,7,8-Tetrachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-1368 | N/A | 1,3,6,8-Tetrachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-1378 | N/A | 1,3,7,8-Tetrachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-2378 | 76523-40-5 | 2,3,7,8-Tetrachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-12378 | 109719-79-1 | 1,2,3,7,8-Pentachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-12389 | N/A | 1,2,3,8,9-Pentachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-12478 | N/A | 1,2,4,7,8-Pentachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-12479 | N/A | 1,2,4,7,9-Pentachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-123467 | N/A | 1,2,3,4,6,7-Hexachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-123468 | N/A | 1,2,3,4,6,8-Hexachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-123478 | 109719-80-4 | 1,2,3,4,7,8-Hexachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-123678 | 109719-81-5 | 1,2,3,6,7,8-Hexachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-123789 | 109719-82-6 | 1,2,3,7,8,9-Hexachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-1234678 | 109719-83-7 | 1,2,3,4,6,7,8-Heptachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-1234679 | N/A | 1,2,3,4,6,7,9-Heptachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-12346789 | 114423-97-1 | Octachloro(13C12)dibenzo-p-dioxin Solution |
| MCDD-2378 | 85508-50-5 | 2,3,7,8-(37Cl4)-Tetrachlorodibenzo-p-dioxin Solution |
| MDF-0 | N/A | (13C12)Dibenzofuran Solution |
| MDF-2 | N/A | 2-Chloro(13C12)dibenzofuran Solution |
| MDF-23 | N/A | 2,3-Dichloro(13C12)dibenzofuran Solution |
| MDF-238 | N/A | 2,3,8-Trichloro(13C12)dibenzofuran Solution |
| MDF-1234 | N/A | 1,2,3,4-Tetrachloro(13C12)dibenzofuran Solution |
| MDF-1278-1 | N/A | 1,2,7,8-Tetrachloro(13C12)dibenzofuran Solution |
| MDF-1278 | N/A | 1,2,7,8-Tetrachloro(13C12)dibenzofuran Solution |
| MDF-1368 | N/A | 1,3,6,8-Tetrachloro(13C12)dibenzofuran Solution |
| MDF-2378 | 89059-46-1 | 2,3,7,8-Tetrachloro(13C12)dibenzofuran Solution |
| MDF-12346-1 | N/A | 1,2,3,4,6-Pentachloro(13C12)dibenzofuran Solution |
| MDF-12346 | N/A | 1,2,3,4,6-Pentachloro(13C12)dibenzofuran Solution |
| MDF-12378 | 109719-77-9 | 1,2,3,7,8-Pentachloro(13C12)dibenzofuran Solution |
| MDF-13468 | N/A | 1,3,4,6,8-Pentachloro(13C12)dibenzofuran Solution |
| MDF-23478 | 116843-02-8 | 2,3,4,7,8-Pentachloro(13C12)dibenzofuran Solution |
| MDF-123469-1 | N/A | 1,2,3,4,6,9-Hexachloro(13C12)dibenzofuran Solution |
| MDF-123469 | N/A | 1,2,3,4,6,9-Hexachloro(13C12)dibenzofuran Solution |
| MDF-123478 | 114423-98-2 | 1,2,3,4,7,8-Hexachloro(13C12)dibenzofuran Solution |
| MDF-123678 | 116843-03-9 | 1,2,3,6,7,8-Hexachloro(13C12)dibenzofuran Solution |
| MDF-123789 | 116843-04-0 | 1,2,3,7,8,9-Hexachloro(13C12)dibenzofuran Solution |
| MDF-234678 | 116843-05-1 | 2,3,4,6,7,8-Hexachloro(13C12)dibenzofuran Solution |
| MDF-1234678 | 109719-84-8 | 1,2,3,4,6,7,8-Heptachloro(13C12)dibenzofuran Solution |
| MDF-1234689-1 | N/A | 1,2,3,4,6,8,9-Heptachloro(13C12)dibenzofuran Solution |
| MDF-1234689 | N/A | 1,2,3,4,6,8,9-Heptachloro(13C12)dibenzofuran Solution |
| MDF-1234789 | 109719-94-0 | 1,2,3,4,7,8,9-Heptachloro(13C12)dibenzofuran Solution |
| MDF-12346789 | 109719-78-0 | Octachloro(13C12)dibenzofuran Solution |
| DF-CVS-A10 | M/C | Polychlorinated Dibenzo-p-dioxin/Polychlorinated Dibenzofuran (PCDD/PCDF) Calibration Kit |
| DF-CVS-B10 | M/C | Polychlorinated Dibenzo-p-dioxin/Polychlorinated Dibenzofuran (PCDD/PCDF) Calibration Kit |
| DF-CVS-C10 | M/C | Polychlorinated Dibenzo-p-dioxin/Polychlorinated Dibenzofuran (PCDD/PCDF) Calibration Kit |
| DF-C10-CS8 | M/C | Polychlorinated Dibenzo-p-dioxin/Polychlorinated Dibenzofuran (PCDD/PCDF) Extended Calibration/High Level Solution/Mixture – CS8 (DF-CVS-C10) |
| DFP-CVS-B10 | M/C | Polychlorinated Dibenzo-p-dioxin/Polychlorinated Dibenzofuran/Polychlorinated Biphenyl (PCDD/PCDF/PCB) Calibration Kit |
| NK-CVS-J | M/C | Polychlorinated Dibenzo-p-dioxin/Polychlorinated Dibenzofuran (PCDD/PCDF) Calibration Kit |
| DF-LCS-A | M/C | Mass-Labelled PCDD/PCDF Extraction Standard Solution/Mixture |
| DF-LCS-A200 | M/C | Mass-Labelled PCDD/PCDF Extraction Standard Solution/Mixture |
| DF-LCS-A40 | M/C | Mass-Labelled PCDD/PCDF Extraction Standard Solution/Mixture |
| DF-LCS-B | M/C | Mass-Labelled PCDD/PCDF Extraction Standard Solution/Mixture |
| DF-LCS-B200 | M/C | Mass-Labelled PCDD/PCDF Extraction Standard Solution/Mixture |
| DF-LCS-B40 | M/C | Mass-Labelled PCDD/PCDF Extraction Standard Solution/Mixture |
| DF-LCS-C | M/C | Mass-Labelled PCDD/PCDF Extraction Standard Solution/Mixture |
| DF-LCS-C200 | M/C | Mass-Labelled PCDD/PCDF Extraction Standard Solution/Mixture |
| DF-LCS-C40 | M/C | Mass-Labelled PCDD/PCDF Extraction Standard Solution/Mixture |
| DS-1000 | M/C | Mass-Labelled PCDD Solution/Mixture |
| FS-1000 | M/C | Mass-Labelled PCDF Solution/Mixture |
| NK-LCS-O | M/C | Mass-Labelled PCDD/PCDF Extraction Standard Solution/Mixture |
| NK-LCS-T | M/C | Mass-Labelled PCDD/PCDF Extraction Standard Solution/Mixture |
| DF-IS-A | M/C | Mass-Labelled TCDD Internal Standard Solution |
| DF-IS-A200 | M/C | Mass-Labelled TCDD Internal Standard Solution |
| DF-IS-A40 | M/C | Mass-Labelled TCDD Internal Standard Solution |
| DF-IS-B | M/C | Mass-Labelled TCDD/TCDF Internal Standard Solution/Mixture |
| DF-IS-B200 | M/C | Mass-Labelled TCDD/TCDF Internal Standard Solution/Mixture |
| DF-IS-B40 | M/C | Mass-Labelled TCDD/TCDF Internal Standard Solution/Mixture |
| DF-IS-C | M/C | Mass-Labelled TCDD/TCDF Internal Standard Solution/Mixture |
| DF-IS-C200 | M/C | Mass-Labelled TCDD/TCDF Internal Standard Solution/Mixture |
| DF-IS-C40 | M/C | Mass-Labelled TCDD/TCDF Internal Standard Solution/Mixture |
| DF-IS-D | M/C | Mass-Labelled TCDD/TCDF Internal Standard Solution/Mixture |
| DF-IS-D200 | M/C | Mass-Labelled TCDD/TCDF Internal Standard Solution/Mixture |
| DF-IS-D40 | M/C | Mass-Labelled TCDD/TCDF Internal Standard Solution/Mixture |
| DF-IS-E | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DF-IS-E200 | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DF-IS-E40 | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DF-IS-F | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DF-IS-F200 | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DF-IS-F40 | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DF-IS-G | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DF-IS-G200 | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DF-IS-G40 | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DF-IS-H | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DF-IS-H200 | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DF-IS-H40 | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DF-IS-I | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DF-IS-I200 | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DF-IS-I40 | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DF-IS-J | M/C | Mass-Labelled PCDD Internal Standard Solution/Mixture |
| NK-IS-J4 | M/C | Mass-Labelled PCDD Internal Standard Solution/Mixture |
| NK-IS-J5 | M/C | Mass-Labelled PCDF Internal Standard Solution/Mixture |
| DFP-LCS-B | M/C | Mass-Labelled PCDD/PCDF/PCB Extraction Standard Solution/Mixture |
| DFP-LCS-B100 | M/C | Mass-Labelled PCDD/PCDF/PCB Extraction Standard Solution/Mixture |
| DFP-LCS-B20 | M/C | Mass-Labelled PCDD/PCDF/PCB Extraction Standard Solution/Mixture |
| DFP-LCS-A | M/C | Mass-Labelled PCDD/PCDF/PCB Extraction Standard Solution/Mixture |
| DFP-IS-A | M/C | Mass-Labelled PCDF/PCB Injection Standard Solution/Mixture |
| DFP-SS-A | M/C | Mass-Labelled PCDD/PCB Sampling Standard Solution |
| DFP-IS-B10 | M/C | Mass-Labelled PCDD/PCB Injection Standard Solution/Mixture |
| DFP-SS-A10 | M/C | Mass-Labelled PCDD/PCB Sampling Standard Solution |
| DF-ST-A | M/C | Native PCDD/PCDF Solution/Mixture |
| DF-ST-B | M/C | Native PCDD/PCDF Solution/Mixture |
| NK-ST-A | M/C | Native PCDD/PCDF Solution/Mixture |
| NK-ST-A4 | M/C | Native PCDD/PCDF Solution/Mixture |
| NK-ST-B2 | M/C | Native PCDD/PCDF Solution/Mixture |
| NK-ST-B4 | M/C | Native PCDD/PCDF Solution/Mixture |
| DDF-MDT | M/C | Native PCDD/PCDF Solution/Mixture |
| MDDF-MDT | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| WP-CVS | M/C | WHO (Dioxin-Like) Polychlorinated Biphenyl (PCB) Calibration Kit |
| WP-LCS | M/C | Mass-Labelled WHO (Dioxin-Like) PCB Extraction Standard Solution/Mixture |
| WP-ISS | M/C | Mass-Labelled WHO (Dioxin-Like) PCB Internal Standard Solution/Mixture |
| WP-STK | M/C | Native WHO (Dioxin-Like) PCB Stock Solution/Mixture |
| 68C-CVS | M/C | U.S. EPA Method 1668C PCB Calibration Kit |
| 68C-LCS | M/C | U.S. EPA Method 1668C Mass-Labelled PCB Toxics/LOC/Window Defining Stock Solution/Mixture (DB-5, HP-5MS, or equivalent) |
| 68C-CS | M/C | U.S. EPA Method 1668C Mass-Labelled PCB Cleanup Standard Stock Solution/Mixture |
| 68C-IS | M/C | U.S. EPA Method 1668C Mass-Labelled PCB Injection/Internal Standard Stock Solution/Mixture |
| 68C-PAR | M/C | U.S. EPA Method 1668C Native PCB Toxics/LOC Stock Solution/Mixture |
| EPA-1668CVS | M/C | U.S. EPA Method 1668 PCB Calibration Kit |
| EPA-1668LCS | M/C | U.S. EPA Method 1668 Mass-Labelled PCB Stock Solution/Mixture |
| EPA-1668CS | M/C | U.S. EPA Method 1668 Mass-Labelled PCB Cleanup Standard Solution/Mixture |
| EPA-1668IS | M/C | U.S. EPA Method 1668 Mass-Labelled PCB Internal Standard Stock Solution/Mixture |
| EPA-1668PAR | M/C | U.S. EPA Method 1668 Native PCB Precision and Recovery Solution/Mixture |
| EC9605-CVS | M/C | Environment Canada Report EPS 1/RM/31 PCB Calibration Kit |
| EC9605-RS | M/C | Environment Canada Report EPS 1/RM/31 Mass-Labelled PCB Recovery Standard Solution/Mixture |
| EC9605-SS | M/C | Environment Canada Report EPS 1/RM/31 Mass-Labelled PCB Surrogate Solution/Mixture |
| EC9605-PAR | M/C | Environment Canada Report EPS 1/RM/31 Native PCB Precision and Recovery Solution/Mixture |
| P48-W-CVS | M/C | European Standard Method EN 1948-4 WHO (Dioxin-Like) PCB Calibration Kit |
| P48-M-CVS | M/C | European Standard Method EN 1948-4 Marker PCB Calibration Kit |
| WM48-CVS | M/C | European Standard Method EN 1948-4 WHO (Dioxin-Like) & Marker PCB Calibration Kit |
| P48-W-PAR | M/C | European Standard Method EN 1948-4 Native WHO (Dioxin-Like) PCB Precision and Recovery Stock Solution/Mixture |
| P48-M-PAR | M/C | European Standard Method EN 1948-4 Marker Native PCB Precision and Recovery Stock Solution/Mixture |
| P48-W-ES | M/C | European Standard Method EN 1948-4 Mass-Labelled WHO (Dioxin-Like) PCB Extraction Standard Solution/Mixture |
| P48-M-ES | M/C | European Standard Method EN 1948-4 Mass-Labelled Marker PCB Extraction Standard Solution/Mixture |
| P48-SS | M/C | European Standard Method EN 1948-4 Mass-Labelled PCB Sampling Standard Solution/Mixture |
| P48-RS | M/C | European Standard Method EN 1948-4 Mass-Labelled PCB Recovery Standard Solution/Mixture |
| MBP-1 | 234432-85-0 | 2-Chloro(13C12)biphenyl Solution |
| MBP-3 | 208263-77-8 | 4-Chloro(13C12)biphenyl Solution |
| MBP-4 | 234432-86-1 | 2,2′-Dichloro(13C12)biphenyl Solution |
| MBP-5 | N/A | 2,3-Dichloro(13C12)biphenyl Solution |
| MBP-8 | N/A | 2,4′-Dichloro(13C12)biphenyl Solution |
| MBP-9 | 250694-89-4 | 2,5-Dichloro(13C12)biphenyl Solution |
| MBP-11 | N/A | 3,3′-Dichloro(13C12)biphenyl Solution |
| MBP-15 | 208263-67-6 | 4,4′-Dichloro(13C12)biphenyl Solution |
| MBP-19 | 234432-87-2 | 2,2′,6-Trichloro(13C12)biphenyl Solution |
| MBP-28 | 208263-76-7 | 2,4,4′-Trichloro(13C12)biphenyl Solution |
| MBP-31 | 208263-78-9 | 2,4′,5-Trichloro(13C12)biphenyl Solution |
| MBP-37 | 208263-79-0 | 3,4,4′-Trichloro(13C12)biphenyl Solution |
| MBP-52 | 208263-80-3 | 2,2′,5,5′-Tetrachloro(13C12)biphenyl Solution |
| MBP-54 | 234432-88-3 | 2,2′,6,6′-Tetrachloro(13C12)biphenyl Solution |
| MBP-60 | N/A | 2,3,4,4′-Tetrachloro(13C12)biphenyl Solution |
| MBP-70 | 208263-81-4 | 2,3′,4′,5-Tetrachloro(13C12)biphenyl Solution |
| MBP-77 | 105600-23-5 | 3,3′,4,4′-Tetrachloro(13C12)biphenyl Solution |
| MBP-79 | 1027415-81-1 | 3,3′,4,5′-Tetrachloro(13C12)biphenyl Solution |
| MBP-81 | 208461-24-9 | 3,4,4′,5-Tetrachloro(13C12)biphenyl Solution |
| MBP-95 | N/A | 2,2′,3,5′,6-Pentachloro(13C12)biphenyl Solution |
| MBP-101 | 104130-39-4 | 2,2′,4,5,5′-Pentachloro(13C12)biphenyl Solution |
| MBP-104 | 234432-89-4 | 2,2′,4,6,6′-Pentachloro(13C12)biphenyl Solution |
| MBP-105 | 208263-62-1 | 2,3,3′,4,4′-Pentachloro(13C12)biphenyl Solution |
| MBP-111 | 235416-29-2 | 2,3,3′,5,5′-Pentachloro(13C12)biphenyl Solution |
| MBP-114 | 208263-63-2 | 2,3,4,4′,5-Pentachloro(13C12)biphenyl Solution |
| MBP-118 | 104130-40-7 | 2,3′,4,4′,5-Pentachloro(13C12)biphenyl Solution |
| MBP-123 | 208263-64-3 | 2′,3,4,4′,5-Pentachloro(13C12)biphenyl Solution |
| MBP-126 | 208263-65-4 | 3,3′,4,4′,5-Pentachloro(13C12)biphenyl Solution |
| MBP-127 | N/A | 3,3′,4,5,5′-Pentachloro(13C12)biphenyl Solution |
| MBP-133 | N/A | 2,2′,3,3′,5,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-138 | 208263-66-5 | 2,2′,3,4,4′,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-153 | 185376-58-3 | 2,2′,4,4′,5,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-155 | 234432-90-7 | 2,2′,4,4′,6,6′-Hexachloro(13C12)biphenyl Solution |
| MBP-156 | 208263-68-7 | 2,3,3′,4,4′,5-Hexachloro(13C12)biphenyl Solution |
| MBP-157 | 235416-30-5 | 2,3,3′,4,4′,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-159 | N/A | 2,3,3′,4,5,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-162 | N/A | 2,3,3′,4′,5,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-167 | 208263-69-8 | 2,3′,4,4′,5,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-169 | 208263-70-1 | 3,3′,4,4′,5,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-170 | 160901-80-4 | 2,2′,3,3′,4,4′,5-Heptachloro(13C12)biphenyl Solution |
| MBP-178 | 232919-67-4 | 2,2′,3,3′,5,5′,6-Heptachloro(13C12)biphenyl Solution |
| MBP-180 | 160901-82-6 | 2,2′,3,4,4′,5,5′-Heptachloro(13C12)biphenyl Solution |
| MBP-188 | 234432-91-8 | 2,2′,3,4′,5,6,6′-Heptachloro(13C12)biphenyl Solution |
| MBP-189 | 208263-73-4 | 2,3,3′,4,4′,5,5′-Heptachloro(13C12)biphenyl Solution |
| MBP-194 | 208263-74-5 | 2,2′,3,3′,4,4′,5,5′-Octachloro(13C12)biphenyl Solution |
| MBP-202 | 105600-26-8 | 2,2′,3,3′,5,5′,6,6′-Octachloro(13C12)biphenyl Solution |
| MBP-205 | 234446-64-1 | 2,3,3′,4,4′,5,5′,6-Octachloro(13C12)biphenyl Solution |
| MBP-206 | 208263-75-6 | 2,2′,3,3′,4,4′,5,5′,6-Nonachloro(13C12)biphenyl Solution |
| MBP-208 | 234432-92-9 | 2,2′,3,3′,4,5,5′,6,6′-Nonachloro(13C12)biphenyl Solution |
| MBP-209 | 105600-27-9 | Decachloro(13C12)biphenyl Solution |
| PCB-CVS-H | M/C | Polychlorinated Biphenyl (PCB) Calibration Kit |
| PCB-LCS-H | M/C | Mass-Labelled PCB Extraction Standard Solution/Mixture |
| PCB-ISS-H | M/C | Mass-Labelled PCB Recovery/Injection Standard Solution/Mixture |
| PCB-SCS-H | M/C | Mass-Labelled PCB Sampling/Cleanup Standard Solution/Mixture |
| PCB-PAR-H | M/C | Native PCB Solution/Mixture |
| PCB-CVS-A10 | M/C | Polychlorinated Biphenyl (PCB) Calibration Kit |
| PCB-LCS-A1 | M/C | Mass-Labelled PCB Extraction Standard Solution/Mixture |
| PCB-LCS-A100 | M/C | Mass-Labelled PCB Extraction Standard Solution/Mixture |
| PCB-LCS-A20 | M/C | Mass-Labelled PCB Extraction Standard Solution/Mixture |
| PCB-IS-A | M/C | Mass-Labelled PCB Injection Standard Solution |
| PCB-IS-A100 | M/C | Mass-Labelled PCB Injection Standard Solution |
| PCB-IS-A20 | M/C | Mass-Labelled PCB Injection Standard Solution |
| PCB-IS-B | M/C | Mass-Labelled PCB Injection Standard Solution/Mixture |
| PCB-IS-B100 | M/C | Mass-Labelled PCB Injection Standard Solution/Mixture |
| PCB-IS-B20 | M/C | Mass-Labelled PCB Injection Standard Solution/Mixture |
| PCB-IS-C | M/C | Mass-Labelled PCB Injection Standard Solution/Mixture |
| PCB-IS-C100 | M/C | Mass-Labelled PCB Injection Standard Solution/Mixture |
| PCB-IS-C20 | M/C | Mass-Labelled PCB Injection Standard Solution/Mixture |
| PCB-SS-A | M/C | Mass-Labelled PCB Sampling Standard Solution |
| PCB-SS-A100 | M/C | Mass-Labelled PCB Sampling Standard Solution |
| PCB-SS-A20 | M/C | Mass-Labelled PCB Sampling Standard Solution |
| BP-D7 | M/C | Native Dutch 7 PCB Solution/Mixture |
| MBP-D7 | M/C | Mass-Labelled Dutch 7 PCB Solution/Mixture |
| MBP-CP | M/C | Mass-Labelled Coplanar PCB Solution/Mixture |
| MBP-MO | M/C | Mass-Labelled Mono-Ortho PCB Solution/Mixture |
| MBP-CG | M/C | Mass-Labelled Cl1-Cl10 PCB Solution/Mixture |
| MBP-MXE | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-ST-A | M/C | Native PCB Stock Solution/Mixture |
| PCB-ST-A10 | M/C | Native PCB Stock Solution/Mixture |
| PCB-ST-A2 | M/C | Native PCB Stock Solution/Mixture |
| BP-CP81 | M/C | Native Coplanar PCB Solution/Mixture |
| BP-WD | M/C | PCB Window Defining Solution/Mixture (DB-5, HP-5MS, or equivalent) |
| BP-MO | M/C | Native Mono-Ortho PCB Solution/Mixture |
| BP-MS | M/C | Native PCB Solution/Mixture |
| BP-MS2 | M/C | Native PCB Solution/Mixture |
| BFR-CVS | M/C | Polybrominated Diphenyl Ether/Brominated Flame Retardant (PBDE/BFR) Calibration Kit (BDE-17 ≥96%) |
| BFR-LCS | M/C | Mass-Labelled PBDE/BFR Solution/Mixture |
| BFR-ISS | M/C | Mass-Labelled PBDE/BFR Internal/Injection Standard Solution/Mixture |
| BFR-SCS | M/C | Mass-Labelled PBDE/BFR Sampling/Cleanup Standard Solution |
| BFR-PAR | M/C | Native PBDE/BFR Stock Solution/Mixture (BDE-17 ≥96%) |
| BDE-MXE | M/C | Native PBDE Solution/Mixture |
| BDE-CVS-F | M/C | Polybrominated Diphenyl Ether (PBDE) Calibration Kit |
| MBDE-MXFS | M/C | Mass-Labelled PBDE Surrogate Stock Solution/Mixture |
| MBDE-MXFR | M/C | Mass-Labelled PBDE Recovery Stock Solution/Mixture |
| BDE-MXF | M/C | Native PBDE Stock Solution/Mixture |
| BDE-CVS-G | M/C | Polybrominated Diphenyl Ether (PBDE) Calibration Kit |
| MBDE-MXG | M/C | Mass-Labelled PBDE Solution/Mixture |
| MBDE-ISS-G | M/C | Mass-Labelled PBDE Internal Standard Solution/Mixture |
| BDE-1 | 7025-06-1 | 2-Bromodiphenyl ether Solution |
| BDE-2 | 6876-00-2 | 3-Bromodiphenyl ether Solution |
| BDE-3 | 101-55-3 | 4-Bromodiphenyl ether Solution |
| BDE-7 | 171977-44-9 | 2,4-Dibromodiphenyl ether Solution |
| BDE-10 | 51930-04-2 | 2,6-Dibromodiphenyl ether Solution |
| BDE-15 | 2050-47-7 | 4,4′-Dibromodiphenyl ether Solution |
| BDE-17 | 147217-75-2 | 2,2′,4-Tribromodiphenyl ether Solution |
| BDE-21 | 337513-67-4 | 2,3,4-Tribromodiphenyl ether Solution |
| BDE-28 | 41318-75-6 | 2,4,4′-Tribromodiphenyl ether Solution |
| BDE-30 | 155999-95-4 | 2,4,6-Tribromodiphenyl ether Solution |
| BDE-37 | 147217-81-0 | 3,4,4′-Tribromodiphenyl ether Solution |
| BDE-47 | 5436-43-1 | 2,2′,4,4′-Tetrabromodiphenyl ether Solution |
| BDE-49 | 243982-82-3 | 2,2′,4,5′-Tetrabromodiphenyl ether Solution |
| BDE-54 | N/A | 2,2′,6,6′-Tetrabromodiphenyl ether Solution |
| BDE-60 | 446254-31-5 | 2,3,4,4′-Tetrabromodiphenyl ether Solution |
| BDE-66 | 189084-61-5 | 2,3′,4,4′-Tetrabromodiphenyl ether Solution |
| BDE-71 | 189084-62-6 | 2,3′,4′,6-Tetrabromodiphenyl ether Solution |
| BDE-77 | 93703-48-1 | 3,3′,4,4′-Tetrabromodiphenyl ether Solution |
| BDE-82 | 327185-11-5 | 2,2′,3,3′,4-Pentabromodiphenyl ether Solution |
| BDE-85 | 182346-21-0 | 2,2′,3,4,4′-Pentabromodiphenyl ether Solution |
| BDE-99 | 60348-60-9 | 2,2′,4,4′,5-Pentabromodiphenyl ether Solution |
| BDE-100 | 189084-64-8 | 2,2′,4,4′,6-Pentabromodiphenyl ether Solution |
| BDE-104 | 446254-68-8 | 2,2′,4,6,6′-Pentabromodiphenyl ether Solution |
| BDE-105 | 373594-78-6 | 2,3,3′,4,4′-Pentabromodiphenyl ether Solution |
| BDE-119 | 189084-66-0 | 2,3′,4,4′,6-Pentabromodiphenyl ether Solution |
| BDE-126 | 366791-32-4 | 3,3′,4,4′,5-Pentabromodiphenyl ether Solution |
| BDE-128 | 182677-28-7 | 2,2′,3,3′,4,4′-Hexabromodiphenyl ether Solution |
| BDE-138 | 182677-30-1 | 2,2′,3,4,4′,5′-Hexabromodiphenyl ether Solution |
| BDE-139 | 446254-96-2 | 2,2′,3,4,4′,6-Hexabromodiphenyl ether Solution |
| BDE-140 | 243982-83-4 | 2,2′,3,4,4′,6′-Hexabromodiphenyl ether Solution |
| BDE-149 | N/A | 2,2′,3,4′,5′,6-Hexabromodiphenyl ether Solution |
| BDE-153 | 68631-49-2 | 2,2′,4,4′,5,5′-Hexabromodiphenyl ether Solution |
| BDE-154 | 207122-15-4 | 2,2′,4,4′,5,6′-Hexabromodiphenyl ether Solution |
| BDE-155 | 35854-94-5 | 2,2′,4,4′,6,6′-Hexabromodiphenyl ether Solution |
| BDE-156 | N/A | 2,3,3′,4,4′,5-Hexabromodiphenyl ether Solution |
| BDE-169 | 446255-18-1 | 3,3′,4,4′,5,5′-Hexabromodiphenyl ether Solution |
| BDE-170 | 327185-13-7 | 2,2′,3,3′,4,4′,5-Heptabromodiphenyl ether Solution |
| BDE-171 | 446255-19-2 | 2,2′,3,3′,4,4′,6-Heptabromodiphenyl ether Solution |
| BDE-175 | 446255-22-7 | 2,2′,3,3′,4,5′,6-Heptabromodiphenyl ether Solution |
| BDE-176 | 407606-61-5 | 2,2′,3,3′,4,6,6′-Heptabromodiphenyl ether Solution |
| BDE-177 | 446255-23-8 | 2,2′,3,3′,4′,5,6-Heptabromodiphenyl ether Solution |
| BDE-179 | 446255-25-0 | 2,2′,3,3′,5,6,6′-Heptabromodiphenyl ether Solution |
| BDE-180 | 446255-26-1 | 2,2′,3,4,4′,5,5′-Heptabromodiphenyl ether Solution |
| BDE-181 | 189084-67-1 | 2,2′,3,4,4′,5,6-Heptabromodiphenyl ether Solution |
| BDE-182 | 442690-45-1 | 2,2′,3,4,4′,5,6′-Heptabromodiphenyl ether Solution |
| BDE-183 | 207122-16-5 | 2,2′,3,4,4′,5′,6-Heptabromodiphenyl ether Solution |
| BDE-184 | 117948-63-7 | 2,2′,3,4,4′,6,6′-Heptabromodiphenyl ether Solution |
| BDE-188 | 116995-32-5 | 2,2′,3,4′,5,6,6′-Heptabromodiphenyl ether Solution |
| BDE-189 | 259087-35-9 | 2,3,3′,4,4′,5,5′-Heptabromodiphenyl ether Solution |
| BDE-191 | 446255-30-7 | 2,3,3′,4,4′,5′,6-Heptabromodiphenyl ether Solution |
| BDE-194 | 85446-17-9 | 2,2′,3,3′,4,4′,5,5′-Octabromodiphenyl ether Solution |
| BDE-195 | 446255-38-5 | 2,2′,3,3′,4,4′,5,6-Octabromodiphenyl ether Solution |
| BDE-196 | N/A | 2,2′,3,3′,4,4′,5,6′-Octabromodiphenyl ether Solution |
| BDE-197 | 117964-21-3 | 2,2′,3,3′,4,4′,6,6′-Octabromodiphenyl ether Solution |
| BDE-198 | 446255-42-1 | 2,2′,3,3′,4,5,5′,6-Octabromodiphenyl ether Solution |
| BDE-199 | 446255-43-2 | 2,2′,3,3′,4,5,5′,6′-Octabromodiphenyl ether Solution |
| BDE-200 | 446255-46-5 | 2,2′,3,3′,4,5,6,6′-Octabromodiphenyl ether Solution |
| BDE-201 | 446255-50-1 | 2,2′,3,3′,4,5′,6,6′-Octabromodiphenyl ether Solution |
| BDE-202 | 67797-09-5 | 2,2′,3,3′,5,5′,6,6′-Octabromodiphenyl ether Solution |
| BDE-203 | 337513-72-1 | 2,2′,3,4,4′,5,5′,6-Octabromodiphenyl ether Solution |
| BDE-204 | 446255-54-5 | 2,2′,3,4,4′,5,6,6′-Octabromodiphenyl ether Solution |
| BDE-205 | 446255-56-7 | 2,3,3′,4,4′,5,5′,6-Octabromodiphenyl ether Solution |
| BDE-206 | 63387-28-0 | 2,2′,3,3′,4,4′,5,5′,6-Nonabromodiphenyl ether Solution |
| BDE-207 | 437701-79-6 | 2,2′,3,3′,4,4′,5,6,6′-Nonabromodiphenyl ether Solution |
| BDE-208 | 437701-78-5 | 2,2′,3,3′,4,5,5′,6,6′-Nonabromodiphenyl ether Solution |
| BDE-209 | 1163-19-5 | Decabromodiphenyl ether Solution |
| 4PC-BDE-208 | 918947-03-2 | 2,2′,3,3′,4,5,5′,6,6′-Nonabromo-4′-chlorodiphenyl ether Solution |
| BDE-WD | M/C | PBDE Window Defining Solution/Mixture (DB-5HT, Rtx-1614, HP-5MS, or equivalent) |
| BDE-OND | M/C | Native Br8-Br10 PBDE Solution/Mixture |
| BDE-MXA | M/C | Native PBDE Solution/Mixture |
| BDE-MXB | M/C | Native PBDE Solution/Mixture |
| BDE-MXD | M/C | Native PBDE Solution/Mixture |
| MBDE-3 | 488710-15-2 | 4-Bromo(13C12)]diphenyl ether Solution |
| MBDE-15 | 488710-17-4 | 4,4′-Dibromo(13C12)diphenyl ether Solution |
| MBDE-28 | 488710-19-6 | 2,4,4′-Tribromo(13C12)diphenyl ether Solution |
| MBDE-47 | 488710-20-9 | 2,2′,4,4′-Tetrabromo(13C12)diphenyl ether Solution |
| MBDE-77 | 1401355-55-2 | 3,3′,4,4′-Tetrabromo(13C12)diphenyl ether Solution |
| MBDE-79 | N/A | 3,3′,4,5′-Tetrabromo(13C12)diphenyl ether Solution |
| MBDE-99 | 488710-21-0 | 2,2′,4,4′,5-Pentabromo(13C12)diphenyl ether Solution |
| MBDE-100 | 678997-41-6 | 2,2′,4,4′,6-Pentabromo(13C12)diphenyl ether Solution |
| MBDE-126 | 1401355-56-3 | 3,3′,4,4′,5-Pentabromo(13C12)diphenyl ether Solution |
| MBDE-138 | 1401355-57-4 | 2,2′,3,4,4′,5′-Hexabromo(13C12)diphenyl ether Solution |
| MBDE-139 | 488710-25-4 | 2,2′,3,4,4′,6-Hexabromo(13C12)diphenyl ether Solution |
| MBDE-153 | 488710-22-1 | 2,2′,4,4′,5,5′-Hexabromo(13C12)diphenyl ether Solution |
| MBDE-154 | 488710-23-2 | 2,2′,4,4′,5,6′-Hexabromo(13C12)diphenyl ether Solution |
| MBDE-169 | 1401355-58-5 | 3,3′,4,4′,5,5′-Hexabromo(13C12)diphenyl ether Solution |
| MBDE-180 | N/A | 2,2′,3,4,4′,5,5′-Heptabromo(13C12)diphenyl ether Solution |
| MBDE-183 | 488710-24-3 | 2,2′,3,4,4′,5′,6-Heptabromo(13C12)diphenyl ether Solution |
| MBDE-197 | 1367487-31-7 | 2,2′,3,3′,4,4′,6,6′-Octabromo(13C12)diphenyl ether Solution |
| MBDE-205 | 1401355-59-6 | 2,3,3′,4,4′,5,5′,6-Octabromo(13C12)diphenyl ether Solution |
| MBDE-206 | N/A | 2,2′,3,3′,4,4′,5,5′,6-Nonabromo(13C12)diphenyl ether Solution |
| MBDE-207 | 1367487-33-9 | 2,2′,3,3′,4,4′,5,6,6′-Nonabromo(13C12)diphenyl ether Solution |
| MBDE-209 | N/A | Decabromo(13C12)diphenyl ether Solution |
| MBDE-MXA | M/C | Mass-Labelled PBDE Solution/Mixture |
| MBDE-MXB | M/C | Mass-Labelled PBDE Solution/Mixture |
| MBDE-MXC | M/C | Mass-Labelled PBDE Solution/Mixture |
| TBDE-71 | 32534-81-9 | Great Lakes DE-71 Pentabromodiphenyl Oxide Solution/Mixture |
| TBDE-79 | 32536-52-0 | Great Lakes DE-79 Octabromodiphenyl Oxide Solution/Mixture |
| TBDE-83R | 1163-19-5 | Great Lakes DE-83 Decabromodiphenyl Oxide Solution/Mixture |
| 5MBDE47 | 602326-19-2 | 2,2′,4,4′-Tetrabromo-5-methoxydiphenyl ether Solution |
| 6MBDE47 | 102739-99-1 | 2,2′,4,4′-Tetrabromo-6-methoxydiphenyl ether Solution |
| 4PMBDE49 | 602326-26-1 | 2,2′,4′,5-Tetrabromo-4-methoxydiphenyl ether Solution |
| 2PMBDE68 | 96920-28-4 | 2′,3,4′,5-Tetrabromo-2-methoxydiphenyl ether Solution |
| 5PMBDE99 | 1013432-29-5 | 2,2′,4,4′,5-Pentabromo-5′-methoxydiphenyl ether Solution |
| 5PMBDE100 | 1185773-70-9 | 2,2′,4,4′,6′-Pentabromo-5-methoxydiphenyl ether Solution |
| 4PMBDE101 | 1185773-72-1 | 2,2′,4,5,5′-Pentabromo-4′-methoxydiphenyl ether Solution |
| 4PMBDE103 | 1185773-71-0 | 2,2′,4′,5,6′-Pentabromo-4-methoxydiphenyl ether Solution |
| MeOBDES | M/C | Native Methoxy-PBDE Solution/Mixture |
| M6MBDE47 | N/A | 2,2′,4,4′-Tetrabromo-6-methoxy(13C12)diphenyl ether Solution |
| M6PMBDE100 | N/A | 2,2′,4,4′,6-Pentabromo-6′-methoxy(13C12)diphenyl ether Solution |
| M6HBDE47 | N/A | 2,2′,4,4′-Tetrabromo-6-hydroxy(13C12)diphenyl ether Solution |
| M6PHBDE100 | N/A | 2,2′,4,4′,6-Pentabromo-6′-hydroxy(13C12)diphenyl ether Solution |
| aHBCD | 134237-50-6 | rac-alpha-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| bHBCD | 134237-51-7 | rac-beta-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| gHBCD | 134237-52-8 | rac-gamma-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| dHBCD | 65701-47-5 | delta-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| eHBCD | 4736-49-6 | epsilon-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| zHBCD | 878049-06-0 | zeta-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| etaHBCD | 1392102-29-2 | rac-eta-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| tHBCD | 878049-07-1 | theta-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| iHBCD | 1392102-30-5 | rac-iota-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| kHBCD | 1392102-31-6 | rac-kappa-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| MaHBCD | 870247-98-6 | rac-alpha-1,2,5,6,9,10-Hexabromo(13C12)cyclododecane Solution |
| MbHBCD | 870248-00-3 | rac-beta-1,2,5,6,9,10-Hexabromo(13C12)cyclododecane Solution |
| MgHBCD | 676552-82-2 | rac-gamma-1,2,5,6,9,10-Hexabromo(13C12)cyclododecane Solution |
| DaHBCD | 870247-99-7 | d18-rac-alpha-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| DbHBCD | 870248-01-4 | d18-rac-beta-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| DgHBCD | 676552-83-3 | d18-rac-gamma-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| HBCD-MXA | M/C | Native HBCD Isomers (alpha, beta, gamma) Solution/Mixture |
| MHBCD-MXA | M/C | Mass-Labelled HBCD Isomers (alpha, beta, gamma) Solution/Mixture |
| PBCD | N/A | rac-(1,5R,6S,9S,10R)-Pentabromocyclododecene Solution |
| TBBPA | 79-94-7 | 3,3′,5,5′-Tetrabromobisphenol A Solution |
| MTBBPA | 1352876-39-1 | 3,3′,5,5′-Tetrabromobisphenol A (13C12-rings) Solution |
| DBDPE | 84852-53-9 | 1,2-Bis(pentabromophenyl)ethane Solution |
| MDBDPE | N/A | 1,2-Bis(pentabromophenyl)ethane (13C14) Solution |
| BTBPE | 37853-59-1 | 1,2-Bis(2,4,6-tribromophenoxy)ethane Solution |
| MBTBPE | N/A | 1,2-Bis(2,4,6-tribromo(13C6)phenoxy)ethane Solution |
| HBBZ | 87-82-1 | Hexabromobenzene Solution |
| MHBBZ | 2483735-50-6 | Hexabromo(13C6)benzene Solution |
| PBBZ | 608-90-2 | Pentabromobenzene Solution |
| MPBBZ | N/A | Pentabromo(13C6)benzene Solution |
| PBEB | 85-22-3 | Pentabromoethylbenzene Solution |
| PBT | 87-83-2 | Pentabromotoluene Solution |
| pTBX | 23488-38-2 | 2,3,5,6-Tetrabromo-p-xylene Solution |
| aTBCO | 3194-57-8 | (1R,2R,5S,6S)-1,2,5,6-Tetrabromocyclooctane Solution |
| bTBCO | 3194-57-8 | rac-(1R,2R,5R,6R)-1,2,5,6-Tetrabromocyclooctane Solution |
| bTBECH | 3322-93-8 | rac-(1R,2R)-1,2-Dibromo-(4S)-4-((1S)-1,2-dibromoethyl)cyclohexane Solution |
| gTBECH | 3322-93-8 | rac-(1R,2R)-1,2-Dibromo-(4R)-4-((1R)-1,2-dibromoethyl)cyclohexane Solution |
| abTBECH | 3322-93-8 | TBECH Isomers (alpha, beta) Solution/Mixture |
| gdTBECH | 3322-93-8 | TBECH Isomers (gamma, delta) Solution/Mixture |
| OBIND | 155613-93-7 | Octabromotrimethylphenylindane Solution |
| BEHTBP | 26040-51-7 | Bis(2-ethyl-1-hexyl) tetrabromophthalate Solution |
| MBEHTBP | N/A | Bis[2-(2H5)ethyl(2H12)hexyl] tetrabromo(13C6)phthalate Solution |
| EHTBB | 183658-27-7 | rac-2-Ethylhexyl 2,3,4,5-tetrabromobenzoate Solution |
| MEHTBB | N/A | rac-2-(2H5)Ethyl(2H12)hexyl 2,3,4,5-tetrabromo(13C6)benzoate Solution |
| HCDBCO | 51936-55-1 | Hexachlorocyclopentenyl-dibromocyclooctane Solution |
| TBCT | 39569-21-6 | Tetrabromo-o-chlorotoluene Solution |
| PBBA | 59447-55-1 | Pentabromobenzyl acrylate Solution |
| ATE | 3278-89-5 | Allyl 2,4,6-tribromophenyl ether Solution |
| DPTE | 35109-60-5 | 2,3-Dibromopropyl 2,4,6-tribromophenyl ether Solution |
| BATE | 99717-56-3 | 2-Bromoallyl 2,4,6-tribromophenyl ether Solution |
| s-DP | 135821-03-3 | syn-Dechlorane Plus Solution |
| a-DP | 135821-74-8 | anti-Dechlorane Plus Solution |
| aCl10DP | 1632364-26-1 | anti-Cl10-Dechlorane Plus Solution |
| aCl11DP | 1258787-06-2 | anti-Cl11-Dechlorane Plus Solution |
| DPMA(1,5-DPMA) | 10297-21-9 | 1,5-Dechlorane Plus monoadduct Solution |
| 1,3-DPMA | 70267-37-7 | 1,3-Dechlorane Plus monoadduct Solution |
| DBCD | 18300-04-4 | Dibromochlordene Solution |
| Dec-601 | 13560-90-2 | Dechlorane 601 Solution |
| Dec-602 | 31107-44-5 | Dechlorane 602 Solution |
| Dec-603 | 13560-92-4 | Dechlorane 603 Solution |
| Dec-604 | 34571-16-9 | Dechlorane 604 Solution |
| Dec-604CB | 56890-89-2 | Dechlorane 604 Component B Solution |
| CPlus | 13560-91-3 | Chlordene Plus Solution |
| DBALD | 1482458-57-0 | Dibromoaldrin Solution |
| HCPN | N/A | Hexachloro(phenyl)norbornene Solution |
| T23BPIC | 52434-90-9 | Tris(2,3-dibromopropyl)isocyanurate Solution |
| TBBA | 27581-13-1 | 2,3,4,5-Tetrabromobenzoic acid Solution (with 4 mole eq. NaOH) |
| MeTBBA | 1448844-87-8 | Methyl-2,3,4,5-tetrabromobenzoate Solution |
| MTBBA | 2710628-49-0 | 2,3,4,5-Tetrabromobenzoic acid (13C6-ring) Solution (with 4 mole eq. NaOH) |
| BDCP | 72236-72-7 | Bis(1,3-dichloro-2-propyl) phosphate Solution |
| TPP | 115-86-6 | Triphenyl phosphate Solution |
| TOTP | 78-30-8 | Tri-o-tolyl phosphate Solution |
| TMTP | 563-04-2 | Tri-m-tolyl phosphate Solution |
| TPTP | 78-32-0 | Tri-p-tolyl phosphate Solution |
| B2tBPPP | 65652-41-7 | Bis(2-tert-butylphenyl) phenyl phosphate Solution |
| B4tBPPP | 115-87-7 | Bis(4-tert-butylphenyl) phenyl phosphate Solution |
| 2tBPDPP | N/A | 2-tert-Butylphenyl diphenyl phosphate Solution |
| 4tBPDPP | 981-40-8 | 4-tert-Butylphenyl diphenyl phosphate Solution |
| T4tBPP | 78-33-1 | Tris(4-tert-butylphenyl) phosphate Solution |
| T2IPPP | 64532-95-2 | Tris(2-isopropylphenyl) phosphate Solution |
| T3IPPP | 72668-27-0 | Tris(3-isopropylphenyl) phosphate Solution |
| T4IPPP | 2502-15-0 | Tris(4-isopropylphenyl) phosphate Solution |
| T34DMPP | 3862-11-1 | Tris(3,4-dimethylphenyl) phosphate Solution |
| T35DMPP | 25653-16-1 | Tris(3,5-dimethylphenyl) phosphate Solution |
| B24DIPPPP | 2190501-29-0 | Bis(2,4-diisopropylphenyl) phenyl phosphate Solution |
| B2IPPPP | 69500-29-4 | Bis(2-isopropylphenyl) phenyl phosphate Solution |
| B4IPPPP | 55864-07-8 | Bis(4-isopropylphenyl) phenyl phosphate Solution |
| 2IPPDPP | 64532-94-1 | 2-Isopropylphenyl diphenyl phosphate Solution |
| 4IPPDPP | 55864-04-5 | 4-Isopropylphenyl diphenyl phosphate Solution |
| 24DIPPDPP | 96107-55-0 | 2,4-Diisopropylphenyl diphenyl phosphate Solution |
| MTPP | N/A | (13C18)Triphenyl phosphate Solution |
| TEP | 78-40-0 | Tri-ethyl phosphate Solution |
| TPrP | 513-08-6 | Tri-n-propyl phosphate Solution |
| TBP | 126-73-8 | Tri-n-butyl phosphate Solution |
| TBEP | 78-51-3 | Tris(2-butoxyethyl) phosphate Solution |
| TDBPP | 126-72-7 | Tris(2,3-dibromopropyl) phosphate Solution |
| EHDP | 1241-94-7 | 2-Ethylhexyl diphenyl phosphate Solution |
| TEHP | 78-42-2 | Tris(2-ethylhexyl) phosphate Solution |
| TCEP | 115-96-8 | Tris(2-chloroethyl) phosphate Solution |
| TCPP | 13674-84-5 | Tris[(2R)-1-chloro-2-propyl] phosphate Solution |
| TDCPP | 13674-87-8 | Tris(1,3-dichloro-2-propyl) phosphate Solution |
| M6TBEP | N/A | Tris(2-butoxy-(13C2)-ethyl) phosphate Solution |
| dTEP | 135942-11-9 | Tri-ethyl phosphate-d15 Solution |
| dTPrP | 1219794-92-9 | Tri-n-propyl phosphate-d21 Solution |
| dTBP | 61196-26-7 | Tri-n-butyl phophate-d27 Solution |
| dTPP | 1173020-30-8 | Triphenyl phosphate-d15 Solution |
| dTCEP | 1276500-47-0 | Tris(2-chloroethyl) phosphate-d12 Solution |
| dTDCPP | 1447569-77-8 | Tris(1,3-dichloro-2-propyl) phophate-d15 Solution |
| dBDCP | N/A | Bis(1,3-dichloro-2-propyl) phosphate-d10 Solution |
| BB-1 | 2052-07-5 | 2-Bromobiphenyl Solution |
| BB-2 | 2113-57-7 | 3-Bromobiphenyl Solution |
| BB-3 | 92-66-0 | 4-Bromobiphenyl Solution |
| BB-4 | 13029-09-9 | 2,2′-Dibromobiphenyl Solution |
| BB-7 | 53592-10-2 | 2,4-Dibromobiphenyl Solution |
| BB-9 | 57422-77-2 | 2,5-Dibromobiphenyl Solution |
| BB-10 | 59080-32-9 | 2,6-Dibromobiphenyl Solution |
| BB-15 | 92-86-4 | 4,4′-Dibromobiphenyl Solution |
| BB-18 | 59080-34-1 | 2,2′,5-Tribromobiphenyl Solution |
| BB-22 | N/A | 2,3,4′-Tribromobiphenyl Solution |
| BB-26 | 59080-35-2 | 2,3′,5-Tribromobiphenyl Solution |
| BB-29 | 115245-07-3 | 2,4,5-Tribromobiphenyl Solution |
| BB-30 | 59080-33-0 | 2,4,6-Tribromobiphenyl Solution |
| BB-31 | 59080-36-3 | 2,4′,5-Tribromobiphenyl Solution |
| BB-37 | 6683-35-8 | 3,4,4′-Tribromobiphenyl Solution |
| BB-38 | 115245-08-4 | 3,4,5-Tribromobiphenyl Solution |
| BB-49 | 60044-24-8 | 2,2′,4,5′-Tetrabromobiphenyl Solution |
| BB-52 | 59080-37-4 | 2,2′,5,5′-Tetrabromobiphenyl Solution |
| BB-53 | 60044-25-9 | 2,2′,5,6′-Tetrabromobiphenyl Solution |
| BB-56 | N/A | 2,3,3′,4′-Tetrabromobiphenyl Solution |
| BB-75 | 64258-02-2 | 2,4,4′,6-Tetrabromobiphenyl Solution |
| BB-77 | 77102-82-0 | 3,3′,4,4′-Tetrabromobiphenyl Solution |
| BB-80 | 16400-50-3 | 3,3′,5,5′-Tetrabromobiphenyl Solution |
| BB-101 | 67888-96-4 | 2,2′,4,5,5′-Pentabromobiphenyl Solution |
| BB-103 | 59080-39-6 | 2,2′,4,5′,6-Pentabromobiphenyl Solution |
| BB-153 | 59080-40-9 | 2,2′,4,4′,5,5′-Hexabromobiphenyl Solution |
| BB-154 | 36402-15-0 | 2,2′,4,4′,5,6′-Hexabromobiphenyl Solution |
| BB-155 | 59261-08-4 | 2,2′,4,4′,6,6′-Hexabromobiphenyl Solution |
| BB-156 | 77607-09-1 | 2,3,3′,4,4′,5-Hexabromobiphenyl Solution |
| BB-169 | 60044-26-0 | 3,3′,4,4′,5,5′-Hexabromobiphenyl Solution |
| BB-180 | 67733-52-2 | 2,2′,3,4,4′,5,5′-Heptabromobiphenyl Solution |
| BB-194 | 67889-00-3 | 2,2′,3,3′,4,4′,5,5′-Octabromobiphenyl Solution |
| BB-205 | 915039-12-2 | 2,3,3′,4,4′,5,5′,6-Octabromobiphenyl Solution |
| BB-206 | 69278-62-2 | 2,2′,3,3′,4,4′,5,5′,6-Nonabromobiphenyl Solution |
| BB-209 | 13654-09-6 | Decabromobiphenyl Solution |
| PBB-MXA | M/C | Native PBB Solution/Mixture |
| TBB-BP6 | 59536-65-1 | Great Lakes Firemaster BP-6 Hexabromobiphenyl Solution/Mixture |
| TBB-809D | 27753-52-2 | Chemische Fabrik Kalk Bromkal 80-9D Nonabromobiphenyl Solution/Mixture |
| MBB-52 | 1401248-99-4 | 2,2′,5,5′-Tetrabromo(13C12)biphenyl Solution |
| MBB-153 | 1401249-00-0 | 2,2′,4,4′,5,5′-Hexabromo(13C12)biphenyl Solution |
| MBB-194 | 1401249-01-1 | 2,2′,3,3′,4,4′,5,5′-Octabromo(13C12)biphenyl Solution |
| MBB-209 | N/A | Decabromo(13C12)biphenyl Solution |
| MBB-MXA | M/C | Mass-Labelled PBB Solution/Mixture |
| BDD-1 | 105908-71-2 | 1-Bromodibenzo-p-dioxin Solution |
| BDD-27/28 | 39073-07-9; 105836-96-2 |
2,7/2,8-Dibromodibenzo-p-dioxin Solution/Mixture |
| BDD-237 | 51974-40-4 | 2,3,7-Tribromodibenzo-p-dioxin Solution |
| BDD-1378 | 109333-31-5 | 1,3,7,8-Tetrabromodibenzo-p-dioxin Solution |
| BDD-2378 | 50585-41-6 | 2,3,7,8-Tetrabromodibenzo-p-dioxin Solution |
| BDD-12378 | 109333-34-8 | 1,2,3,7,8-Pentabromodibenzo-p-dioxin Solution |
| BDD-12478 | 109333-35-9 | 1,2,4,7,8-Pentabromodibenzo-p-dioxin Solution |
| BDD-1234678 | 110999-47-8 | 1,2,3,4,6,7,8-Heptabromodibenzo-p-dioxin Solution |
| BDD-12346789 | 2170-45-8 | Octabromodibenzo-p-dioxin Solution |
| MBDD-2378 | N/A | 2,3,7,8-Tetrabromo(13C12)dibenzo-p-dioxin Solution |
| BDF-4 | 89827-45-2 | 4-Bromodibenzofuran Solution |
| BDF-24 | 133953-36-3 | 2,4-Dibromodibenzofuran Solution |
| BDF-28 | 10016-52-1 | 2,8-Dibromodibenzofuran Solution |
| BDF-138 | 142408-19-3 | 1,3,8-Tribromodibenzofuran Solution |
| BDF-234 | 617707-50-3 | 2,3,4-Tribromodibenzofuran Solution |
| BDF-238 | 84761-82-0 | 2,3,8-Tribromodibenzofuran Solution |
| BDF-247 | 617707-53-6 | 2,4,7-Tribromodibenzofuran Solution |
| BDF-1278 | 84761-80-8 | 1,2,7,8-Tetrabromodibenzofuran Solution |
| BDF-2378 | 67733-57-7 | 2,3,7,8-Tetrabromodibenzofuran Solution |
| BDF-12378 | 107555-93-1 | 1,2,3,7,8-Pentabromodibenzofuran Solution |
| BDF-23478 | 131166-92-2 | 2,3,4,7,8-Pentabromodibenzofuran Solution |
| BDF-1234678 | 107555-95-3 | 1,2,3,4,6,7,8-Heptabromodibenzofuran Solution |
| BDF-12346789 | 103582-29-2 | Octabromodibenzofuran Solution |
| 7-B-23-CDD | 97741-74-7 | 7-Bromo-2,3-dichlorodibenzo-p-dioxin Solution (≥97%) |
| 2-B-378-CDD | 109333-33-7 | 2-Bromo-3,7,8-trichlorodibenzo-p-dioxin Solution (≥95%) |
| 2-B-1378-CDD | 131167-13-0 | 2-Bromo-1,3,7,8-tetrachlorodibenzo-p-dioxin Solution (≥95%) |
| 23-B-78-CDD | 50585-40-5 | 2,3-Dibromo-7,8-dichlorodibenzo-p-dioxin Solution |
| M23-B-78-CDD | N/A | 2,3-Dibromo-7,8-dichloro(13C12)dibenzo-p-dioxin Solution |
| 8-B-23-CDF | 103124-75-0 | 8-Bromo-2,3-dichlorodibenzofuran Solution |
| 3-B-278-CDF | 131166-87-5 | 3-Bromo-2,7,8-trichlorodibenzofuran Solution |
| 8-B-234-CDF | 103124-72-7 | 8-Bromo-2,3,4-trichlorodibenzofuran Solution |
| 4-B-2378-CDF | 115656-08-1 | 4-Bromo-2,3,7,8-tetrachlorodibenzofuran Solution |
| 12-B-78-CDF | N/A | 1,2-Dibromo-7,8-dichlorodibenzofuran Solution |
| 23-B-78-CDF | 131166-88-6 | 2,3-Dibromo-7,8-dichlorodibenzofuran Solution |
| 13-B-278-CDF | 1353756-40-7 | 1,3-Dibromo-2,7,8-trichlorodibenzofuran Solution |
| M8-B-23-CDF | N/A | 8-Bromo-2,3-dichloro(13C12)dibenzofuran Solution |
| M3-B-278-CDF | N/A | 3-Bromo-2,7,8-trichloro(13C12)dibenzofuran Solution |
| M4-B-2378-CDF | N/A | 4-Bromo-2,3,7,8-tetrachloro(13C12)dibenzofuran Solution |
| M23-B-78-CDF | N/A | 2,3-Dibromo-7,8-dichloro(13C12)dibenzofuran Solution |
| M13-B-278-CDF | N/A | 1,3-Dibromo-2,7,8-trichloro(13C12)dibenzofuran Solution |
| PFC-CVS-C | M/C | Perfluoroalkylcarboxylic Acid/Perfluoroalkanesulfonate (PFCA/PFSA) PFAS Calibration Kit (with 4 mole eq. NaOH) |
| MPFAC-C-ES | M/C | Mass-Labelled PFCA/PFSA (PFAS) Extraction Standard Solution/Mixture (with 4 mole eq. NaOH) |
| MPFAC-C-IS | M/C | Mass-Labelled PFCA/PFSA (PFAS) Injection Standard Solution/Mixture (with 4 mole eq. NaOH) |
| PFAC-MXC | M/C | Native PFCA/PFSA (PFAS) Stock Solution/Mixture (with 4 mole eq. NaOH) |
| L-PFPrS | 359868-82-9 | Sodium perfluoro-1-propanesulfonate Solution |
| L-PFBS | 29420-49-3 | Potassium perfluoro-1-butanesulfonate Solution |
| L-PFPeS | N/A | Sodium perfluoro-1-pentanesulfonate Solution |
| L-PFHxS | 82382-12-5 | Sodium perfluoro-1-hexanesulfonate Solution |
| br-PFHxSK | M/C | Potassium perfluorohexanesulfonate Solution/Mixture of Linear and Branched Isomers |
| L-PFHpS | 21934-50-9 | Sodium perfluoro-1-heptanesulfonate Solution |
| NaP3MHpS | 1202827-34-6 | Sodium perfluoro-3-methylheptanesulfonate Solution |
| NaP6MHpS | 1202827-38-0 | Sodium perfluoro-6-methylheptanesulfonate Solution |
| L-PFOS | 4021-47-0 | Sodium perfluoro-1-octanesulfonate Solution |
| L-PFOSK | 2795-39-3 | Potassium perfluoro-1-octanesulfonate Solution |
| br-PFOSK | M/C | Potassium perfluorooctanesulfonate Solution/Mixture of Linear and Branched Isomers |
| T-PFOS | N/A | Potassium perfluorooctanesulfonate (Technical Grade) Solution/Mixture |
| 8Cl-PFOS | 2481740-05-8 | Sodium 8-chloroperfluoro-1-octanesulfonate Solution |
| L-PFNS | 98789-57-2 | Sodium perfluoro-1-nonanesulfonate Solution |
| ipPFNS | 1383788-15-5 | Sodium perfluoro-7-methyloctanesulfonate Solution |
| L-PFDS | 2806-15-7 | Sodium perfluoro-1-decanesulfonate Solution |
| L-PFDoS | 1260224-54-1 | Sodium perfluoro-1-dodecanesulfonate Solution |
| M3PFBS | 2708218-84-0 | Sodium perfluoro-1-(2,3,4-13C3)butanesulfonate Solution |
| MPFHxS | N/A | Sodium perfluoro-1-hexane(18O2)sulfonate Solution |
| M3PFHxS | 2708218-86-2 | Sodium perfluoro-1-(1,2,3-13C3)hexanesulfonate Solution |
| MPFOS | 960315-53-1 | Sodium perfluoro-1-(1,2,3,4-13C4)octanesulfonate Solution |
| M8PFOS | 2522762-16-7 | Sodium perfluoro-(13C8)octanesulfonate Solution |
| PFBA | 375-22-4 | Perfluoro-n-butanoic acid Solution (with 4 mole eq. NaOH) |
| PFPeA | 2706-90-3 | Perfluoro-n-pentanoic acid Solution (with 4 mole eq. NaOH) |
| PFHxA | 307-24-4 | Perfluoro-n-hexanoic acid Solution (with 4 mole eq. NaOH) |
| PFHpA | 375-85-9 | Perfluoro-n-heptanoic acid Solution (with 4 mole eq. NaOH) |
| PFOA | 335-67-1 | Perfluoro-n-octanoic acid Solution (with 4 mole eq. NaOH) |
| T-PFOA | 3825-26-1 | Ammonium perfluorooctanoate (Technical Grade) Solution/Mixture (with 4 mole eq. NaOH) |
| P3MHpA | 705240-04-6 | Perfluoro-3-methylheptanoic acid Solution (with 4 mole eq. NaOH) |
| PFNA | 375-95-1 | Perfluoro-n-nonanoic acid Solution (with 4 mole eq. NaOH) |
| P4MOA | N/A | Perfluoro-4-methyloctanoic acid Solution (with 4 mole eq. NaOH) |
| ipPFNA | 15899-31-7 | Perfluoro-7-methyloctanoic acid Solution (with 4 mole eq. NaOH) |
| P355TMHxA | 238403-51-5 | Perfluoro-3,5,5-trimethylhexanoic acid Solution (with 4 mole eq. NaOH) |
| PFDA | 335-76-2 | Perfluoro-n-decanoic acid Solution (with 4 mole eq. NaOH) |
| P37DMOA | 172155-07-6 | Perfluoro-3,7-dimethyloctanoic acid Solution (with 4 mole eq. NaOH) |
| PFUdA | 2058-94-8 | Perfluoro-n-undecanoic acid Solution (with 4 mole eq. NaOH) |
| PFDoA | 307-55-1 | Perfluoro-n-dodecanoic acid Solution (with 4 mole eq. NaOH) |
| PFTrDA | 72629-94-8 | Perfluoro-n-tridecanoic acid Solution (with 4 mole eq. NaOH) |
| PFTeDA | 376-06-7 | Perfluoro-n-tetradecanoic acid Solution (with 4 mole eq. NaOH) |
| PFHxDA | 67905-19-5 | Perfluoro-n-hexadecanoic acid Solution (with 4 mole eq. NaOH) |
| PFODA | 16517-11-6 | Perfluoro-n-octadecanoic acid Solution (with 4 mole eq. NaOH) |
| M3PFBA | 2483735-33-5 | Perfluoro-n-(2,3,4-13C3)butanoic acid Solution (with 4 mole eq. NaOH) |
| MPFBA | 1017281-29-6 | Perfluoro-n-(1,2,3,4-13C4)butanoic acid Solution (with 4 mole eq. NaOH) |
| M3PFPeA | N/A | Perfluoro-n-(3,4,5-13C3)pentanoic acid Solution (with 4 mole eq. NaOH) |
| M5PFPeA | 2283397-79-3 | Perfluoro-n-(1,2,3,4,5-13C5)pentanoic acid Solution (with 4 mole eq. NaOH) |
| MPFHxA | 960315-47-3 | Perfluoro-n-(1,2-13C2)hexanoic acid Solution (with 4 mole eq. NaOH) |
| M5PFHxA | 2328024-54-8 | Perfluoro-n-(1,2,3,4,6-13C5)hexanoic acid Solution (with 4 mole eq. NaOH) |
| M4PFHpA | 2328024-55-9 | Perfluoro-n-(1,2,3,4-13C4)heptanoic acid Solution (with 4 mole eq. NaOH) |
| M2PFOA | 864071-08-9 | Perfluoro-n-(1,2-13C2)octanoic acid Solution (with 4 mole eq. NaOH) |
| MPFOA | N/A | Perfluoro-n-(1,2,3,4-13C4)octanoic acid Solution (with 4 mole eq. NaOH) |
| M8PFOA | 1350614-84-4 | Perfluoro-n-(13C8)octanoic acid Solution (with 4 mole eq. NaOH) |
| MPFNA | 960315-49-5 | Perfluoro-n-(1,2,3,4,5-13C5)nonanoic acid Solution (with 4 mole eq. NaOH) |
| M9PFNA | 2283397-80-6 | Perfluoro-n-(13C9)nonanoic acid Solution (with 4 mole eq. NaOH) |
| MPFDA | 960315-50-8 | Perfluoro-n-(1,2-13C2)decanoic acid Solution (with 4 mole eq. NaOH) |
| M6PFDA | 2328024-56-0 | Perfluoro-n-(1,2,3,4,5,6-13C6)decanoic acid Solution (with 4 mole eq. NaOH) |
| MPFUdA | 960315-51-9 | Perfluoro-n-(1,2-13C2)undecanoic acid Solution (with 4 mole eq. NaOH) |
| M7PFUdA | N/A | Perfluoro-n-(1,2,3,4,5,6,7-13C7)undecanoic acid Solution (with 4 mole eq. NaOH) |
| MPFDoA | 960315-52-0 | Perfluoro-n-(1,2-13C2)dodecanoic acid Solution (with 4 mole eq. NaOH) |
| M2PFTeDA | 2708218-82-8 | Perfluoro-n-(1,2-13C2)tetradecanoic acid Solution (with 4 mole eq. NaOH) |
| M2PFHxDA | N/A | Perfluoro-n-(1,2-13C2)hexadecanoic acid Solution (with 4 mole eq. NaOH) |
| PFC-MXA | M/C | Native Perfluoroalkylcarboxylic acid (PFCA) Solution/Mixture (with 4 mole eq. NaOH) |
| PFS-MXA | M/C | Native Perfluoroalkanesulfonate (PFSA) Solution/Mixture |
| PFAC-MXA | M/C | Native PFAS Solution/Mixture (with 4 mole eq. NaOH) |
| PFAC-MXB | M/C | Native PFAS Solution/Mixture (with 4 mole eq. NaOH) |
| PFAC-24PAR | M/C | Native PFAS Precision and Recovery Standard Solution/Mixture (with 4 mole eq. NaOH) |
| MPFAC-MXA | M/C | Mass-Labelled PFAS Solution/Mixture (with 4 mole eq. NaOH) |
| EPA-537SS-R1 | M/C | U.S. EPA Method 537.1 PFAS Surrogate Primary Dilution Standard (SUR PDS) Solution/Mixture (with 4 mole eq. NaOH) |
| EPA-537IS | M/C | U.S. EPA Method 537.1 PFAS Internal Standard Primary Dilution Standard (IS PDS) Solution/Mixture (with 4 mole eq. NaOH) |
| MPFAC-24ES | M/C | Mass-Labelled PFAS Extraction Standard Solution/Mixture (with 4 mole eq. NaOH) |
| P3MHpS | M/C | Perfluoro-3-methylheptane sulfonate/Perfluoro-3-methylheptanoic acid Solution/Mixture (with 4 mole eq. NaOH) |
| P4MHpS | M/C | Perfluoro-4-methylheptane sulfonate/Perfluoro-4-methylheptanoic acid Solution/Mixture (with 4 mole eq. NaOH) |
| P5MHpS | M/C | Perfluoro-5-methylheptane sulfonate/Perfluoro-5-methylheptanoic acid Solution/Mixture (with 4 mole eq. NaOH) |
| P6MHpS | M/C | Perfluoro-6-methylheptane sulfonate/Perfluoro-6-methylheptanoic acid Solution/Mixture (with 4 mole eq. NaOH) |
| P55DMHxS | M/C | Perfluoro-5,5-dimethylhexane sulfonate/Perfluoro-5,5-dimethylhexanoic acid Solution/Mixture (with 4 mole eq. NaOH) |
| P45DMHxS | M/C | Perfluoro-4,5-dimethylhexane sulfonate/Perfluoro-4,5-dimethylhexanoic acid/Perfluoro-3,5-dimethylhexane sulfonate/Perfluoro-3,5-dimethylhexanoic acid Solution/Mixture (with 4 mole eq. NaOH) |
| FOSA-I | 754-91-6 | Perfluoro-1-octanesulfonamide Solution |
| N-MeFOSA-M | 31506-32-8 | N-Methylperfluoro-1-octansulfonamide Solution |
| N,N-Me2FOSA-M | 213181-78-3 | N,N-Dimethylperfluoro-1-octanesulfonamide Solution |
| N-EtFOSA-M | 4151-50-2 | N-Ethylperfluoro-1-octanesulfonamide Solution |
| M8FOSA-I | N/A | Perfluoro-1-(13C8)octanesulfonamide Solution |
| d-N-MeFOSA-M | 936109-37-4 | N-Methyl-d3-perfluoro-1-octanesulfonamide Solution |
| d-N-EtFOSA-M | 936109-40-9 | N-Ethyl-d5-perfluoro-1-octanesulfonamide Solution |
| N-MeFOSE-M | 24448-09-7 | 2-(N-Methylperfluoro-1-octanesulfonamido)ethanol Solution |
| N-EtFOSE-M | 1691-99-2 | 2-(N-Ethylperfluoro-1-octanesulfonamido)ethanol Solution |
| d7-N-MeFOSE-M | 1265205-95-5 | 2-(N-Methyl-d3-perfluoro-1-octanesulfonamido)ethan-d4-ol Solution |
| d9-N-EtFOSE-M | 1265205-96-6 | 2-(N-Ethyl-d5-perfluoro-1-octanesulfonamido)ethan-d4-ol Solution |
| FOSAA | 2806-24-8 | Perfluoro-1-octanesulfonamidoacetic acid Solution (with 4 mole eq. NaOH) |
| N-MeFOSAA | 2355-31-9 | N-Methylperfluoro-1-octanesulfonamidoacetic acid Solution (with 4 mole eq. NaOH) |
| N-EtFOSAA | 2991-50-6 | N-Ethylperfluoro-1-octanesulfonamidoacetic acid Solution (with 4 mole eq. NaOH) |
| d3-N-MeFOSAA | N/A | N-Methyl-d3-perfluoro-1-octanesulfonamidoacetic acid Solution (with 4 mole eq. NaOH) |
| d5-N-EtFOSAA | 1265205-97-7 | N-Ethyl-d5-perfluoro-1-octanesulfonamidoacetic acid Solution (with 4 mole eq. NaOH) |
| FBET | 2043-47-2 | 2-Perfluorobutyl ethanol (4:2 FTOH) Solution |
| 5:2sFTOH | 914637-05-1 | 1-Perfluoropentyl ethanol (5:2 secondary FTOH) Solution |
| FHET | 647-42-7 | 2-Perfluorohexyl ethanol (6:2 FTOH) Solution |
| 7:2sFTOH | 24015-83-6 | 1-Perfluoroheptyl ethanol (7:2 secondary FTOH) Solution |
| FOET | 678-39-7 | 2-Perfluorooctyl ethanol (8:2 FTOH) Solution |
| FDET | 865-86-1 | 2-Perfluorodecyl ethanol (10:2 FTOH) Solution |
| MFBET | N/A | 2-Perfluorobutyl (1,1,2,2-2H4)ethanol (2H4-4:2 FTOH) Solution (≥97%) |
| MFHET | 872398-72-6 | 2-Perfluorohexyl (1,1-2H2,1,2-13C2)ethanol (2H2,13C2-6:2 FTOH) Solution |
| M2FHET | N/A | 2-Perfluorohexyl (1,2-13C2)ethanol (13C2-6:2 FTOH) Solution (≥96%) |
| MFOET | 872398-73-7 | 2-Perfluorooctyl (1,1-2H2, 1,2-13C2)ethanol (2H2,13C2-8:2 FTOH) Solution |
| M2FOET | N/A | 2-Perfluorooctyl (13C2)ethanol (13C2-8:2 FTOH) Solution |
| MFDET | 872398-74-8 | 2-Perfluorodecyl (1,1-2H2, 1,2-13C2)ethanol (2H2,13C2-10:2 FTOH) Solution |
| FHEA | 53826-12-3 | 2-Perfluorohexyl ethanoic acid (6:2 FTCA) Solution (with 1.2 mole eq. HCI) |
| FOEA | 27854-31-5 | 2-Perfluorooctyl ethanoic acid (8:2 FTCA) Solution (with 1.2 mole eq. HCI) |
| FDEA | 53826-13-4 | 2-Perfluorodecyl ethanoic acid (10:2 FTCA) Solution (with 1.2 mole eq. HCI) |
| FPrPA | 356-02-5 | 3-Perfluoropropyl propanoic acid (3:3 FTCA) Solution |
| FPePA | 914637-49-3 | 3-Perfluoropentyl propanoic acid (5:3 FTCA) Solution |
| FHpPA | 812-70-4 | 3-Perfluoroheptyl propanoic acid (7:3 FTCA) Solution |
| FTA-MXA | M/C | Native X:2 Fluorotelomer Carboxylic Acid (X:2 FTCA) Solution/Mixture (with 1.2 mole eq. HCl) |
| MFHEA | 872398-75-9 | 2-Perfluorohexyl (13C2)ethanoic acid (13C2-6:2 FTCA) Solution (with 1.2 mole eq. HCI) |
| MFOEA | 872398-76-0 | 2-Perfluorooctyl (13C2)ethanoic acid (13C2-8:2 FTCA) Solution (with 1.2 mole eq. HCI) |
| MFDEA | 872398-77-1 | 2-Perfluorodecyl (13C2)ethanoic acid (13C2-10:2 FTCA) Solution (with 1.2 mole eq. HCI) |
| MFTA-MXA | M/C | Mass-Labelled X:2 Fluorotelomer Carboxylic Acid (X:2 FTCA) Solution/Mixture (with 1.2 mole eq. HCl) |
| FHUEA | 70887-88-6 | (2Z)-2H-Perfluoro-2-octenoic acid (6:2 FTUCA) Solution |
| FOUEA | 70887-84-2 | (2Z)-2H-Perfluoro-2-decenoic acid (8:2 FTUCA) Solution |
| FDUEA | 70887-94-4 | (2Z)-2H-Perfluoro-2-dodecenoic acid (10:2 FTUCA) Solution |
| MFHUEA | 872398-78-2 | (2Z)-2H-Perfluoro-2-(1,2-13C2)octenoic acid (13C2-6:2 FTUCA) Solution |
| MFOUEA | 872398-79-3 | (2Z)-2H-Perfluoro-2-(1,2-13C2)decenoic acid (13C2-8:2 FTUCA) Solution |
| MFDUEA | 872398-80-6 | (2Z)-2H-Perfluoro-2-(1,2-13C2)dodecenoic acid (13C2-10:2 FTUCA) Solution |
| 9Cl-PF3ONS | 73606-19-6 (F-53B) |
Potassium 9-chlorohexadecafluoro-3-oxanonane-1-sulfonate Solution (major component of F-53B) |
| 11Cl-PF3OUdS | 83329-89-9 | Potassium 11-chloroeicosafluoro-3-oxaundecane-1-sulfonate Solution (minor component of F-53B) |
| NaDONA | 2250081-67-3; 958445-44-8 (ADONA) |
Sodium rac-dodecafluoro-3H-4,8-dioxanonanoate Solution (with 4 mole eq. NaOH) |
| HFPO-DA | 13252-13-6 | Hexafluoropropylene oxide dimer acid Solution (major component of GenX) |
| M3HFPO-DA | 3030247-97-0 | 13C3-Hexafluoropropylene oxide dimer acid Solution (13C3-GenX) |
| 4:2FTS | 27619-93-8 | Sodium 1H,1H,2H,2H-perfluorohexane sulfonate (4:2 FTS) Solution |
| 6:2FTS | 27619-94-9 | Sodium 1H,1H,2H,2H-perfluorooctane sulfonate (6:2 FTS) Solution |
| 8:2FTS | 27619-96-1 | Sodium 1H,1H,2H,2H-perfluorodecane sulfonate (8:2 FTS) Solution |
| 10:2FTS | 108026-35-3 | Sodium 1H,1H,2H,2H-perfluorododecane sulfonate (10:2 FTS) Solution |
| M2-4:2FTS | 2708218-88-4 | Sodium 1H,1H,2H,2H-perfluoro(1,2-13C2)hexanesulfonate (13C2-4:2 FTS) Solution |
| M2-6:2FTS | 2708218-89-5 | Sodium 1H,1H,2H,2H-perfluoro-1-(1,2-13C2)octane sulfonate (13C2-6:2 FTS) Solution |
| M2-8:2FTS | 2708218-90-8 | Sodium 1H,1H,2H,2H-perfluoro-1-(1,2-13C2)decane sulfonate (13C2-8:2 FTS) Solution |
| 8:2FTOAc | 37858-04-1 | 1H,1H,2H,2H-Perfluorodecyl acetate Solution |
| 10:2FTOAc | 37858-05-2 | 1H,1H,2H,2H-Perfluorododecyl acetate Solution |
| 8:2FTAcr | 27905-45-9 | 1H,1H,2H,2H-Perfluorodecyl acrylate Solution |
| 10:2FTAcr | 17741-60-5 | 1H,1H,2H,2H-Perfluorododecyl acrylate Solution (≥95%) |
| PFHxPA | 40143-76-8 | Perfluorohexylphosphonic acid Solution |
| PFOPA | 40143-78-0 | Perfluorooctylphosphonic acid Solution |
| PFDPA | 52299-26-0 | Perfluorodecylphosphonic acid Solution |
| Cl-PFHxPA | N/A | 6-Chloroperfluorohexylphosphonic acid Solution |
| Cl-PFOPA | N/A | 8-Chloroperfluorooctylphosphonic acid Solution |
| 6:6PFPi | 70609-44-8 | Sodium bis(perfluorohexyl)phosphinate Solution |
| 6:8PFPi | 2361298-14-6 | Sodium perfluorohexyl(perfluorooctyl)phosphinate Solution |
| 8:8PFPi | 500776-69-2 | Sodium bis(perfluorooctyl)phosphinate Solution |
| 6:2PAP | 150033-29-7 | Disodium 1H,1H,2H,2H-perfluorooctyl phosphate Solution |
| 8:2PAP | 438237-75-3 | Disodium 1H,1H,2H,2H-perfluorodecyl phosphate Solution |
| 6:2diPAP | 407582-79-0 | Sodium bis(1H,1H,2H,2H-perfluorooctyl) phosphate Solution |
| 8:2diPAP | 114519-85-6 | Sodium bis(1H,1H,2H,2H-perfluorodecyl) phosphate Solution |
| 6:2/8:2diPAP | N/A | Sodium (1H,1H,2H,2H-perfluorooctyl-1H,1H.2H,2H-perfluorodecyl) phosphate Solution |
| SAmPAP | 2624-80-8 | Disodium 2-(N-ethylperfluorooctane-1-sulfonamido)ethyl phosphate Solution |
| diSAmPAP | 23282-60-2 | Sodium bis-[2-(N-ethylperfluorooctane-1-sulfonamido)ethyl] phosphate Solution |
| M2-6:2PAP | N/A | Disodium 1H,1H,2H,2H-(1,2-13C2)perfluorooctyl phosphate Solution |
| M2-8:2PAP | N/A | Disodium 1H,1H,2H,2H-(1,2-13C2)perfluorodecyl phosphate Solution |
| M4-6:2diPAP | N/A | Sodium bis[1H,1H,2H,2H-perfluoro(1,2-13C2)octyl] phosphate Solution |
| M4-8:2diPAP | N/A | Sodium bis[1H,1H,2H,2H-perfluoro(1,2-13C2)decyl] phosphate Solution |
| PAH-CVS-B | M/C | Polycyclic Aromatic Hydrocarbon (PAH) Calibration Kit |
| PAH-LCS-B | M/C | Mass-Labelled PAH Extraction Standard Solution/Mixture |
| PAH-ISS-B | M/C | Mass-Labelled PAH Injection Standard Solution/Mixture |
| PAH-SS-B | M/C | Mass-Labelled PAH Sampling Standard Solution/Mixture |
| PAH-STK-B | M/C | Native PAH Stock Solution/Mixture |
| L429-CVS | M/C | California EPA Air Resources Board Method 429 PAH Calibration Kit |
| L429-SS | M/C | California EPA Air Resources Board Method 429 Mass-Labelled PAH Surrogate Standard Stock Solution/Mixture |
| L429-IS | M/C | California EPA Air Resources Board Method 429 Mass-Labelled PAH Internal Standard Stock Solution/Mixture |
| L429-AS | M/C | California EPA Air Resources Board Method 429 Mass-Labelled PAH Alternate Standard Stock Solution |
| L429-RS | M/C | California EPA Air Resources Board Method 429 Mass-Labelled PAH Recovery Standard Stock Solution/Mixture |
| L429-PAR | M/C | California EPA Air Resources Board Method 429 Native PAH Stock Solution/Mixture |
| EPA-PAH-STK | M/C | Native PAH Solution/Mixture |
| EPA-PAH-LCS | M/C | Deuterated PAH Extraction Standard Solution/Mixture |
| EPA-EU-PAH-ISS | M/C | Deuterated PAH Injection Standard Solution/Mixture |
| EU-PAH-STK | M/C | Native PAH Solution/Mixture |
| EU-PAH-LCS | M/C | Deuterated PAH Extraction Standard Solution/Mixture |
| 4H107 | 152969-11-4 | 2,3,3′,4′,5-Pentachloro-4-biphenylol Solution |
| 3H118 | 170946-11-9 | 2,3′,4,4′,5-Pentachloro-3-biphenylol Solution |
| 4H130 | 158076-62-1 | 2,2′,3,3′,4′,5-Hexachloro-4-biphenylol Solution |
| 3H138 | N/A | 2,2′,3′,4,4′,5-Hexachloro-3-biphenylol Solution |
| 4H146 | 145413-90-7 | 2,2′,3,4′,5,5′-Hexachloro-4-biphenylol Solution |
| 3H153 | 54284-55-8 | 2,2′,4,4′,5,5′-Hexachloro-3-biphenylol Solution |
| 4H172 | 158076-64-3 | 2,2′,3,3′,4′,5,5′-Heptachloro-4-biphenylol Solution |
| 3H180 | 158076-69-8 | 2,2′,3′,4,4′,5,5′-Heptachloro-3-biphenylol Solution |
| 4H187 | 158076-68-7 | 2,2′,3,4′,5,5′,6-Heptachloro-4-biphenylol Solution |
| M4H12 | N/A | 3′,4′-Dichloro-4-(13C12)biphenylol Solution |
| M4H29 | N/A | 2′,4′,5′-Trichloro-4-(13C12)biphenylol Solution |
| M4H61 | N/A | 2′,3′,4′,5′-Tetrachloro-4-(13C12)biphenylol Solution |
| M4H120 | N/A | 2′,3,4′,5,5′-Pentachloro-4-(13C12)biphenylol Solution |
| M4H159 | N/A | 2′,3,3′,4′,5,5′-Hexachloro-4-(13C12)biphenylol Solution |
| M4H172 | N/A | 2,2′,3,3′,4′,5,5′-Heptachloro-4-(13C12)biphenylol Solution |
| M4H187 | N/A | 2,2′,3,4′,5,5′,6-Heptachloro-4-(13C12)biphenylol Solution |
| MHPCB-MXA | M/C | Mass-Labelled Polychlorinated Biphenylol Solution/Mixture |
| 4PM79 | N/A | 3,3′,4′,5-Tetrachloro-4-methoxybiphenyl Solution |
| 4PM97 | N/A | 2,2′,3,4′,5′-Pentachloro-4-methoxybiphenyl Solution |
| 4PM101 | N/A | 2,2′,4,5,5′-Pentachloro-4′-methoxybiphenyl Solution |
| 4M107 | N/A | 2,3,3′,4′,5-Pentachloro-4-methoxybiphenyl Solution |
| 4PM108 | N/A | 2,3,3′,4,5′-Pentachloro-4′-methoxybiphenyl Solution |
| 3M118 | N/A | 2,3′,4,4′,5-Pentachloro-3-methoxybiphenyl Solution |
| 4PM120 | N/A | 2,3′,4,5,5′-Pentachloro-4′-methoxybiphenyl Solution |
| 4PM127 | N/A | 3,3′,4,5,5′-Pentachloro-4′-methoxybiphenyl Solution |
| 4PM130 | N/A | 2,2′,3,3′,4′,5-Hexachloro-4-methoxybiphenyl Solution |
| 4M134 | N/A | 2,2′,3,3′,5,6-Hexachloro-4-methoxybiphenyl Solution |
| 3PM138 | N/A | 2,2′,3′,4,4′,5-Hexachloro-3-methoxybiphenyl Solution |
| 4M146 | N/A | 2,2′,3,4′,5,5′-Hexachloro-4-methoxybiphenyl Solution |
| 33PDM155 | N/A | 2,2′,4,4′,6,6′-Hexachloro-3,3′-dimethoxybiphenyl Solution |
| 4PM159 | N/A | 2,3,3′,4,5,5′-Hexachloro-4′-methoxybiphenyl Solution |
| 4M162 | N/A | 2,3,3′,4′,5,5′-Hexachloro-4-methoxybiphenyl Solution |
| 4M163 | N/A | 2,3,3′,4′,5,6-Hexachloro-4-methoxybiphenyl Solution |
| 4PM172 | N/A | 2,2′,3,3′,4,5,5′-Heptachloro-4′-methoxybiphenyl Solution |
| 4M177 | N/A | 2,2′,3,3′,4′,5,6-Heptachloro-4-methoxybiphenyl Solution |
| 4M178 | N/A | 2,2′,3,3′,5,5′,6-Heptachloro-4-methoxybiphenyl Solution (≥97%) |
| 3PM180 | N/A | 2,2′,3,4,4′,5,5′-Heptachloro-3′-methoxybiphenyl Solution |
| 3PM182 | N/A | 2,2′,3,4,4′,5,6′-Heptachloro-3′-methoxybiphenyl Solution |
| 3PM183 | N/A | 2,2′,3′,4,4′,5,6′-Heptachloro-3-methoxybiphenyl Solution |
| 3PM184 | N/A | 2,2′,3,4,4′,6,6′-Heptachloro-3′-methoxybiphenyl Solution |
| 4M187 | N/A | 2,2′,3,4′,5,5′,6-Heptachloro-4-methoxybiphenyl Solution |
| 4M193 | N/A | 2,3,3′,4′,5,5′,6-Heptachloro-4-methoxybiphenyl Solution |
| 4PM198 | N/A | 2,2′,3,3′,4,5,5′,6-Octachloro-4′-methoxybiphenyl Solution |
| 4PM199 | N/A | 2,2′,3,3′,4′,5,5′,6-Octachloro-4-methoxybiphenyl Solution |
| 4PM200 | N/A | 2,2′,3,3′,4,5,6,6′-Octachloro-4′-methoxybiphenyl Solution |
| 4PM201 | N/A | 2,2′,3,3′,4′,5,6,6′-Octachloro-4-methoxybiphenyl Solution |
| 4M202 | N/A | 2,2′,3,3′,5,5′,6,6′-Octachloro-4-methoxybiphenyl Solution |
| 44PDM202 | N/A | 2,2′,3,3′,5,5′,6,6′-Octachloro-4,4′-dimethoxybiphenyl Solution |
| 3PM203 | N/A | 2,2′,3,4,4′,5,5′,6-Octachloro-3′-methoxybiphenyl Solution |
| 4PM208 | N/A | 2,2′,3,3′,4,5,5′,6,6′-Nonachloro-4′-methoxybiphenyl Solution |
| MPCB-MXA | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXB | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture (4M178 ≥97%) |
| MPCB-MXC | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXD | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXE | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXF | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXG | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXH | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXI | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| M4M29 | N/A | 2,4,5-Trichloro-4′-methoxy(13C12)biphenyl Solution |
| M4M61 | N/A | 2,3,4,5-Tetrachloro-4′-methoxy(13C12)biphenyl Solution |
| M4M120 | N/A | 2,3′,4,5,5′-Pentachloro-4′-methoxy(13C12)biphenyl Solution |
| M4M159 | N/A | 2,3,3′,4,5,5′-Hexachloro-4′-methoxy(13C12)biphenyl Solution |
| M4M172 | N/A | 2,2′,3,3′,4,5,5′-Heptachloro-4′-methoxy(13C12)biphenyl Solution |
| M4M187 | N/A | 2,2′,3,4′,5,5′,6-Heptachloro-4-methoxy(13C12)biphenyl Solution |
| MMPCB-MXA | M/C | Mass-Labelled Polychlorinated Methoxybiphenyl Solution/Mixture |
| CBP-2 | 50558-21-9 | 2-Chlorobiphenylene Solution |
| CBP-23 | 909024-10-8 | 2,3-Dichlorobiphenylene Solution |
| CBP-236 | 909024-09-5 | 2,3,6-Trichlorobiphenylene Solution |
| CBP-2367 | 7090-41-7 | 2,3,6,7-Tetrachlorobiphenylene Solution |
| MCBP-2367 | N/A | 2,3,6,7-Tetrachloro(13C12)biphenylene Solution |
| TCC | 101-20-2 | N-(4-chlorophenyl)-N’-(3,4-dichlorophenyl)urea (Triclocarban) Solution |
| MTCC | N/A | N-(4-chloro(13C6)phenyl)-N’-(3,4-dichloro(13C6)phenyl)(13C)urea ((13C13)Triclocarban) Solution |
| TCS | 3380-34-5 | 5-Chloro-2-(2,4-dichlorophenoxy)phenol (Triclosan) Solution |
| TCS-M | 3380-34-5 | 5-Chloro-2-(2,4-dichlorophenoxy)phenol (Triclosan) Solution |
| MeTCS | 4640-01-1 | 5-Chloro-2-(2,4-dichlorophenoxy)anisole (Methyl Triclosan) Solution |
| MTCS | 1365620-36-5 | 5-Chloro-2-[2,4-dichloro(13C6)phenoxy](13C6)phenol ((13C12)Triclosan) Solution |
| MTCS-M | 1365620-36-5 | 5-Chloro-2-[2,4-dichloro(13C6)phenoxy](13C6)phenol ((13C12)Triclosan) Solution |
| MMeTCS | N/A | 5-Chloro-2-[2,4-dichloro(13C6)phenoxy](1,2,3,4,5,6-13C6)anisole ((13C12)Methyl Triclosan) Solution |
| 6TCS | 63709-57-9 | 2,3-Dichloro-6-(2,4-dichlorophenoxy)phenol (6-Chlorotriclosan) Solution |
| 6MeTCS | N/A | 2,3-Dichloro-6-(2,4-dichlorophenoxy)anisole (Methyl 6-Chlorotriclosan) Solution |
| 4TCS | 3380-44-7 | 4,5-Dichloro-2-(2,4-dichlorophenoxy)phenol (4-Chlorotriclosan) Solution |
| 4MeTCS | N/A | 4,5-Dichloro-2-(2,4-dichlorophenoxy)anisole (Methyl 4-Chlorotriclosan) Solution |
| 46TCS | 53555-01-4 | 2,3,4-Trichloro-6-(2,4-dichlorophenoxy)phenol (4,6-Dichlorotriclosan) Solution |
| 46MeTCS | N/A | 2,3,4-Trichloro-6-(2,4-dichlorophenoxy)anisole (Methyl 4,6-Dichlorotriclosan) Solution |
| T4CPM | 27575-78-6 | Tris(4-chlorophenyl)methane Solution |
| T4CPME | 3010-80-8 | Tris(4-chlorophenyl)methanol Solution |
| MT4CPM | N/A | Tris[4-chloro(13C6)phenyl](13C)methane Solution |
| MT4CPME | N/A | Tris[4-chloro(13C6)phenyl](13C)methanol Solution |
| PN-2S | 91-58-7 | 2-Chloronaphthalene Solution |
| PN-6S | 1825-30-5 | 1,5-Dichloronaphthalene Solution |
| PN-12S | 2198-77-8 | 2,7-Dichloronaphthalene Solution |
| PN-13S | 50402-52-3 | 1,2,3-Trichloronaphthalene Solution |
| PN-27S | 20020-02-4 | 1,2,3,4-Tetrachloronaphthalene Solution |
| PN-28S | 53555-63-8 | 1,2,3,5-Tetrachloronaphthalene Solution |
| PN-31S | 149864-81-3 | 1,2,3,8-Tetrachloronaphthalene Solution |
| PN-36S | 67922-22-9 | 1,2,5,6-Tetrachloronaphthalene Solution |
| PN-46S | 3432-57-3 | 1,4,5,8-Tetrachloronaphthalene Solution (≥96%) |
| PN-48S | 34588-40-4 | 2,3,6,7-Tetrachloronaphthalene Solution |
| PN-50S | 67922-26-3 | 1,2,3,4,6-Pentachloronaphthalene Solution |
| PN-52S | 53555-65-0 | 1,2,3,5,7-Pentachloronaphthalene Solution |
| PN-53S | 150224-24-1 | 1,2,3,5,8-Pentachloronaphthalene Solution |
| PN-66S | 103426-96-6 | 1,2,3,4,6,7-Hexachloronaphthalene Solution |
| PN-69S | 103426-94-4 | 1,2,3,5,7,8-Hexachloronaphthalene Solution |
| PN-72S | 103426-92-2 | 1,2,4,5,7,8-Hexachloronaphthalene Solution |
| PN-73S | 58863-14-2 | 1,2,3,4,5,6,7-Heptachloronaphthalene Solution |
| PN-75S | 2234-13-1 | Octachloronaphthalene Solution |
| PCN-MXA | M/C | Native PCN Solution/Mixture |
| PCN-MXC | M/C | Native PCN Solution/Mixture (PN-46 ≥96%) |
| DPE-0 | 101-84-8 | Diphenyl ether Solution |
| DPE-3 | 7005-72-3 | 4-Chlorodiphenyl ether Solution |
| DPE-15 | 2444-89-5 | 4,4′-Dichlorodiphenyl ether Solution |
| DPE-28 | 59039-21-3 | 2,4,4′-Trichlorodiphenyl ether Solution |
| DPE-74 | 61328-45-8 | 2,4,4′,5-Tetrachlorodiphenyl ether Solution |
| DPE-77 | 56348-72-2 | 3,3′,4,4′-Tetrachlorodiphenyl ether Solution |
| DPE-99 | 60123-64-0 | 2,2′,4,4′,5-Pentachlorodiphenyl ether Solution |
| DPE-209 | 31710-30-2 | Decachlorodiphenyl ether Solution |
| MCDE-0 | 2483735-44-8 | (13C12)Diphenyl ether Solution |
| MCDE-3 | N/A | 4-Chloro(13C12)diphenyl ether Solution |
| MCDE-12 | N/A | 3,4-Dichloro(13C12)diphenyl ether Solution |
| MCDE-37 | N/A | 3,4,4′-Trichloro(13C12)diphenyl ether Solution |
| MCDE-61 | N/A | 2,3,4,5-Tetrachloro(13C12)diphenyl ether Solution |
| MCDE-86 | 1621005-50-2 | 2,2′,3,4,5-Pentachloro(13C12)diphenyl ether Solution |
| MCDE-141 | N/A | 2,2′,3,4,5,5′-Hexachloro(13C12)diphenyl ether Solution |
| MCDE-180 | N/A | 2,2′,3,4,4′,5,5′-Heptachloro(13C12)diphenyl ether Solution |
| CBS | M/C | Native Polychlorobenzene Solution/Mixture |
| MCBS | M/C | Mass-Labelled Polychlorobenzene Solution/Mixture |
| MBZ-1235 | 208461-25-0 | 1,2,3,5-Tetrachloro(13C6)benzene Solution |
| CPS | M/C | Native Polychlorophenol Solution/Mixture |
| MCPS | M/C | Mass-Labelled Polychlorophenol Solution/Mixture |
| MCP-246 | 208461-28-3 | 2,4,6-Trichloro(13C6)phenol Solution |
| MCP-345 | 208461-30-7 | 3,4,5-Trichloro(13C6)phenol Solution |
| MCP-23456 | 85380-74-1 | Pentachloro(13C6)phenol Solution |
| MEL | 108-78-1 | Melamine Solution |
| CYA | 108-80-5 | Cyanuric Acid Solution |
| M3-MEL | 1173022-88-2 | (13C3)Melamine Solution |
| M3-CYA | 201996-37-4 | (13C3)Cyanuric Acid Solution |
| M6-CYA | N/A | (13C3,15N3)Cyanuric Acid Solution |
| BPA | 80-05-7 | Bisphenol A Solution |
| BPAF | 1478-61-1 | Bisphenol AF Solution |
| BPAP | 1571-75-1 | Bisphenol AP Solution |
| BPB | 77-40-7 | Bisphenol B Solution |
| BPF | 620-92-8 | Bisphenol F Solution |
| BPP | 2167-51-3 | Bisphenol P Solution |
| BPS | 80-09-1 | Bisphenol S Solution |
| BPZ | 843-55-0 | Bisphenol Z Solution |
| MBPA | 263261-65-0 | Bisphenol A (13C12-rings) Solution |
| TCDT-83 | 133513-17-4 | 2,3,7,8-Tetrachlorodibenzothiophene Solution |
| TCDT-85 | 134705-49-0 | 2,4,6,8-Tetrachlorodibenzothiophene Solution |
| MTCDT-85 | N/A | 2,4,6,8-Tetrachloro(13C12)dibenzothiophene Solution |
| CCZ-3 | 2732-25-4 | 3-Chloro-9H-carbazole Solution |
| CCZ-36 | 5599-71-3 | 3,6-Dichloro-9H-carbazole Solution |
| CCZ-1368 | 58910-96-6 | 1,3,6,8-Tetrachloro-9H-carbazole Solution |
| CCZ-2367 | 697298-02-5 | 2,3,6,7-Tetrachloro-9H-carbazole Solution |
| CBCZ-MXB | M/C | Native Halogenated Carbazoles Solution/Mixture |
| MCCZ-36 | N/A | 3,6-Dichloro-9H-(13C12)carbazole Solution |
| MCCZ-1368 | N/A | 1,3,6,8-Tetrachloro-9H-(13C12)carbazole Solution |
| BCZ-3 | 1592-95-6 | 3-Bromo-9H-carbazole Solution |
| BCZ-27 | 136630-39-2 | 2,7-Dibromo-9H-carbazole Solution |
| BCZ-36 | 6825-20-3 | 3,6-Dibromo-9H-carbazole Solution |
| BCZ-136 | 55119-10-3 | 1,3,6-Tribromo-9H-carbazole Solution |
| BCZ-1368 | 55119-09-0 | 1,3,6,8-Tetrabromo-9H-carbazole Solution |
| 1-B-36-CCZ | 100125-05-1 | 1-Bromo-3,6-dichloro-9H-carbazole Solution |
| 18-B-36-CCZ | 100131-03-1 | 1,8-Dibromo-3,6-dichloro-9H-carbazole Solution |
| CARP-2 | N/A | Reference Fish Tissue (Carp homogenate) for Organic Contaminant Analysis |
| TPCB-CVS-A | M/C | Polychlorinated Biphenyl (PCB) Calibration Kit |
| DF-IS-J100 | M/C | Mass-Labelled PCDD Injection Standard Solution/Mixture |
| DF-IS-J20 | M/C | Mass-Labelled PCDD Injection Standard Solution/Mixture |
| DF-SS-A | M/C | Mass-Labelled PCDD Sampling Standard Solution |
| DF-SS-A100 | M/C | Mass-Labelled PCDD Sampling Standard Solution |
| DF-SS-A20 | M/C | Mass-Labelled PCDD Sampling Standard Solution |
| TPCB-LCS-A100 | M/C | Mass-Labelled PCB Extraction Standard Solution/Mixture |
| TPCB-LCS-A20 | M/C | Mass-Labelled PCB Extraction Standard Solution/Mixture |
| TPCB-LCS-B100 | M/C | Mass-Labelled PCB Extraction Standard Solution/Mixture |
| TPCB-LCS-B20 | M/C | Mass-Labelled PCB Extraction Standard Solution/Mixture |
| TPCB-IS-A100 | M/C | Mass-Labelled PCB Recovery/Internal Standard Solution/Mixture |
| TPCB-IS-A20 | M/C | Mass-Labelled PCB Recovery/Internal Standard Solution/Mixture |
| TPCB-SS-A100 | M/C | Mass-Labelled PCB Sampling/Cleanup Standard Solution/Mixture |
| TPCB-SS-A20 | M/C | Mass-Labelled PCB Sampling/Cleanup Standard Solution/Mixture |
| DFP-ST-C10 | M/C | Native PCDD/PCDF/PCB Solution/Mixture |
| DF-ST-C | M/C | Native PCDD/PCDF Solution/Mixture |
| DF-ST-C10 | M/C | Native PCDD/PCDF Solution/Mixture |
| PCB-ST-C | M/C | Native PCB Solution/Mixture |
| PCB-ST-C20 | M/C | Native PCB Solution/Mixture |
| PCB-ST-D | M/C | Native PCB Solution/Mixture |
| MBP-MXP | M/C | Mass-Labelled PCB Solution/Mixture |
| BP-MXP | M/C | Native PCB Solution/Mixture |
| BP-PG-MXA | M/C | Native PCB Solution/Mixture |
| MBP-PG-MXA | M/C | Mass-Labelled PCB Solution/Mixture |
| br-NMeFOSAA | N/A | N-Methylperfluorooctanesulfonamidoacetic acid Solution/Mixture of Linear and Branched Isomers (with 4 mole eq. NaOH) |
| br-NEtFOSAA | N/A | N-Ethylperfluorooctanesulfonamidoacetic acid Solution/Mixture of Linear and Branched Isomers (with 4 mole eq. NaOH) |
| EPA-537PDS-R1 | M/C | U.S. EPA Method 537.1 Native PFAS Analyte PDS (with branched/linear isomers) Solution/Mixture (with 4 mole eq. NaOH) |
| EPA-537PDSL-R1 | M/C | U.S. EPA Method 537.1 Native PFAS Analyte PDS (linear isomers only) Solution/Mixture (with 4 mole eq. NaOH) |
| PFECHS | 335-24-0 | Potassium perfluoro-4-ethylcyclohexanesulfonate Isomeric Solution/Mixture |
| MDD-27 | N/A | 2,7-Dichloro(13C12)dibenzo-p-dioxin Solution |
| MDD-28 | N/A | 2,8-Dichloro(13C12)dibenzo-p-dioxin Solution |
| (+)aHBCD | 138257-19-9 | (+)-alpha-1S,2S,5R,6S,9S,10R-Hexabromocyclododecane Solution |
| (-)aHBCD | 678970-15-5 | (-)-alpha-1R,2R,5S,6R,9R,10S-Hexabromocyclododecane Solution |
| (+)gHBCD | 678970-17-7 | (+)-gamma-1R,2R,5R,6S,9S,10R-Hexabromocyclododecane Solution |
| (-)gHBCD | 169102-57-2 | (-)-gamma-1S,2S,5S,6R,9R,10S-Hexabromocyclododecane Solution |
| FBSA-I | 30334-69-1 | Perfluoro-1-butanesulfonamide Solution |
| FHxSA-I | 41997-13-1 | Perfluoro-1-hexanesulfonamide Solution |
| N-AP-FHxSA | 50598-28-2 | N-[3-(Dimethylamino)propan-1-yl]perfluoro-1-hexanesulfonamide Solution |
| N-TAmP-FHxSA | 38850-51-0 | N-[3-(Trimethylammonio)propan-1-yl]perfluoro-1-hexanesulfonazanide Solution |
| N-CMAmP-6:2FOSA | 34455-29-3 | 6:2 Fluorotelomer sulfonamide alkylbetaine (6:2 FTAB; Capstone B) Solution |
| Ma-DP | N/A | anti-(13C10)Dechlorane Plus Solution |
| PCN-WD | M/C | PCN Window Defining Solution/Mixture (DB-5, or equivalent) |
| PCN-HWX | M/C | Native PCN Major Halowax Congeners Solution/Mixture |
| PCN-INC | M/C | Native PCN Major Incineration Congeners Solution/Mixture |
| PCN-TOX | M/C | Native PCN Potentially Toxic Congeners Solution/Mixture |
| OCP-MXA | M/C | Native OCP Solution/Mixture |
| MOCP-MXA | M/C | Mass-Labelled OCP Solution/Mixture |
| DET-MXA | M/C | Native DDT & Related Compound Solution/Mixture |
| MDET-MXA | M/C | Mass-Labelled DDT & Related Compound Solution/Mixture |
| HCH-MXA | M/C | Native HCH Solution/Mixture |
| MHCH-MXA | M/C | Mass-Labelled HCH Solution/Mixture |
| WMF-02 | N/A | Reference “Freeze-Dried” Fish Tissue (naturally fortified/ground Pacific Salmon) |
| WMF-03 | N/A | Low Level Reference “Freeze-Dried” Fish Tissue (ground Pacific Salmon) |
| WMF-EX | N/A | Reference Fish Tissue (Salmon) Extract (Isooctane/20% Salmon Oil) |
| PFAC30PAR | M/C | Native PFAS Precision and Recovery Standard Solution (with 4 mole eq. NaOH) |
| PF4OPeA | 377-73-1 | Perfluoro-4-oxapentanoic acid (PFMPA) Solution (with 4 mole eq. NaOH) |
| PF5OHxA | 863090-89-5 | Perfluoro-5-oxahexanoic acid (PFMBA) Solution (with 4 mole eq. NaOH) |
| 3,6-OPFHpA | 151772-58-6 | Perfluoro-3,6-dioxaheptanoic acid (NFDHA) Solution (with 4 mole eq. NaOH) |
| PFEESA | 117205-07-9 | Potassium perfluoro(2-ethoxyethane)sulfonate Solution |
| FDSA-I | 4262-70-8 | Perfluoro-1-decanesulfonamide Solution |
| N-MeFBSA-M | 68298-12-4 | N-Methylperfluoro-1-butanesulfonamide Solution |
| axCl11DP | 1826842-25-4 | exo–anti-Cl11-Dechlorane Plus Solution |
| axxCl10DP | 2305587-45-3 | exo–exo–anti-Cl10-Dechlorane Plus Solution |
| 3tBPDPP | N/A | 3-tert-Butylphenyl diphenyl phosphate Solution |
| T3tBPP | N/A | Tris(3-tert-butylphenyl) phosphate Solution |
| B3tBPPP | N/A | Bis(3-tert-butylphenyl) phenyl phosphate Solution |
| T24DtBPP | 95906-11-9 | Tris(2,4-di-tert-butylphenyl) phosphate Solution |
| 3IPPDPP | 69515-46-4 | 3-Isopropylphenyl diphenyl phosphate Solution |
| B3IPPPP | 69500-30-7 | Bis(3-isopropylphenyl) phenyl phosphate Solution |
| 5:3FTB | 171184-14-8 | 2-[(4,4,5,5,6,6,7,7,8,8,8-Undecafluorooctyl)dimethylammonio]acetate Solution |
| 5:1:2FTB | 171184-02-4 | 2-[(3,4,4,5,5,6,6,7,7,8,8,8-Dodecafluorooctyl)dimethylammonio]acetate Solution |
| EPA-533PAR | M/C | U.S. EPA Method 533 Native PFAS Analyte PDS (with branched/linear isomers) Solution/Mixture (with 4 mole eq. NaOH) |
| EPA-533ES | M/C | U.S. EPA Method 533 Mass-Labelled PFAS Isotope Dilution Analogue PDS Solution/Mixture (with 4 mole eq. NaOH) |
| EPA-533IS | M/C | U.S. EPA Method 533 Mass-Labelled PFAS Isotope Performance Standard PDS Solution/Mixture (with 4 mole eq. NaOH) |
| PFAC-MXF | M/C | Native Replacement PFAS Solution/Mixture (with 4 mole eq. NaOH) |
| PFAC-MXG | M/C | Native Perfluoroether Carboxylic Acid and Sulfonate Solution/Mixture (with 4 mole eq. NaOH) |
| L-PFUdS | 3016286-99-7 | Sodium perfluoro-1-undecanesulfonate Solution |
| L-PFTrDS | 174675-49-1 | Sodium perfluoro-1-tridecanesulfonate Solution |
| EU-5813-NSS | M/C | EU 5813/20 Native PFAS Solution/Mixture (with 4 mole eq. NaOH) |
| ISO 21675-NSS | M/C | ISO 21675:2019 Native PFAS Stock Solution/Mixture (with 4 mole eq. NaOH) |
| ISO 21675-LSS | M/C | ISO 21675:2019 Labelled Stock Solution (with 4 mole eq. NaOH) |
| MPFAC-HIF-ES | M/C | U.S. EPA Method 1633 Mass-Labelled PFAS Extraction Standard Solution/Mixture (with 4 mole eq. NaOH) |
| MPFAC-HIF-IS | M/C | U.S. EPA Method 1633 Mass-Labelled PFAS Injection Standard Solution/Mixture (with 4 mole eq. NaOH) |
| PFAC-MXH | M/C | Native PFAS Solution/Mixture (with 4 mole eq. NaOH) |
| PFAC-MXI | M/C | Native N-Substituted FOSA/FOSE Solution/Mixture |
| PFAC-MXJ | M/C | Native X:3 Fluorotelomer Carboxylic Acid (X:3 FTCA) Solution/Mixture |
| 16130CVS | M/C | Alternative Method 16130 PCDD/PCDF Calibration Kit |
| 16130CSL | M/C | Alternative Method 16130 PCDD/PCDF Extended Calibration/Low Level Solution/Mixture – CSL |
| 16130CS05 | M/C | Alternative Method 16130 PCDD/PCDF Extended Calibration/Low Level Solution/Mixture – CS0.5 |
| MD5CWDS | M/C | Mass-Labelled PCDD Window Defining Mixture (DB-5, HP-5MS, or equivalent) |
| MF5CWDS | M/C | Mass-Labelled PCDF Window Defining Mixture (DB-5, HP-5MS, or equivalent) |
| DF-14678-S | 83704-35-2 | 1,4,6,7,8-Pentachlorodibenzofuran (or 2,3,4,6,9) Solution |
| MDD-1289 | N/A | 1,2,8,9-Tetrachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-124679 | N/A | 1,2,4,6,7,9-Hexachloro(13C12)dibenzo-p-dioxin Solution |
| MDF-12389 | N/A | 1,2,3,8,9-Pentachloro(13C12)dibenzofuran Solution |
| MDF-123489 | N/A | 1,2,3,4,8,9-Hexachloro(13C12)dibenzofuran Solution |
| FHpSA-I | 82765-77-3 | Perfluoro-1-heptanesulfonamide Solution |
| N-MeFBSE-M | 34454-97-2 | 2-(N-Methylperfluoro-1-butanesulfonamido)ethanol Solution |
| PeCB | 608-93-5 | Pentachlorobenzene Solution |
| HxCB | 118-74-1 | Hexachlorobenzene Solution |
| aHCH | 319-84-6 | alpha-1,2,3,4,5,6-Hexachlorocyclohexane Solution |
| bHCH | 319-85-7 | beta-1,2,3,4,5,6-Hexachlorocyclohexane Solution |
| gHCH | 58-89-9 | gamma-1,2,3,4,5,6-Hexachlorocyclohexane Solution |
| dHCH | 319-86-8 | delta-1,2,3,4,5,6-Hexachlorocyclohexane Solution |
| 24P-DMDT | 30667-99-3 | o,p’-Methoxychlor Solution |
| 44P-DMDT | 72-43-5 | p,p’-Methoxychlor Solution |
| 24P-DDD | 53-19-0 | 1,1-Dichloro-2-(2-chlorophenyl)-2-(4-chlorophenyl)ethane Solution |
| 44P-DDD | 72-54-8 | 1,1-Dichloro-2,2-bis(4-chlorophenyl)ethane Solution |
| 24P-DDE | 3424-82-6 | 1,1-Dichloro-2-(2-chlorophenyl)-2-(4-chlorophenyl)ethene Solution |
| 44P-DDE | 72-55-9 | 1,1-Dichloro-2,2-bis(4-chlorophenyl)ethene Solution |
| 24P-DDT | 789-02-6 | 1,1,1-Trichloro-2-(2-chlorophenyl)-2-(4-chlorophenyl)ethane Solution |
| 44P-DDT | 50-29-3 | 1,1,1-Trichloro-2,2-bis(4-chlorophenyl)ethane Solution |
| HxChlor | 3734-48-3 | Chlordene Solution |
| 1H-HxChlor | 2597-11-7 | 1-Hydroxychlordene Solution |
| HpChlor | 76-44-8 | Heptachlor Solution |
| HpChlor-nEp | 28044-83-9 | Heptachlor-endo-epoxide (isomer A) Solution |
| HpChlor-xEp | 1024-57-3 | Heptachlor-exo-epoxide (isomer B) Solution |
| cChlorD | 5103-71-9 | cis-Chlordane (alpha) Solution |
| tChlorD | 5103-74-2 | trans-Chlordane (gamma) Solution |
| OxyChlorD | 27304-13-8 | OxyChlordane Solution |
| cNChlor | 5103-73-1 | cis-Nonachlor Solution |
| tNChlor | 39765-80-5 | trans-Nonachlor Solution |
| ALD | 309-00-2 | Aldrin Solution |
| ISOD | 465-73-6 | Isodrin Solution |
| DELD | 60-57-1 | Dieldrin Solution |
| END | 72-20-8 | Endrin Solution |
| END-Ald | 7421-93-4 | Endrin Aldehyde Solution |
| END-Ket | 53494-70-5 | Endrin Ketone Solution |
| KEP | 143-50-0 | Kepone Solution |
| MRX | 2385-85-5 | Mirex Solution |
| aENDOS | 959-98-8 | Endosulfan I (alpha) Solution |
| bENDOS | 33213-65-9 | Endosulfan II (beta) Solution |
| ENDOS-S | 1031-07-8 | Endosulfan Sulfate Solution |
| MPeCB | 2483735-54-0 | Pentachloro(13C6)benzene Solution |
| MHxCB | 93952-14-8 | Hexachloro(13C6)benzene Solution |
| MaHCH | 222966-66-7 | alpha-1,2,3,4,5,6-Hexachloro(13C6)cyclohexane Solution |
| MbHCH | 222966-68-9 | beta-1,2,3,4,5,6-Hexachloro(13C6)cyclohexane Solution |
| MgHCH | 104215-85-2 | gamma-1,2,3,4,5,6-Hexachloro(13C6)cyclohexane Solution |
| MdHCH | N/A | delta-1,2,3,4,5,6-Hexachloro(13C6)cyclohexane Solution |
| M44P-DMDT | 2483735-96-0 | p,p’-(13C12)Methoxychlor Solution |
| M24P-DDD | 2483736-36-1 | 1,1-Dichloro-2-[2-chloro(13C6)phenyl]-2-[4-chloro(13C6)phenyl]ethane Solution |
| M44P-DDD | 1571957-95-3 | 1,1-Dichloro-2,2-bis[4-chloro(13C6)phenyl]ethane Solution |
| M24P-DDE | 2483735-97-1 | 1,1-Dichloro-2-[2-chloro(13C6)phenyl]-2-[4-chloro(13C6)phenyl]ethene Solution |
| M44P-DDE | 201612-50-2 | 1,1-Dichloro-2,2-bis[4-chloro(13C6)phenyl]ethene Solution |
| M24P-DDT | 1396995-26-8 | 1,1,1-Trichloro-2-[2-chloro(13C6)phenyl]-2-[4-chloro(13C6)phenyl]ethane Solution |
| M44P-DDT | 104215-84-1 | 1,1,1-Trichloro-2,2-bis[4-chloro(13C6)phenyl]ethane Solution |
| MHxChlor | N/A | (13C10)Chlordene Solution |
| MHpChlor | N/A | (13C10)Heptachlor Solution |
| McChlorD | 475275-01-5 | cis-(13C10)Chlordane (alpha) Solution |
| MtChlorD | 1262969-05-0 | trans-(13C10)Chlordane (gamma) Solution |
| McNChlor | 2484171-06-2 | cis-(13C10)Nonachlor Solution |
| MALD | 475274-95-4 | (13C12)Aldrin Solution |
| MISOD | 475274-98-7 | (13C12)Isodrin Solution |
| MDELD | 475274-96-5 | (13C12)Dieldrin Solution |
| MEND | 475274-99-8 | (13C12)Endrin Solution |
| MKEP | 2483736-05-4 | (13C10)Kepone Solution |
| MMRX | 2483736-04-3 | (13C10)Mirex Solution |
| PCN-CVS-A | M/C | Polychlorinated Naphthalene (PCN) Calibration Kit |
| PCN-LCS-A | M/C | Mass-Labelled PCN Extraction Standard Solution/Mixture |
| PCN-ISS-A | M/C | Mass-Labelled PCN Injection Standard Solution/Mixture |
| PCN-SS-A | N/A | Mass-Labelled PCN Sampling Standard Solution |
| PCN-STK-A | M/C | Native PCN Stock Solution/Mixture |
| PN-1S | 90-13-1 | 1-Chloronaphthalene Solution |
| PN-4S | 2198-75-6 | 1,3-Dichloronaphthalene Solution |
| PN-5S | 1825-31-6 | 1,4-Dichloronaphthalene Solution |
| PN-9S | 2050-74-0 | 1,8-Dichloronaphthalene Solution |
| PN-17S | 55720-34-8 | 1,2,7-Trichloronaphthalene Solution |
| PN-18S | 55720-35-9 | 1,2,8-Trichloronaphthalene Solution |
| PN-19S | 51570-43-5 | 1,3,5-Trichloronaphthalene Solution |
| PN-20S | 55720-36-0 | 1,3,6-Trichloronaphthalene Solution |
| PN-21S | 55720-37-1 | 1,3,7-Trichloronaphthalene Solution |
| PN-23S | 2437-55-0 | 1,4,5-Trichloronaphthalene Solution |
| PN-24S | 2737-54-9 | 1,4,6-Trichloronaphthalene Solution |
| PN-33S | 51570-45-7 | 1,2,4,6-Tetrachloronaphthalene Solution |
| PN-34S | 67922-21-8 | 1,2,4,7-Tetrachloronaphthalene Solution |
| PN-35S | 6529-87-9 | 1,2,4,8-Tetrachloronaphthalene Solution |
| PN-37S | 67922-23-0 | 1,2,5,7-Tetrachloronaphthalene Solution |
| PN-40S | 67922-24-1 | 1,2,6,8-Tetrachloronaphthalene Solution |
| PN-41S | 149864-82-4 | 1,2,7,8-Tetrachloronaphthalene Solution |
| PN-42S | 53555-64-9 | 1,3,5,7-Tetrachloronaphthalene Solution |
| PN-54S | 150224-16-1 | 1,2,3,6,7-Pentachloronaphthalene Solution |
| PN-56S | 150205-21-3 | 1,2,3,7,8-Pentachloronaphthalene Solution |
| PN-57S | 150224-20-7 | 1,2,4,5,6-Pentachloronaphthalene Solution |
| PN-59S | 150224-25-2 | 1,2,4,5,8-Pentachloronaphthalene Solution |
| PN-63S | 58877-88-6 | 1,2,3,4,5,6-Hexachloronaphthalene Solution |
| PN-68S | 103426-95-5 | 1,2,3,5,6,8-Hexachloronaphthalene Solution |
| PN-70S | 17062-87-2 | 1,2,3,6,7,8-Hexachloronaphthalene Solution |
| PN-74S | 58863-15-3 | 1,2,3,4,5,6,8-Heptachloronaphthalene Solution |
| MPN-1 | N/A | 1-Chloro(13C10)naphthalene Solution |
| MPN-5 | N/A | 1,4-Dichloro(13C10)]naphthalene Solution |
| MPN-23 | N/A | 1,4,5-Trichloro(13C10)naphthalene Solution |
| MPN-24 | N/A | 1,4,6-Trichloro(13C10)naphthalene Solution |
| MPN-48 | N/A | 2,3,6,7-Tetrachloro(13C10)naphthalene Solution |
| MPN-54 | N/A | 1,2,3,6,7-Pentachloro(13C10)naphthalene Solution |
| MPN-56 | N/A | 1,2,3,7,8-Pentachloro(13C10)naphthalene Solution |
| MPN-59 | N/A | 1,2,4,5,8-Pentachloro(13C10)naphthalene Solution |
| MPN-67 | 219526-47-3 | 1,2,3,5,6,7-Hexachloro(13C10)naphthalene Solution |
| MPN-70 | N/A | 1,2,3,6,7,8-Hexachloro(13C10)naphthalene Solution |
| MPN-72 | N/A | 1,2,4,5,7,8-Hexachloro(13C10)naphthalene Solution |
| MPN-73 | 219526-49-5 | 1,2,3,4,5,6,7-Heptachloro(13C10)naphthalene Solution |
| MPN-74 | N/A | 1,2,3,4,5,6,8-Heptachloro(13C10)naphthalene Solution |
| MPN-75 | 219526-50-8 | Octachloro(13C10)]naphthalene Solution |
| MtNChlor | 1262969-06-1 | trans-(13C10)Nonachlor Solution |
| MHpChlor-xEp | 2483736-00-9 | (13C10)Heptachlor-exo-epoxide (isomer B) Solution |
| MOxyChlorD | 2483735-99-3 | (13C10)Oxychlordane Solution |
| MaENDOS | 2483736-15-6 | (13C9)Endosulfan I (alpha) Solution |
| MbENDOS | 2484171-16-4 | (13C9)Endosulfan II (beta) Solution |
| MENDOS-S | N/A | (13C9)Endosulfan Sulfate Solution |
| FPeSA-I | 82765-76-2 | Perfluoro-1-pentanesulfonamide Solution |
| N-EtFBSA-M | 40630-67-9 | N-Ethylperfluoro-1-butanesulfonamide Solution |
| N-EtFBSE-M | 34449-89-3 | 2-(N-Ethylperfluoro-1-butanesulfonamido)ethanol Solution |
| br-FOSA | M/C | Perfluorooctanesulfonamide Solution/Mixture of Linear and Branched Isomers |
| br-NMeFOSA | M/C | N-Methylperfluorooctanesulfonamide Solution/Mixture of Linear and Branched Isomers |
| br-NEtFOSA | M/C | N-Ethylperfluorooctanesulfonamide Solution/Mixture of Linear and Branched Isomers |
| br-NMeFOSE | M/C | 2-(N-Methylperfluorooctanesulfonamido)ethanol Solution/Mixture of Linear and Branched Isomers |
| br-NEtFOSE | M/C | 2-(N-Ethylperfluorooctanesulfonamido)ethanol Solution/Mixture of Linear and Branched Isomers |
| br-PFOA | M/C | Perfluorooctanoic Acid Solution/Mixture of Linear and Branched Isomers (with 4 mole eq. NaOH) |
| br-PFNA | M/C | Perfluorononanoic Acid Solution/Mixture of Linear and Branched Isomers (with 4 mole eq. NaOH) |
| PFMeS | 2926-30-9 | Sodium trifluoromethanesulfonate Solution |
| PFEtS | 2923-21-9 | Sodium perfluoroethanesulfonate Solution |
| TFA | 76-05-1 | Trifluoroacetic acid Solution (with 4 mole eq. NaOH) |
| PFPrA | 422-64-0 | Perfluoropropanoic acid Solution (with 4 mole eq. NaOH) |
| EPA-533APDS | M/C | U.S. EPA Method 533 Native PFAS Analyte PDS (with expanded branched/linear isomers) Solution/Mixture (with 4 mole eq. NaOH) |
| EPA-537APDS | M/C | U.S. EPA Method 537.1 Native PFAS Analyte PDS (with expanded branched/linear isomers) Solution/Mixture (with 4 mole eq. NaOH) |
| EPA-8327STK | M/C | U.S. EPA Method 8327 Native PFAS Precision and Recovery Standard Stock Solution/Mixture (with 4 mole eq. NaOH) |
| EPA-1633STK | M/C | U.S. EPA Method 1633 Native PFAS Stock Solution/Mixture (with 4 mole eq. NaOH) |
| UV-328 | 25973-55-1 | 2-(2H-Benzotriazol-2-yl)-4,6-bis(1,1-dimethylpropyl)phenol Solution |
| M6UV-328 | N/A | 2-[2H-(13C6)Benzotriazol-2-yl]-4,6-bis(1,1-dimethylpropyl)phenol Solution |
| N-OxAmP-6:2FOSA | 80475-32-7 | 6:2 Fluorotelomer sulfonamide amine oxide (6:2 FTNO; Capstone A) Solution |
| N-AP-6:2FOSA | 34455-22-6 | 6:2 Fluorotelomer sulfonamide alkylamine (6:2 FTAA) Solution |
| M3N-CMAmP-6:2FOSA | N/A | 13C3-6:2 Fluorotelomer sulfonamide alkylbetaine (13C3-6:2 FTAB; mass-labelled Capstone B) Solution |
| aPFNOBS (OBS) | 70829-87-7 | Sodium p-perfluorous nonenoxybenzenesulfonate Solution |
| PFAS-3PAR | M/C | Native PFAS Precision and Recovery Standard Solution/Mixture (with 4 mole eq. NaOH) |
| MPFAS-3ES | M/C | Mass-Labelled PFAS Extraction Standard Solution/Mixture (with 4 mole eq. NaOH) |
| M2-10:2FTS | N/A | Sodium 1H,1H,2H,2H-perfluoro(1,2-13C2)dodecanesulfonate (13C2-10:2 FTS) Solution |
| LiPFMeSI | 90076-65-6 | Lithium bis(trifluoromethanesulfonyl)imide Solution (HQ-115) |
| LiPFEtSI | 132843-44-8 | Lithium bis(pentafluoroethanesulfonyl)imide Solution |
| N-AP-FBSA | 68555-77-1 | N-[3-(Dimethylamino)propan-1-yl]perfluoro-1-butanesulfonamide Solution |
| N-AP-FPeSA | 68555-78-2 | N-[3-(Dimethylamino)propan-1-yl]perfluoro-1-pentanesulfonamide Solution |
| N-AP-FOSA | 13417-01-1 | N-[3-(Dimethylamino)propan-1-yl]perfluoro-1-octanesulfonamide Solution |
| ISO 21675-LSSA | M/C | ISO 21675:2019 Mass-Labelled PFAS Stock Solution Additional Analytes (with 4 mole eq. NaOH) |
| HFPO-TrA | 13252-14-7 | Hexafluoropropylene oxide trimer acid Solution |
| HFPO-TeA | 65294-16-8 | Hexafluoropropylene oxide tetramer acid Solution |
| MDF-123468 | N/A | 1,2,3,4,6,8-Hexachloro(13C12)dibenzofuran Solution |
| PCB-CVS-B10 | M/C | Polychlorinated Biphenyl (PCB) Calibration Kit |
| DFP-IS-B100 | M/C | Mass-Labelled PCDD/PCB Injection Standard Solution/Mixture |
| DFP-ST-C | M/C | Native PCDD/PCDF/PCB Solution/Mixture |
| M2TFA | N/A | Trifluoro(13C2)acetic acid (with 4 mole eq. NaOH) |
| FDA-30MX | M/C | U.S. FDA Method C-010.03 Native PFAS Solution/Mixture (with 4 mole eq. NaOH) |
| M2FTS-MXA | M/C | Mass-Labelled (13C2) X:2 Fluorotelomer Sulfonate Solution/Mixture |
| FDA-12MPFAS | M/C | U.S. FDA Method C-010.03 Mass-Labelled PFAS Solution/Mixture (with 4 mole eq. NaOH) |
| FHxPA | 27854-30-4 | 3-Perfluorohexyl propanoic acid (6:3 FTCA) Solution |
| FOPA | 34598-33-9 | 3-Perfluorooctyl propanoic acid (8:3 FTCA, 4HPFUnA) Solution |
| 6PPD-Q | 2754428-18-5 | rac-N-(1,3-Dimethylbutyl)-N’-phenyl-p-phenylenediamine-quinone (6PPD-quinone) Solution |
| M6PPD-Q | N/A | rac-N-(1,3-Dimethylbutyl)-N’-phenyl-p-(13C6)phenylenediamine-quinone (13C6-6PPD-quinone) Solution |
| d5-6PPD-Q | 2750119-14-1 | rac-N-(1,3-Dimethylbutyl)-N’-phenyl-p-(2H5)phenylenediamine-quinone (2H5-6PPD-quinone) Solution |



