Product Search
Looking for a specific product? Use our product filter to find it!
The search field below was designed to enable our customers to conveniently search our products using product codes, CAS numbers, or product descriptions.
- Simply enter a Product Code, CAS number, or Description into the search box and the table will be filtered to display only the most applicable items.
- Please note that CAS numbers are only listed for individual component solutions
(M/C = multiple components, N/A = not available). - All products are sold as dilute solutions of known concentration and purity (>98% chemical purity unless otherwise stated) in an appropriate solvent.
For more information on specific products, view our catalogue
| Product Code | CAS number | Description |
|---|---|---|
| EPA-1613CVS | M/C | U.S. EPA Method 1613 PCDD/PCDF Calibration Kit |
| EPA-1613CSL | M/C | U.S. EPA Method 1613 PCDD/PCDF Extended Calibration/Low Level Solution (CSL) |
| EPA-1613CS0.5 | M/C | U.S. EPA Method 1613 PCDD/PCDF Extended Calibration/Low Level Solution (CS0.5) |
| EPA-1613LCS | M/C | U.S. EPA Method 1613 PCDD/PCDF Labelled Compound Stock Solution |
| EPA-1613CSS | N/A | U.S. EPA Method 1613 PCDD/PCDF Cleanup Standard Spiking Solution |
| EPA-1613CSS-STK | M/C | U.S. EPA Method 1613 PCDD/PCDF Cleanup Standard Spiking Stock Solution |
| EPA-1613ISS | M/C | U.S. EPA Method 1613 PCDD/PCDF Internal Standard Spiking Solution |
| EPA-1613ISS-STK | M/C | U.S. EPA Method 1613 PCDD/PCDF Internal Standard Spiking Stock Solution |
| EPA-1613PAR | M/C | U.S. EPA Method 1613 PCDD/PCDF Precision and Recovery Stock Solution |
| EPA-1613STOCK | M/C | U.S. EPA Method 1613 PCDD/PCDF Native Stock Solution |
| CS3WT | M/C | EPA-1613CS3 + Window Defining/2378-TCDD Specificity Mixture for DB-5/BP5/HP-2/Rtx-5/SPB-5 |
| EPA-513CVS | M/C | U.S. EPA Method 513 TCDD/TCDF Calibration Kit |
| 513-CS0.25 | M/C | U.S. EPA Method 513 TCDD/TCDF Extended Calibration/Low Level Solution (CS0.25) |
| EPA-513LCSS | M/C | U.S. EPA Method 513 TCDD/TCDF Labelled Spiking Solution |
| EPA-513ISS | M/C | U.S. EPA Method 513 TCDD/TCDF Internal Standard Spiking Solution |
| EPA-513CSSA | M/C | U.S. EPA Method 513 TCDD/TCDF Cleanup Standard Spiking Solution |
| EPA-513CSSB | M/C | U.S. EPA Method 513 TCDD/TCDF Alternative Cleanup Standard Spiking Solution |
| EPA-513PAR | M/C | U.S. EPA Method 513 TCDD/TCDF Precision and Recovery Solution |
| EPA-8280CVS | M/C | U.S. EPA Method 8280 PCDD/PCDF Calibration Kit |
| EPA-8280IS | M/C | U.S. EPA Method 8280 PCDD/PCDF Internal Standard Solution |
| EPA-8280ISB | M/C | U.S. EPA Method 8280 PCDD/PCDF Additional Internal Standard Solution |
| EPA-8280CS | M/C | U.S. EPA Method 8280 PCDD/PCDF Cleanup Standard Solution |
| EPA-8280RS | M/C | U.S. EPA Method 8280 PCDD/PCDF Recovery Standard Solution |
| EPA-8280MSS | M/C | U.S. EPA Method 8280 PCDD/PCDF Matrix Spiking Solution |
| EPA-8290HRCC1-5 | M/C | U.S. EPA Method 8290 PCDD/PCDF Calibration Kit |
| EPA-8290HRCC0.25 | M/C | U.S. EPA Method 8290 PCDD/PCDF Extended Calibration/Low Level Solution (CS0.25) |
| EPA-8290HRCC0.5 | M/C | U.S. EPA Method 8290 PCDD/PCDF Extended Calibration/Low Level Solution (CS0.5) |
| EPA-8290SFS | M/C | U.S. EPA Method 8290 PCDD/PCDF Sample Fortification Solution |
| EPA-8290RSS | M/C | U.S. EPA Method 8290 PCDD/PCDF Recovery Standard Solution |
| EPA-8290MSS | M/C | U.S. EPA Method 8290 PCDD/PCDF Matrix Spiking Solution |
| EPA-8290STN | M/C | U.S. EPA Method 8290 PCDD/PCDF Native Stock Solution |
| EPA-23CS1-5 | M/C | U.S. EPA Method 23 PCDD/PCDF Calibration Kit |
| EPA-23IS | M/C | U.S. EPA Method 23 PCDD/PCDF Internal Standard Solution |
| EPA-23ISS | M/C | U.S. EPA Method 23 PCDD/PCDF Internal Standard Stock Solution |
| EPA-23SS | M/C | U.S. EPA Method 23 PCDD/PCDF Surrogate Standard Solution |
| EPA-23SSS | M/C | U.S. EPA Method 23 PCDD/PCDF Surrogate Standard Stock Solution |
| EPA-23RS | M/C | U.S. EPA Method 23 PCDD/PCDF Recovery Standard Solution |
| EPA-23AS | M/C | U.S. EPA Method 23 PCDD/PCDF Alternative Standard Solution |
| EN-1948CVS | M/C | European Standard Method EN-1948-4 PCDD/PCDF Calibration Kit |
| EN-1948CSL | M/C | European Standard Method EN-1948-4 PCDD/PCDF Extended Calibration/Low Level Solution (CSL) |
| EN-1948ES | M/C | European Standard Method EN-1948-4 PCDD/PCDF Extraction Standard Solution |
| EN-1948IS | M/C | European Standard Method EN-1948-4 PCDD/PCDF Syringe Standard Solution |
| EN-1948SS | M/C | European Standard Method EN-1948-4 PCDD/PCDF Sampling Standard Solution |
| EN-1948STK | M/C | European Standard Method EN-1948-4 PCDD/PCDF Native Stock Solution |
| 5CWDS | M/C | PCDD/PCDF Window Defining Mixture for DB-5/BP5/HP-2/Rtx-5/SPB-5 |
| 5TCDD | M/C | 2378-TCDD Specificity Mixture for DB-5/BP5/HP-2/Rtx-5/SPB-5 |
| 225TCDF | M/C | 2378-TCDF Specificity Mixture for DB/BP/HP/Rtx/SPB -225 |
| 5TDWD | M/C | PCDD/PCDF Combined Window Defining/2378-TCDD Specificity Mixture for DB-5/BP5/HP-2/Rtx-5/SPB-5 |
| TDTFWD | M/C | PCDD/PCDF Multi-Column Combined Window Defining/Specificity Mixture |
| DD-0-S | 262-12-4 | Dibenzo-p-dioxin Solution |
| DD-1-S | 39227-53-7 | 1-Chlorodibenzo-p-dioxin Solution |
| DD-2-S | 39227-54-8 | 2-Chlorodibenzo-p-dioxin Solution |
| DD-23-S | 29446-15-9 | 2,3-Dichlorodibenzo-p-dioxin Solution |
| DD-27-S | 33857-26-0 | 2,7-Dichlorodibenzo-p-dioxin Solution |
| DD-28-S | 38964-22-6 | 2,8-Dichlorodibenzo-p-dioxin Solution |
| DD-123-S | 54536-17-3 | 1,2,3-Trichlorodibenzo-p-dioxin Solution |
| DD-124-S | 39227-58-2 | 1,2,4-Trichlorodibenzo-p-dioxin Solution |
| DD-237-S | 33857-28-2 | 2,3,7-Trichlorodibenzo-p-dioxin Solution |
| DD-1234-S | 30746-58-8 | 1,2,3,4-Tetrachlorodibenzo-p-dioxin Solution |
| DD-1247/1248-S | 71669-28-8; 71669-29-9 |
1,2,4,7/1,2,4,8-Tetrachlorodibenzo-p-dioxin Solution/Mixture |
| DD-1278-S | 34816-53-0 | 1,2,7,8-Tetrachlorodibenzo-p-dioxin Solution |
| DD-1289-S | 62470-54-6 | 1,2,8,9-Tetrachlorodibenzo-p-dioxin Solution |
| DD-1368-S | 33423-92-6 | 1,3,6,8-Tetrachlorodibenzo-p-dioxin Solution |
| DD-1378-S | 50585-46-1 | 1,3,7,8-Tetrachlorodibenzo-p-dioxin Solution |
| DD-1379-S | 62470-53-5 | 1,3,7,9-Tetrachlorodibenzo-p-dioxin Solution |
| DD-1478-S | 40581-94-0 | 1,4,7,8-Tetrachlorodibenzo-p-dioxin Solution |
| DD-2378-S | 1746-01-6 | 2,3,7,8-Tetrachlorodibenzo-p-dioxin Solution |
| DD-12378-S | 40321-76-4 | 1,2,3,7,8-Pentachlorodibenzo-p-dioxin Solution |
| DD-12478-S | 58802-08-7 | 1,2,4,7,8-Pentachlorodibenzo-p-dioxin Solution |
| DD-123467-S | 58200-66-1 | 1,2,3,4,6,7-Hexachlorodibenzo-p-dioxin Solution |
| DD-123468-S | 58200-67-2 | 1,2,3,4,6,8-Hexachlorodibenzo-p-dioxin Solution |
| DD-123478-S | 39227-28-6 | 1,2,3,4,7,8-Hexachlorodibenzo-p-dioxin Solution |
| DD-123678-S | 57653-85-7 | 1,2,3,6,7,8-Hexachlorodibenzo-p-dioxin Solution |
| DD-123789-S | 19408-74-3 | 1,2,3,7,8,9-Hexachlorodibenzo-p-dioxin Solution |
| DD-124679-S | 39227-62-8 | 1,2,4,6,7,9-Hexachlorodibenzo-p-dioxin Solution |
| DD-1234678-S | 35822-46-9 | 1,2,3,4,6,7,8-Heptachlorodibenzo-p-dioxin Solution |
| DD-12346789-S | 3268-87-9 | Octachlorodibenzo-p-dioxin Solution |
| DF-0-S | 132-64-9 | Dibenzofuran Solution |
| DF-2-S | 51230-49-0 | 2-Chlorodibenzofuran Solution |
| DF-4-S | 74992-96-4 | 4-Chlorodibenzofuran Solution |
| DF-23-S | 64126-86-9 | 2,3-Dichlorodibenzofuran Solution |
| DF-24-S | 24478-74-8 | 2,4-Dichlorodibenzofuran Solution |
| DF-26-S | 60390-27-4 | 2,6-Dichlorodibenzofuran Solution |
| DF-27-S | 74992-98-6 | 2,7-Dichlorodibenzofuran Solution |
| DF-28-S | 5409-83-6 | 2,8-Dichlorodibenzofuran Solution |
| DF-136-S | 83704-39-6 | 1,3,6-Trichlorodibenzofuran Solution |
| DF-138-S | 76621-12-0 | 1,3,8-Trichlorodibenzofuran Solution |
| DF-146-S | 82911-60-2 | 1,4,6-Trichlorodibenzofuran Solution |
| DF-147-S | 83704-41-0 | 1,4,7-Trichlorodibenzofuran Solution |
| DF-149-S | 70648-13-4 | 1,4,9-Trichlorodibenzofuran Solution |
| DF-234-S | 57117-34-7 | 2,3,4-Trichlorodibenzofuran Solution |
| DF-236-S | 57117-33-6 | 2,3,6-Trichlorodibenzofuran Solution |
| DF-238-S | 57117-32-5 | 2,3,8-Trichlorodibenzofuran Solution |
| DF-246-S | 58802-14-5 | 2,4,6-Trichlorodibenzofuran Solution |
| DF-247-S | 83704-42-1 | 2,4,7-Trichlorodibenzofuran Solution |
| DF-248-S | 54589-71-8 | 2,4,8-Trichlorodibenzofuran Solution |
| DF-267-S | 83704-45-4 | 2,6,7-Trichlorodibenzofuran Solution |
| DF-1236-S | 83704-21-6 | 1,2,3,6-Tetrachlorodibenzofuran Solution |
| DF-1238-S | 62615-08-1 | 1,2,3,8-Tetrachlorodibenzofuran Solution |
| DF-1239-S | 83704-23-8 | 1,2,3,9-Tetrachlorodibenzofuran Solution |
| DF-1246-S | 71998-73-7 | 1,2,4,6-Tetrachlorodibenzofuran Solution |
| DF-1247-S | 83719-40-8 | 1,2,4,7-Tetrachlorodibenzofuran Solution |
| DF-1248-S | 64126-87-0 | 1,2,4,8-Tetrachlorodibenzofuran Solution |
| DF-1267-S | 83704-25-0 | 1,2,6,7-Tetrachlorodibenzofuran Solution |
| DF-1278-S | 58802-20-3 | 1,2,7,8-Tetrachlorodibenzofuran Solution |
| DF-1279-S | 83704-26-1 | 1,2,7,9-Tetrachlorodibenzofuran Solution |
| DF-1347-S | 70648-16-7 | 1,3,4,7-Tetrachlorodibenzofuran Solution |
| DF-1348-S | 92341-04-3 | 1,3,4,8-Tetrachlorodibenzofuran Solution |
| DF-1349-S | 83704-28-3 | 1,3,4,9-Tetrachlorodibenzofuran Solution |
| DF-1367-S | 57117-36-9 | 1,3,6,7-Tetrachlorodibenzofuran Solution |
| DF-1368-S | 71998-72-6 | 1,3,6,8-Tetrachlorodibenzofuran Solution |
| DF-1369-S | 83690-98-6 | 1,3,6,9-Tetrachlorodibenzofuran Solution |
| DF-1378-S | 57117-35-8 | 1,3,7,8-Tetrachlorodibenzofuran Solution |
| DF-1467-S | 66794-59-0 | 1,4,6,7-Tetrachlorodibenzofuran Solution |
| DF-1478-S | 83704-29-4 | 1,4,7,8-Tetrachlorodibenzofuran Solution |
| DF-2346-S | 83704-30-7 | 2,3,4,6-Tetrachlorodibenzofuran Solution |
| DF-2347-S | 83704-31-8 | 2,3,4,7-Tetrachlorodibenzofuran Solution |
| DF-2348-S | 83704-32-9 | 2,3,4,8-Tetrachlorodibenzofuran Solution |
| DF-2368-S | 57117-37-0 | 2,3,6,8-Tetrachlorodibenzofuran Solution |
| DF-2378-S | 51207-31-9 | 2,3,7,8-Tetrachlorodibenzofuran Solution |
| DF-2467-S | 57117-38-1 | 2,4,6,7-Tetrachlorodibenzofuran Solution |
| DF-2468-S | 58802-19-0 | 2,4,6,8-Tetrachlorodibenzofuran Solution |
| DF-3467-S | 57117-40-5 | 3,4,6,7-Tetrachlorodibenzofuran Solution |
| DF-12347-S | 83704-48-7 | 1,2,3,4,7-Pentachlorodibenzofuran Solution |
| DF-12348-S | 67517-48-0 | 1,2,3,4,8-Pentachlorodibenzofuran Solution |
| DF-12367-S | 57117-42-7 | 1,2,3,6,7-Pentachlorodibenzofuran Solution |
| DF-12378-S | 57117-41-6 | 1,2,3,7,8-Pentachlorodibenzofuran Solution |
| DF-12379-S | 83704-53-4 | 1,2,3,7,9-Pentachlorodibenzofuran Solution |
| DF-12389-S | 83704-54-5 | 1,2,3,8,9-Pentachlorodibenzofuran Solution |
| DF-12467-S | 83704-50-1 | 1,2,4,6,7-Pentachlorodibenzofuran Solution |
| DF-12468-S | 69698-57-3 | 1,2,4,6,8-Pentachlorodibenzofuran Solution |
| DF-12478-S | 58802-15-6 | 1,2,4,7,8-Pentachlorodibenzofuran Solution |
| DF-13467-S | 83704-36-3 | 1,3,4,6,7-Pentachlorodibenzofuran Solution |
| DF-13478-S | 58802-16-7 | 1,3,4,7,8-Pentachlorodibenzofuran Solution |
| DF-13479-S | 70648-20-3 | 1,3,4,7,9-Pentachlorodibenzofuran Solution |
| DF-13678-S | 70648-21-4 | 1,3,6,7,8-Pentachlorodibenzofuran Solution (>96%) |
| DF-23467-S | 57117-43-8 | 2,3,4,6,7-Pentachlorodibenzofuran Solution |
| DF-23478-S | 57117-31-4 | 2,3,4,7,8-Pentachlorodibenzofuran Solution |
| DF-123467-S | 79060-60-9 | 1,2,3,4,6,7-Hexachlorodibenzofuran Solution |
| DF-123468-S | 69698-60-8 | 1,2,3,4,6,8-Hexachlorodibenzofuran Solution |
| DF-123478-S | 70648-26-9 | 1,2,3,4,7,8-Hexachlorodibenzofuran Solution |
| DF-123489-S | 92341-07-6 | 1,2,3,4,8,9-Hexachlorodibenzofuran Solution |
| DF-123678-S | 57117-44-9 | 1,2,3,6,7,8-Hexachlorodibenzofuran Solution |
| DF-123789-S | 72918-21-9 | 1,2,3,7,8,9-Hexachlorodibenzofuran Solution |
| DF-234678-S | 60851-34-5 | 2,3,4,6,7,8-Hexachlorodibenzofuran Solution |
| DF-1234678-S | 67562-39-4 | 1,2,3,4,6,7,8-Heptachlorodibenzofuran Solution |
| DF-1234689-S | 69698-58-4 | 1,2,3,4,6,8,9-Heptachlorodibenzofuran Solution |
| DF-1234789-S | 55673-89-7 | 1,2,3,4,7,8,9-Heptachlorodibenzofuran Solution |
| DF-12346789-S | 39001-02-0 | Octachlorodibenzofuran Solution |
| MDD-0 | 125749-32-8 | (13C12)Dibenzo-p-dioxin Solution |
| MDD-2 | N/A | 2-Chloro(13C12)dibenzo-p-dioxin Solution |
| MDD-23 | N/A | 2,3-Dichloro(13C12)dibenzo-p-dioxin Solution |
| MDD-237 | N/A | 2,3,7-Trichloro(13C12)dibenzo-p-dioxin Solution |
| MDD-1234 | 114423-99-3 | 1,2,3,4-Tetrachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-1278 | N/A | 1,2,7,8-Tetrachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-1368 | N/A | 1,3,6,8-Tetrachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-1378 | N/A | 1,3,7,8-Tetrachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-2378 | 76523-40-5 | 2,3,7,8-Tetrachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-12378 | 109719-79-1 | 1,2,3,7,8-Pentachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-12389 | N/A | 1,2,3,8,9-Pentachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-12478 | N/A | 1,2,4,7,8-Pentachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-12479 | N/A | 1,2,4,7,9-Pentachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-123467 | N/A | 1,2,3,4,6,7-Hexachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-123468 | N/A | 1,2,3,4,6,8-Hexachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-123478 | 109719-80-4 | 1,2,3,4,7,8-Hexachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-123678 | 109719-81-5 | 1,2,3,6,7,8-Hexachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-123789 | 109719-82-6 | 1,2,3,7,8,9-Hexachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-1234678 | 109719-83-7 | 1,2,3,4,6,7,8-Heptachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-1234679 | N/A | 1,2,3,4,6,7,9-Heptachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-12346789 | 114423-97-1 | Octachloro(13C12)dibenzo-p-dioxin Solution |
| MCDD-2378 | 85508-50-5 | 2,3,7,8-(37Cl4)-Tetrachlorodibenzo-p-dioxin Solution |
| MDF-0 | N/A | (13C12)Dibenzofuran Solution |
| MDF-2 | N/A | 2-Chloro(13C12)dibenzofuran Solution |
| MDF-23 | N/A | 2,3-Dichloro(13C12)dibenzofuran Solution |
| MDF-238 | N/A | 2,3,8-Trichloro(13C12)dibenzofuran Solution |
| MDF-1234 | N/A | 1,2,3,4-Tetrachloro(13C12)dibenzofuran Solution |
| MDF-1278-1 | N/A | 1,2,7,8-Tetrachloro(13C12)dibenzofuran Solution |
| MDF-1278 | N/A | 1,2,7,8-Tetrachloro(13C12)dibenzofuran Solution |
| MDF-1368 | N/A | 1,3,6,8-Tetrachloro(13C12)dibenzofuran Solution |
| MDF-2378 | 89059-46-1 | 2,3,7,8-Tetrachloro(13C12)dibenzofuran Solution |
| MDF-12346-1 | N/A | 1,2,3,4,6-Pentachloro(13C12)dibenzofuran Solution |
| MDF-12346 | N/A | 1,2,3,4,6-Pentachloro(13C12)dibenzofuran Solution |
| MDF-12378 | 109719-77-9 | 1,2,3,7,8-Pentachloro(13C12)dibenzofuran Solution |
| MDF-13468 | N/A | 1,3,4,6,8-Pentachloro(13C12)dibenzofuran Solution |
| MDF-23478 | 116843-02-8 | 2,3,4,7,8-Pentachloro(13C12)dibenzofuran Solution |
| MDF-123469-1 | N/A | 1,2,3,4,6,9-Hexachloro(13C12)dibenzofuran Solution |
| MDF-123469 | N/A | 1,2,3,4,6,9-Hexachloro(13C12)dibenzofuran Solution |
| MDF-123478 | 114423-98-2 | 1,2,3,4,7,8-Hexachloro(13C12)dibenzofuran Solution |
| MDF-123678 | 116843-03-9 | 1,2,3,6,7,8-Hexachloro(13C12)dibenzofuran Solution |
| MDF-123789 | 116843-04-0 | 1,2,3,7,8,9-Hexachloro(13C12)dibenzofuran Solution |
| MDF-234678 | 116843-05-1 | 2,3,4,6,7,8-Hexachloro(13C12)dibenzofuran Solution |
| MDF-1234678 | 109719-84-8 | 1,2,3,4,6,7,8-Heptachloro(13C12)dibenzofuran Solution |
| MDF-1234689-1 | N/A | 1,2,3,4,6,8,9-Heptachloro(13C12)dibenzofuran Solution |
| MDF-1234689 | N/A | 1,2,3,4,6,8,9-Heptachloro(13C12)dibenzofuran Solution |
| MDF-1234789 | 109719-94-0 | 1,2,3,4,7,8,9-Heptachloro(13C12)dibenzofuran Solution |
| MDF-12346789 | 109719-78-0 | Octachloro(13C12)dibenzofuran Solution |
| DF-CVS-A10 | M/C | Polychlorinated Dibenzo-p-dioxin/Polychlorinated Dibenzofuran (PCDD/PCDF) Calibration Kit |
| DF-CVS-A5 | M/C | Polychlorinated Dibenzo-p-dioxin/Polychlorinated Dibenzofuran (PCDD/PCDF) Calibration Kit |
| DF-CVS-B10 | M/C | Polychlorinated Dibenzo-p-dioxin/Polychlorinated Dibenzofuran (PCDD/PCDF) Calibration Kit |
| DF-CVS-C10 | M/C | Polychlorinated Dibenzo-p-dioxin/Polychlorinated Dibenzofuran (PCDD/PCDF) Calibration Kit |
| DF-C10-CS8 | M/C | PCDD/PCDF Extended Calibration/High Level Solution (C10-CS8) |
| DFP-CVS-B10 | M/C | Polychlorinated Dibenzo-p-dioxin/Polychlorinated Dibenzofuran/Polychlorinated Biphenyl (PCDD/PCDF/PCB) Calibration Kit |
| NK-CVS-J | M/C | Polychlorinated Dibenzo-p-dioxin/Polychlorinated Dibenzofuran (PCDD/PCDF) Calibration Kit |
| DF-LCS-A | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-A200 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-A40 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-B | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-B200 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-B40 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-C | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-C200 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-C40 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DS-1000 | M/C | Mass-Labelled PCDD Solution/Mixture |
| FS-1000 | M/C | Mass-Labelled PCDF Solution/Mixture |
| NK-LCS-O | M/C | Mass-Labelled PCDD/PCDF Solution Mixture |
| NK-LCS-T | M/C | Mass-Labelled PCDD/PCDF Solution Mixture |
| DF-IS-A | M/C | Mass-Labelled PCDD Internal Standard Solution |
| DF-IS-A200 | M/C | Mass-Labelled PCDD Internal Standard Solution |
| DF-IS-A40 | M/C | Mass-Labelled PCDD Internal Standard Solution |
| DF-IS-B | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-B200 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-B40 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-C | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-C200 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-C40 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-D | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-D200 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-D40 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-E | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-E200 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-E40 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-F | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-F200 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-F40 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-G | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-G200 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-G40 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-H | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-H200 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-H40 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-I | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-I200 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-I40 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-J | M/C | Mass-Labelled PCDD Internal Standard Solution |
| DF-IS-J100 | M/C | Mass-Labelled PCDD Internal Standard Solution |
| DF-IS-J20 | M/C | Mass-Labelled PCDD Internal Standard Solution |
| NK-IS-J4 | M/C | Mass-Labelled PCDD Internal Standard Solution |
| NK-IS-J5 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DFP-LCS-B | M/C | Mass-Labelled PCDD/PCDF/PCB Solution/Mixture |
| DFP-LCS-B100 | M/C | Mass-Labelled PCDD/PCDF/PCB Solution/Mixture |
| DFP-LCS-B20 | M/C | Mass-Labelled PCDD/PCDF/PCB Solution/Mixture |
| DFP-LCS-A | M/C | Mass-Labelled PCDD/PCDF/PCB Solution/Mixture |
| DFP-IS-A | M/C | Mass-Labelled PCDF/PCB Syringe Spike Solution |
| DFP-SS-A | M/C | Mass-Labelled PCDD/PCB Sampling Spike Solution |
| DFP-IS-B10 | M/C | Mass-Labelled PCDD/PCB Internal Standard Solution |
| DFP-SS-A10 | M/C | Mass-Labelled PCDD/PCB Sampling Spike Solution |
| DF-ST-A | M/C | Native PCDD/PCDF Solution/Mixture |
| DF-ST-B | M/C | Native PCDD/PCDF Solution/Mixture |
| NK-ST-A | M/C | Native PCDD/PCDF Solution/Mixture |
| NK-ST-A4 | M/C | Native PCDD/PCDF Solution/Mixture |
| NK-ST-B2 | M/C | Native PCDD/PCDF Solution/Mixture |
| NK-ST-B4 | M/C | Native PCDD/PCDF Solution/Mixture |
| DDF-MDT | M/C | Native PCDD/PCDF Solution/Mixture |
| MDDF-MDT | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| WP-CVS | M/C | WHO Polychlorinated Biphenyl (PCB) Calibration Kit |
| WP-LCS | M/C | WHO PCB Surrogate Spiking Solution |
| WP-ISS | M/C | WHO PCB Internal Standard Solution |
| WP-STK | M/C | WHO PCB Native Stock Solution |
| 68C-CVS | M/C | U.S. EPA Method 1668C PCB Calibration Kit |
| 68C-LCS | M/C | U.S. EPA Method 1668C PCB Mass-Labelled Toxics/LOC/Window-Defining Stock Solution |
| 68C-CS | M/C | U.S. EPA Method 1668C PCB Mass-Labelled Cleanup Stock Solution |
| 68C-IS | M/C | U.S. EPA Method 1668C PCB Mass-Labelled Injection/Internal Standard Stock Solution |
| 68C-PAR | M/C | U.S. EPA Method 1668C PCB Native Toxics/LOC Stock Solution |
| EPA-1668CVS | M/C | U.S. EPA Method 1668 PCB Calibration Kit |
| EPA-1668LCS | M/C | U.S. EPA Method 1668 PCB Labelled Compound Stock Solution |
| EPA-1668CS | M/C | U.S. EPA Method 1668 PCB Cleanup Standard Solution |
| EPA-1668IS | M/C | U.S. EPA Method 1668 PCB Internal Standard Stock Solution |
| EPA-1668PAR | M/C | U.S. EPA Method 1668 PCB Precision and Recovery Solution |
| EC9605-CVS | M/C | Environment Canada Report EPS 1/RM/31 PCB Calibration Kit |
| EC9605-RS | M/C | Environment Canada Report EPS 1/RM/31 PCB Recovery Standard Solution |
| EC9605-SS | M/C | Environment Canada Report EPS 1/RM/31 PCB Surrogate Solution |
| EC9605-PAR | M/C | Environment Canada Report EPS 1/RM/31 PCB Precision and Recovery Solution |
| P48-W-CVS | M/C | European Standard Method EN 1948-4 WHO PCB Calibration Kit |
| P48-M-CVS | M/C | European Standard Method EN 1948-4 Marker PCB Calibration Kit |
| WM48-CVS | M/C | European Standard Method EN 1948-4 WHO & Marker PCB Calibration Kit |
| P48-W-PAR | M/C | European Standard Method EN 1948-4 WHO PCB Precision and Recovery Stock Solution |
| P48-M-PAR | M/C | European Standard Method EN 1948-4 Marker PCB Precision and Recovery Stock Solution |
| P48-W-ES | M/C | European Standard Method EN 1948-4 WHO PCB Extraction Standard |
| P48-M-ES | M/C | European Standard Method EN 1948-4 Marker PCB Extraction Standard |
| P48-SS | M/C | European Standard Method EN 1948-4 Mass-Labelled PCB Sampling Standard |
| P48-RS | M/C | European Standard Method EN 1948-4 Mass-Labelled PCB Recovery Standard |
| P48-SS-STK | M/C | European Standard Method EN 1948-4 Mass-Labelled PCB Sampling Standard Stock Solution |
| P48-RS-STK | M/C | European Standard Method EN 1948-4 Mass-Labelled PCB Recovery Standard Stock Solution |
| P48-W-ES-STK | M/C | European Standard Method EN 1948-4 WHO PCB Extraction Standard Stock Solution |
| P48-M-PAR-STK | M/C | European Standard Method EN 1948-4 Native Marker PCB Stock Solution |
| MBP-1 | 234432-85-0 | 2-Chloro(13C12)]biphenyl Solution |
| MBP-3 | 208263-77-8 | 4-Chloro(13C12)biphenyl Solution |
| MBP-4 | 234432-86-1 | 2,2′-Dichloro(13C12)biphenyl Solution |
| MBP-5 | N/A | 2,3-Dichloro(13C12)biphenyl Solution |
| MBP-8 | N/A | 2,4′-Dichloro(13C12)biphenyl Solution |
| MBP-9 | 250694-89-4 | 2,5-Dichloro(13C12)biphenyl Solution |
| MBP-11 | N/A | 3,3′-Dichloro(13C12)biphenyl Solution |
| MBP-15 | 208263-67-6 | 4,4′-Dichloro(13C12)biphenyl Solution |
| MBP-19 | 234432-87-2 | 2,2′,6-Trichloro(13C12)biphenyl Solution |
| MBP-28 | 208263-76-7 | 2,4,4′-Trichloro(13C12)biphenyl Solution |
| MBP-31 | 208263-78-9 | 2,4′,5-Trichloro(13C12)biphenyl Solution |
| MBP-37 | 208263-79-0 | 3,4,4′-Trichloro(13C12)biphenyl Solution |
| MBP-52 | 208263-80-3 | 2,2′,5,5′-Tetrachloro(13C12)biphenyl Solution |
| MBP-54 | 234432-88-3 | 2,2′,6,6′-Tetrachloro(13C12)biphenyl Solution |
| MBP-60 | N/A | 2,3,4,4′-Tetrachloro(13C12)biphenyl Solution |
| MBP-70 | 208263-81-4 | 2,3′,4′,5-Tetrachloro(13C12)biphenyl Solution |
| MBP-77 | 105600-23-5 | 3,3′,4,4′-Tetrachloro(13C12)biphenyl Solution |
| MBP-79 | 1027415-81-1 | 3,3′,4,5′-Tetrachloro(13C12)biphenyl Solution |
| MBP-81 | 208461-24-9 | 3,4,4′,5-Tetrachloro(13C12)biphenyl Solution |
| MBP-95 | N/A | 2,2′,3,5′,6-Pentachloro(13C12)biphenyl Solution |
| MBP-101 | 104130-39-4 | 2,2′,4,5,5′-Pentachloro(13C12)biphenyl Solution |
| MBP-104 | 234432-89-4 | 2,2′,4,6,6′-Pentachloro(13C12)biphenyl Solution |
| MBP-105 | 208263-62-1 | 2,3,3′,4,4′-Pentachloro(13C12)biphenyl Solution |
| MBP-111 | 235416-29-2 | 2,3,3′,5,5′-Pentachloro(13C12)biphenyl Solution |
| MBP-114 | 208263-63-2 | 2,3,4,4′,5-Pentachloro(13C12)biphenyl Solution |
| MBP-118 | 104130-40-7 | 2,3′,4,4′,5-Pentachloro(13C12)biphenyl Solution |
| MBP-123 | 208263-64-3 | 2′,3,4,4′,5-Pentachloro(13C12)biphenyl Solution |
| MBP-126 | 208263-65-4 | 3,3′,4,4′,5-Pentachloro(13C12)biphenyl Solution |
| MBP-127 | N/A | 3,3′,4,5,5′-Pentachloro(13C12)biphenyl Solution |
| MBP-133 | N/A | 2,2′,3,3′,5,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-138 | 208263-66-5 | 2,2′,3,4,4′,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-153 | 185376-58-3 | 2,2′,4,4′,5,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-155 | 234432-90-7 | 2,2′,4,4′,6,6′-Hexachloro(13C12)biphenyl Solution |
| MBP-156 | 208263-68-7 | 2,3,3′,4,4′,5-Hexachloro(13C12)biphenyl Solution |
| MBP-157 | 235416-30-5 | 2,3,3′,4,4′,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-159 | N/A | 2,3,3′,4,5,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-162 | N/A | 2,3,3′,4′,5,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-167 | 208263-69-8 | 2,3′,4,4′,5,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-169 | 208263-70-1 | 3,3′,4,4′,5,5′-Hexachloro(13C12)biphenyl Solution |
| MBP-170 | 160901-80-4 | 2,2′,3,3′,4,4′,5-Heptachloro(13C12)biphenyl Solution |
| MBP-178 | 232919-67-4 | 2,2′,3,3′,5,5′,6-Heptachloro(13C12)biphenyl Solution |
| MBP-180 | 160901-82-6 | 2,2′,3,4,4′,5,5′-Heptachloro(13C12)biphenyl Solution |
| MBP-188 | 234432-91-8 | 2,2′,3,4′,5,6,6′-Heptachloro(13C12)biphenyl Solution |
| MBP-189 | 208263-73-4 | 2,3,3′,4,4′,5,5′-Heptachloro(13C12)biphenyl Solution |
| MBP-194 | 208263-74-5 | 2,2′,3,3′,4,4′,5,5′-Octachloro(13C12)biphenyl Solution |
| MBP-202 | 105600-26-8 | 2,2′,3,3′,5,5′,6,6′-Octachloro(13C12)biphenyl Solution |
| MBP-205 | 234446-64-1 | 2,3,3′,4,4′,5,5′,6-Octachloro(13C12)biphenyl Solution |
| MBP-206 | 208263-75-6 | 2,2′,3,3′,4,4′,5,5′,6-Nonachloro(13C12)biphenyl Solution |
| MBP-208 | 234432-92-9 | 2,2′,3,3′,4,5,5′,6,6′-Nonachloro(13C12)biphenyl Solution |
| MBP-209 | 105600-27-9 | Decachloro(13C12)biphenyl Solution |
| PCB-CVS-H | M/C | Polychlorinated Biphenyl (PCB) Calibration Kit |
| PCB-LCS-H | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-ISS-H | M/C | Mass-Labelled PCB Internal/Recovery Standard Solution/Mixture |
| PCB-SCS-H | M/C | Mass-Labelled PCB Cleanup/Sampling Standard Solution/Mixture |
| PCB-PAR-H | M/C | Native PCB Solution/Mixture |
| PCB-CVS-A10 | M/C | Polychlorinated Biphenyl (PCB) Calibration Kit |
| PCB-LCS-A1 | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-LCS-A100 | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-LCS-A20 | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-IS-A | M/C | Mass-Labelled PCB Solution |
| PCB-IS-A100 | M/C | Mass-Labelled PCB Solution |
| PCB-IS-A20 | M/C | Mass-Labelled PCB Solution |
| PCB-IS-B | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-IS-B100 | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-IS-B20 | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-IS-C | M/C | Mass-Labelled PCB Syringe Spike Solution |
| PCB-IS-C100 | M/C | Mass-Labelled PCB Syringe Spike Solution |
| PCB-IS-C20 | M/C | Mass-Labelled PCB Syringe Spike Solution |
| PCB-SS-A | M/C | Mass-Labelled PCB Solution |
| PCB-SS-A100 | M/C | Mass-Labelled PCB Solution |
| PCB-SS-A20 | M/C | Mass-Labelled PCB Solution |
| BP-D7 | M/C | Native PCB Congener Solution/Mixture |
| MBP-D7 | M/C | Mass-Labelled PCB Congener Solution/Mixture |
| MBP-CP | M/C | Mass-Labelled Coplanar PCB Solution/Mixture |
| MBP-MO | M/C | Mass-Labelled Mono-Ortho PCB Solution/Mixture |
| MBP-CG | M/C | Mass-Labelled Mono to Decachloro PCB Solution/Mixture |
| MBP-MXE | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-ST-A | M/C | Native PCB Stock Solution |
| PCB-ST-A10 | M/C | Native PCB Stock Solution |
| PCB-ST-A2 | M/C | Native PCB Stock Solution |
| BP-CP81 | M/C | Native Coplanar PCB Solution/Mixture |
| BP-WD | M/C | PCB Window Defining Mixture for DB-5 |
| BP-MO | M/C | Native Mono-ortho PCB Solution/Mixture |
| BP-MS | M/C | Native PCB Solution/Mixture |
| BP-MS2 | M/C | Native PCB Solution/Mixture |
| BFR-CVS | M/C | Polybrominated Diphenyl Ether (PBDE)/Brominated Flame Retardant (BFR) Calibration Kit |
| BFR-LCS | M/C | PBDE/BFR Labelled Compound Solution/Mixture |
| BFR-ISS | M/C | PBDE/BFR Internal/Injection Standard Solution |
| BFR-SCS | M/C | PBDE/BFR Sampling/Cleanup Standard Solution |
| BFR-PAR | M/C | PBDE/BFR Native Stock Solution |
| BFR-LCS-STK | M/C | PBDE/BFR Labelled Compound Stock Solution |
| BFR-ISS-STK | M/C | PBDE/BFR Internal/Injection Standard Stock Solution |
| BDE-MXE | M/C | Native PBDE Solution/Mixture |
| BDE-CVS-F | M/C | Polybrominated Diphenyl Ether (PBDE) Calibration Kit |
| MBDE-MXFS | M/C | Mass-Labelled PBDE Surrogate Stock Solution |
| MBDE-MXFR | M/C | Mass-Labelled PBDE Recovery Stock Solution |
| BDE-MXF | M/C | Native PBDE Stock Solution |
| BDE-CVS-G | M/C | Polybrominated Diphenyl Ether (PBDE) Calibration Kit |
| MBDE-MXG | M/C | Mass-Labelled PBDE Solution/Mixture |
| MBDE-ISS-G | M/C | Mass-Labelled PBDE Internal Standard Solution |
| BDE-1 | 7025-06-1 | 2-Bromodiphenyl ether Solution |
| BDE-2 | 6876-00-2 | 3-Bromodiphenyl ether Solution |
| BDE-3 | 101-55-3 | 4-Bromodiphenyl ether Solution |
| BDE-7 | 171977-44-9 | 2,4-Dibromodiphenyl ether Solution |
| BDE-10 | 51930-04-2 | 2,6-Dibromodiphenyl ether Solution |
| BDE-15 | 2050-47-7 | 4,4′-Dibromodiphenyl ether Solution |
| BDE-17 | 147217-75-2 | 2,2′,4-Tribromodiphenyl ether Solution |
| BDE-21 | 337513-67-4 | 2,3,4-Tribromodiphenyl ether Solution |
| BDE-28 | 41318-75-6 | 2,4,4′-Tribromodiphenyl ether Solution |
| BDE-30 | 155999-95-4 | 2,4,6-Tribromodiphenyl ether Solution |
| BDE-37 | 147217-81-0 | 3,4,4′-Tribromodiphenyl ether Solution |
| BDE-47 | 5436-43-1 | 2,2′,4,4′-Tetrabromodiphenyl ether Solution |
| BDE-49 | 243982-82-3 | 2,2′,4,5′-Tetrabromodiphenyl ether Solution |
| BDE-54 | N/A | 2,2′,6,6′-Tetrabromodiphenyl ether Solution |
| BDE-60 | 446254-31-5 | 2,3,4,4′-Tetrabromodiphenyl ether Solution |
| BDE-66 | 189084-61-5 | 2,3′,4,4′-Tetrabromodiphenyl ether Solution |
| BDE-71 | 189084-62-6 | 2,3′,4′,6-Tetrabromodiphenyl ether Solution |
| BDE-77 | 93703-48-1 | 3,3′,4,4′-Tetrabromodiphenyl ether Solution |
| BDE-82 | 327185-11-5 | 2,2′,3,3′,4-Pentabromodiphenyl ether Solution |
| BDE-85 | 182346-21-0 | 2,2′,3,4,4′-Pentabromodiphenyl ether Solution |
| BDE-99 | 60348-60-9 | 2,2′,4,4′,5-Pentabromodiphenyl ether Solution |
| BDE-100 | 189084-64-8 | 2,2′,4,4′,6-Pentabromodiphenyl ether Solution |
| BDE-104 | 446254-68-8 | 2,2′,4,6,6′-Pentabromodiphenyl ether Solution |
| BDE-105 | 373594-78-6 | 2,3,3′,4,4′-Pentabromodiphenyl ether Solution |
| BDE-119 | 189084-66-0 | 2,3′,4,4′,6-Pentabromodiphenyl ether Solution |
| BDE-126 | 366791-32-4 | 3,3′,4,4′,5-Pentabromodiphenyl ether Solution |
| BDE-128 | 182677-28-7 | 2,2′,3,3′,4,4′-Hexabromodiphenyl ether Solution |
| BDE-138 | 182677-30-1 | 2,2′,3,4,4′,5′-Hexabromodiphenyl ether Solution |
| BDE-139 | 446254-96-2 | 2,2′,3,4,4′,6-Hexabromodiphenyl ether Solution |
| BDE-140 | 243982-83-4 | 2,2′,3,4,4′,6′-Hexabromodiphenyl ether Solution |
| BDE-149 | N/A | 2,2′,3,4′,5′,6-Hexabromodiphenyl ether Solution |
| BDE-153 | 68631-49-2 | 2,2′,4,4′,5,5′-Hexabromodiphenyl ether Solution |
| BDE-154 | 207122-15-4 | 2,2′,4,4′,5,6′-Hexabromodiphenyl ether Solution |
| BDE-155 | 35854-94-5 | 2,2′,4,4′,6,6′-Hexabromodiphenyl ether Solution |
| BDE-156 | N/A | 2,3,3′,4,4′,5-Hexabromodiphenyl ether Solution |
| BDE-169 | 446255-18-1 | 3,3′,4,4′,5,5′-Hexabromodiphenyl ether Solution |
| BDE-170 | 327185-13-7 | 2,2′,3,3′,4,4′,5-Heptabromodiphenyl ether Solution |
| BDE-171 | 446255-19-2 | 2,2′,3,3′,4,4′,6-Heptabromodiphenyl ether Solution |
| BDE-175 | 446255-22-7 | 2,2′,3,3′,4,5′,6-Heptabromodiphenyl ether Solution |
| BDE-176 | 407606-61-5 | 2,2′,3,3′,4,6,6′-Heptabromodiphenyl ether Solution |
| BDE-177 | 446255-23-8 | 2,2′,3,3′,4′,5,6-Heptabromodiphenyl ether Solution |
| BDE-179 | 446255-25-0 | 2,2′,3,3′,5,6,6′-Heptabromodiphenyl ether Solution |
| BDE-180 | 446255-26-1 | 2,2′,3,4,4′,5,5′-Heptabromodiphenyl ether Solution |
| BDE-181 | 189084-67-1 | 2,2′,3,4,4′,5,6-Heptabromodiphenyl ether Solution |
| BDE-182 | 442690-45-1 | 2,2′,3,4,4′,5,6′-Heptabromodiphenyl ether Solution |
| BDE-183 | 207122-16-5 | 2,2′,3,4,4′,5′,6-Heptabromodiphenyl ether Solution |
| BDE-184 | 117948-63-7 | 2,2′,3,4,4′,6,6′-Heptabromodiphenyl ether Solution |
| BDE-188 | 116995-32-5 | 2,2′,3,4′,5,6,6′-Heptabromodiphenyl ether Solution |
| BDE-189 | 259087-35-9 | 2,3,3′,4,4′,5,5′-Heptabromodiphenyl ether Solution |
| BDE-191 | 446255-30-7 | 2,3,3′,4,4′,5′,6-Heptabromodiphenyl ether Solution |
| BDE-194 | 85446-17-9 | 2,2′,3,3′,4,4′,5,5′-Octabromodiphenyl ether Solution |
| BDE-195 | 446255-38-5 | 2,2′,3,3′,4,4′,5,6-Octabromodiphenyl ether Solution |
| BDE-196 | N/A | 2,2′,3,3′,4,4′,5,6′-Octabromodiphenyl ether Solution |
| BDE-197 | 117964-21-3 | 2,2′,3,3′,4,4′,6,6′-Octabromodiphenyl ether Solution |
| BDE-198 | 446255-42-1 | 2,2′,3,3′,4,5,5′,6-Octabromodiphenyl ether Solution |
| BDE-199 | 446255-43-2 | 2,2′,3,3′,4,5,5′,6′-Octabromodiphenyl ether Solution |
| BDE-200 | 446255-46-5 | 2,2′,3,3′,4,5,6,6′-Octabromodiphenyl ether Solution |
| BDE-201 | 446255-50-1 | 2,2′,3,3′,4,5′,6,6′-Octabromodiphenyl ether Solution |
| BDE-202 | 67797-09-5 | 2,2′,3,3′,5,5′,6,6′-Octabromodiphenyl ether Solution |
| BDE-203 | 337513-72-1 | 2,2′,3,4,4′,5,5′,6-Octabromodiphenyl ether Solution |
| BDE-204 | 446255-54-5 | 2,2′,3,4,4′,5,6,6′-Octabromodiphenyl ether Solution |
| BDE-205 | 446255-56-7 | 2,3,3′,4,4′,5,5′,6-Octabromodiphenyl ether Solution |
| BDE-206 | 63387-28-0 | 2,2′,3,3′,4,4′,5,5′,6-Nonabromodiphenyl ether Solution |
| BDE-207 | 437701-79-6 | 2,2′,3,3′,4,4′,5,6,6′-Nonabromodiphenyl ether Solution |
| BDE-208 | 437701-78-5 | 2,2′,3,3′,4,5,5′,6,6′-Nonabromodiphenyl ether Solution |
| BDE-209 | 1163-19-5 | Decabromodiphenyl ether Solution |
| 4PC-BDE-208 | 918947-03-2 | 2,2′,3,3′,4,5,5′,6,6′-Nonabromo-4′-chlorodiphenyl ether Solution |
| BDE-WD | M/C | PBDE Window Defining Mixture for DB-5HT |
| BDE-OND | M/C | Native PBDE (Octa, Nona, Deca) Solution/Mixture |
| BDE-MXA | M/C | Native PBDE Solution/Mixture |
| BDE-MXB | M/C | Native PBDE Solution/Mixture |
| BDE-MXD | M/C | Native PBDE Solution/Mixture |
| MBDE-3 | 488710-15-2 | 4-Bromo(13C12)]diphenyl ether Solution |
| MBDE-15 | 488710-17-4 | 4,4′-Dibromo(13C12)diphenyl ether Solution |
| MBDE-28 | 488710-19-6 | 2,4,4′-Tribromo(13C12)diphenyl ether Solution |
| MBDE-47 | 488710-20-9 | 2,2′,4,4′-Tetrabromo(13C12)diphenyl ether Solution |
| MBDE-77 | 1401355-55-2 | 3,3′,4,4′-Tetrabromo(13C12)diphenyl ether Solution |
| MBDE-79 | N/A | 3,3′,4,5′-Tetrabromo(13C12)diphenyl ether Solution |
| MBDE-99 | 488710-21-0 | 2,2′,4,4′,5-Pentabromo(13C12)diphenyl ether Solution |
| MBDE-100 | 678997-41-6 | 2,2′,4,4′,6-Pentabromo(13C12)diphenyl ether Solution |
| MBDE-126 | 1401355-56-3 | 3,3′,4,4′,5-Pentabromo(13C12)diphenyl ether Solution |
| MBDE-138 | 1401355-57-4 | 2,2′,3,4,4′,5′-Hexabromo(13C12)diphenyl ether Solution |
| MBDE-139 | 488710-25-4 | 2,2′,3,4,4′,6-Hexabromo(13C12)diphenyl ether Solution |
| MBDE-153 | 488710-22-1 | 2,2′,4,4′,5,5′-Hexabromo(13C12)diphenyl ether Solution |
| MBDE-154 | 488710-23-2 | 2,2′,4,4′,5,6′-Hexabromo(13C12)diphenyl ether Solution |
| MBDE-169 | 1401355-58-5 | 3,3′,4,4′,5,5′-Hexabromo(13C12)diphenyl ether Solution |
| MBDE-180 | N/A | 2,2′,3,4,4′,5,5′-Heptabromo(13C12)diphenyl ether Solution |
| MBDE-183 | 488710-24-3 | 2,2′,3,4,4′,5′,6-Heptabromo(13C12)diphenyl ether Solution |
| MBDE-197 | 1367487-31-7 | 2,2′,3,3′,4,4′,6,6′-Octabromo(13C12)diphenyl ether Solution |
| MBDE-205 | 1401355-59-6 | 2,3,3′,4,4′,5,5′,6-Octabromo(13C12)diphenyl ether Solution |
| MBDE-206 | N/A | 2,2′,3,3′,4,4′,5,5′,6-Nonabromo(13C12)diphenyl ether Solution |
| MBDE-207 | 1367487-33-9 | 2,2′,3,3′,4,4′,5,6,6′-Nonabromo(13C12)diphenyl ether Solution |
| MBDE-209 | N/A | Decabromo(13C12)diphenyl ether Solution |
| MBDE-MXA | M/C | Mass-Labelled PBDE Solution/Mixture |
| MBDE-MXB | M/C | Mass-Labelled PBDE Solution/Mixture |
| MBDE-MXC | M/C | Mass-Labelled PBDE Solution/Mixture |
| TBDE-71 | 32534-81-9 | Great Lakes DE-71 Pentabromodiphenyl Oxide Solution/Mixture |
| TBDE-79 | 32536-52-0 | Great Lakes DE-79 Octabromodiphenyl Oxide Solution/Mixture |
| TBDE-83R | 1163-19-5 | Great Lakes DE-83 Decabromodiphenyl Oxide Solution/Mixture |
| 5MBDE47 | 602326-19-2 | 2,2′,4,4′-Tetrabromo-5-methoxydiphenyl ether Solution |
| 6MBDE47 | 102739-99-1 | 2,2′,4,4′-Tetrabromo-6-methoxydiphenyl ether Solution |
| 4PMBDE49 | 602326-26-1 | 2,2′,4′,5-Tetrabromo-4-methoxydiphenyl ether Solution |
| 2PMBDE68 | 96920-28-4 | 2′,3,4′,5-Tetrabromo-2-methoxydiphenyl ether Solution |
| 5PMBDE99 | 1013432-29-5 | 2,2′,4,4′,5-Pentabromo-5′-methoxydiphenyl ether Solution |
| 5PMBDE100 | 1185773-70-9 | 2,2′,4,4′,6′-Pentabromo-5-methoxydiphenyl ether Solution |
| 4PMBDE101 | 1185773-72-1 | 2,2′,4,5,5′-Pentabromo-4′-methoxydiphenyl ether Solution |
| 4PMBDE103 | 1185773-71-0 | 2,2′,4′,5,6′-Pentabromo-4-methoxydiphenyl ether Solution |
| MeOBDES | M/C | Native MeO-PBDEs Solution/Mixture |
| M6MBDE47 | N/A | 2,2′,4,4′-Tetrabromo-6-methoxy(13C12)diphenyl ether Solution |
| M6PMBDE100 | N/A | 2,2′,4,4′,6-Pentabromo-6′-methoxy(13C12)diphenyl ether Solution |
| M6HBDE47 | N/A | 2,2′,4,4′-Tetrabromo-6-hydroxy(13C12)diphenyl ether Solution |
| M6PHBDE100 | N/A | 2,2′,4,4′,6-Pentabromo-6′-hydroxy(13C12)diphenyl ether Solution |
| aHBCD | 134237-50-6 | rac-alpha-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| bHBCD | 134237-51-7 | rac-beta-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| gHBCD | 134237-52-8 | rac-gamma-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| dHBCD | 65701-47-5 | delta-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| eHBCD | 4736-49-6 | epsilon-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| zHBCD | 878049-06-0 | zeta-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| etaHBCD | 1392102-29-2 | rac-eta-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| tHBCD | 878049-07-1 | theta-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| iHBCD | 1392102-30-5 | rac-iota-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| kHBCD | 1392102-31-6 | rac-kappa-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| MaHBCD | 870247-98-6 | rac-alpha-1,2,5,6,9,10-Hexabromo(13C12)cyclododecane Solution |
| MbHBCD | 870248-00-3 | rac-beta-1,2,5,6,9,10-Hexabromo(13C12)cyclododecane Solution |
| MgHBCD | 676552-82-2 | rac-gamma-1,2,5,6,9,10-Hexabromo(13C12)cyclododecane Solution |
| DaHBCD | 870247-99-7 | d18-rac-alpha-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| DbHBCD | 870248-01-4 | d18-rac-beta-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| DgHBCD | 676552-83-3 | d18-rac-gamma-1,2,5,6,9,10-Hexabromocyclododecane Solution |
| HBCD-MXA | M/C | Native HBCD Isomers (α,β,γ) Solution/Mixture |
| MHBCD-MXA | M/C | Mass-Labelled HBCD Isomers (α,β,γ) Solution/Mixture |
| PBCD | N/A | rac-(1,5R,6S,9S,10R)-Pentabromocyclododecene Solution |
| TBBPA | 79-94-7 | 3,3′,5,5′-Tetrabromobisphenol-A Solution |
| MTBBPA | 1352876-39-1 | 3,3′,5,5′-Tetrabromobisphenol-A (13C12-rings) Solution |
| DBDPE | 84852-53-9 | 1,2-Bis(pentabromophenyl)ethane Solution |
| MDBDPE | N/A | 1,2-Bis(pentabromophenyl)ethane (13C14) Solution |
| BTBPE | 37853-59-1 | 1,2-Bis(2,4,6-tribromophenoxy)ethane Solution |
| MBTBPE | N/A | 1,2-Bis(2,4,6-tribromo(13C6)phenoxy)ethane Solution |
| HBBZ | 87-82-1 | Hexabromobenzene Solution |
| MHBBZ | 2483735-50-6 | Hexabromo(13C6)benzene Solution |
| PBBZ | 608-90-2 | Pentabromobenzene Solution |
| MPBBZ | N/A | Pentabromo(13C6)benzene Solution |
| PBEB | 85-22-3 | Pentabromoethylbenzene Solution |
| PBT | 87-83-2 | Pentabromotoluene Solution |
| pTBX | 23488-38-2 | 2,3,5,6-Tetrabromo-p-xylene Solution |
| aTBCO | 3194-57-8 | (1R,2R,5S,6S)-1,2,5,6-Tetrabromocyclooctane Solution |
| bTBCO | 3194-57-8 | rac-(1R,2R,5R,6R)-1,2,5,6-Tetrabromocyclooctane Solution |
| bTBECH | 3322-93-8 | rac-(1R,2R)-1,2-Dibromo-(4S)-4-((1S)-1,2-dibromoethyl)cyclohexane Solution |
| gTBECH | 3322-93-8 | rac-(1R,2R)-1,2-Dibromo-(4R)-4-((1R)-1,2-dibromoethyl)cyclohexane Solution |
| abTBECH | 3322-93-8 | TBECH Isomers (α,β) Solution/Mixture |
| gdTBECH | 3322-93-8 | TBECH Isomers (γ,δ) Solution/Mixture |
| OBIND | 155613-93-7 | Octabromotrimethylphenylindane Solution |
| BEHTBP | 26040-51-7 | Bis(2-ethyl-1-hexyl) tetrabromophthalate Solution |
| MBEHTBP | N/A | Bis[2-(2H5)ethyl(2H12)hexyl] tetrabromo(13C6)phthalate Solution |
| EHTBB | 183658-27-7 | 2-Ethylhexyl 2,3,4,5-tetrabromobenzoate Solution |
| MEHTBB | N/A | rac-2-(2H5)Ethyl(2H12)hexyl 2,3,4,5-tetrabromo(13C6)benzoate Solution |
| HCDBCO | 51936-55-1 | Hexachlorocyclopentenyl-dibromocyclooctane Solution |
| TBCT | 39569-21-6 | Tetrabromo-o-chlorotoluene Solution |
| PBBA | 59447-55-1 | Pentabromobenzyl acrylate Solution |
| ATE | 3278-89-5 | Allyl 2,4,6-tribromophenyl ether Solution |
| DPTE | 35109-60-5 | 2,3-Dibromopropyl 2,4,6-tribromophenyl ether Solution |
| BATE | 99717-56-3 | 2-Bromoallyl 2,4,6-tribromophenyl ether Solution |
| s-DP | 135821-03-3 | syn-Dechlorane Plus Solution |
| a-DP | 135821-74-8 | anti-Dechlorane Plus Solution |
| aCl10DP | 1632364-26-1 | anti-Cl10-Dechlorane Plus Solution |
| aCl11DP | 1258787-06-2 | anti-Cl11-Dechlorane Plus Solution |
| DPMA(1,5-DPMA) | 10297-21-9 | 1,5-Dechlorane Plus monoadduct Solution |
| 1,3-DPMA | 70267-37-7 | 1,3-Dechlorane Plus monoadduct Solution |
| DBCD | 18300-04-4 | Dibromochlordene Solution |
| Dec-601 | 13560-90-2 | Dechlorane 601 Solution |
| Dec-602 | 31107-44-5 | Dechlorane 602 Solution |
| Dec-603 | 13560-92-4 | Dechlorane 603 Solution |
| Dec-604 | 34571-16-9 | Dechlorane 604 Solution |
| Dec-604CB | 56890-89-2 | Dechlorane 604 Component B Solution |
| CPlus | 13560-91-3 | Chlordene Plus Solution |
| DBALD | 1482458-57-0 | Dibromoaldrin Solution |
| HCPN | N/A | Hexachloro(phenyl)norbornene Solution |
| T23BPIC | 52434-90-9 | Tris(2,3-dibromopropyl)isocyanurate Solution |
| TBBA | 27581-13-1 | 2,3,4,5-Tetrabromobenzoic acid Solution (with 4 mole eq. NaOH) |
| MeTBBA | 1448844-87-8 | Methyl-2,3,4,5-tetrabromobenzoate Solution |
| MTBBA | 2710628-49-0 | 2,3,4,5-Tetrabromobenzoic acid (13C6-ring) Solution (with 4 mole eq. NaOH) |
| TBPAn | 632-79-1 | Tetrabromophthalic anhydride Solution |
| MTBPAn | N/A | Tetrabromo(13C6)phthalic anhydride Solution |
| BDCP | 72236-72-7 | Bis(1,3-dichloro-2-propyl) phosphate Solution |
| TPP | 115-86-6 | Triphenyl phosphate Solution |
| TOTP | 78-30-8 | Tri-o-tolyl phosphate Solution |
| TMTP | 563-04-2 | Tri-m-tolyl phosphate Solution |
| TPTP | 78-32-0 | Tri-p-tolyl phosphate Solution |
| B2tBPPP | 65652-41-7 | Bis(2-tert-butylphenyl) phenyl phosphate Solution |
| B4tBPPP | 115-87-7 | Bis(4-tert-butylphenyl) phenyl phosphate Solution |
| 2tBPDPP | N/A | 2-tert-Butylphenyl diphenyl phosphate Solution |
| 4tBPDPP | 981-40-8 | 4-tert-Butylphenyl diphenyl phosphate Solution |
| T4tBPP | 78-33-1 | Tris(4-tert-butylphenyl) phosphate Solution |
| T2IPPP | 64532-95-2 | Tris(2-isopropylphenyl) phosphate Solution |
| T3IPPP | 72668-27-0 | Tris(3-isopropylphenyl) phosphate Solution |
| T4IPPP | 2502-15-0 | Tris(4-isopropylphenyl) phosphate Solution |
| T34DMPP | 3862-11-1 | Tris(3,4-dimethylphenyl) phosphate Solution |
| T35DMPP | 25653-16-1 | Tris(3,5-dimethylphenyl) phosphate Solution |
| B24DIPPPP | 2190501-29-0 | Bis(2,4-diisopropylphenyl) phenyl phosphate Solution |
| B2IPPPP | 69500-29-4 | Bis(2-isopropylphenyl) phenyl phosphate Solution |
| B4IPPPP | 55864-07-8 | Bis(4-isopropylphenyl) phenyl phosphate Solution |
| 2IPPDPP | 64532-94-1 | 2-Isopropylphenyl diphenyl phosphate Solution |
| 4IPPDPP | 55864-04-5 | 4-Isopropylphenyl diphenyl phosphate Solution |
| 24DIPPDPP | 96107-55-0 | 2,4-Diisopropylphenyl diphenyl phosphate Solution |
| MTPP | N/A | 13C18-Triphenyl phosphate Solution |
| TEP | 78-40-0 | Tri-ethyl phosphate Solution |
| TPrP | 513-08-6 | Tri-n-propyl phosphate Solution |
| TBP | 126-73-8 | Tri-n-butyl phosphate Solution |
| TBEP | 78-51-3 | Tris(2-butoxyethyl) phosphate Solution |
| TDBPP | 126-72-7 | Tris(2,3-dibromopropyl) phosphate Solution |
| EHDP | 1241-94-7 | 2-Ethylhexyl diphenyl phosphate Solution |
| TEHP | 78-42-2 | Tris(2-ethylhexyl) phosphate Solution |
| TCEP | 115-96-8 | Tris(2-chloroethyl) phosphate Solution |
| TCPP | 13674-84-5 | Tris[(2R)-1-chloro-2-propyl] phosphate Solution |
| TDCPP | 13674-87-8 | Tris(1,3-dichloro-2-propyl) phosphate Solution |
| M6TBEP | N/A | Tris(2-butoxy-(13C2)-ethyl) phosphate Solution |
| dTEP | 135942-11-9 | Tri-ethyl phosphate-d15 Solution |
| dTPrP | 1219794-92-9 | Tri-n-propyl phosphate-d21 Solution |
| dTBP | 61196-26-7 | Tri-n-butyl phophate-d27 Solution |
| dTPP | 1173020-30-8 | Triphenyl phosphate-d15 Solution |
| dTCEP | 1276500-47-0 | Tris(2-chloroethyl) phosphate-d12 Solution |
| dTDCPP | 1447569-77-8 | Tris(1,3-dichloro-2-propyl) phophate-d15 Solution |
| dBDCP | N/A | Bis(1,3-dichloro-2-propyl) phosphate-d10 Solution |
| BB-1 | 2052-07-5 | 2-Bromobiphenyl Solution |
| BB-2 | 2113-57-7 | 3-Bromobiphenyl Solution |
| BB-3 | 92-66-0 | 4-Bromobiphenyl Solution |
| BB-4 | 13029-09-9 | 2,2′-Dibromobiphenyl Solution |
| BB-7 | 53592-10-2 | 2,4-Dibromobiphenyl Solution |
| BB-9 | 57422-77-2 | 2,5-Dibromobiphenyl Solution |
| BB-10 | 59080-32-9 | 2,6-Dibromobiphenyl Solution |
| BB-15 | 92-86-4 | 4,4′-Dibromobiphenyl Solution |
| BB-18 | 59080-34-1 | 2,2′,5-Tribromobiphenyl Solution |
| BB-22 | N/A | 2,3,4′-Tribromobiphenyl Solution |
| BB-26 | 59080-35-2 | 2,3′,5-Tribromobiphenyl Solution |
| BB-29 | 115245-07-3 | 2,4,5-Tribromobiphenyl Solution |
| BB-30 | 59080-33-0 | 2,4,6-Tribromobiphenyl Solution |
| BB-31 | 59080-36-3 | 2,4′,5-Tribromobiphenyl Solution |
| BB-37 | 6683-35-8 | 3,4,4′-Tribromobiphenyl Solution |
| BB-38 | 115245-08-4 | 3,4,5-Tribromobiphenyl Solution |
| BB-49 | 60044-24-8 | 2,2′,4,5′-Tetrabromobiphenyl Solution |
| BB-52 | 59080-37-4 | 2,2′,5,5′-Tetrabromobiphenyl Solution |
| BB-53 | 60044-25-9 | 2,2′,5,6′-Tetrabromobiphenyl Solution |
| BB-56 | N/A | 2,3,3′,4′-Tetrabromobiphenyl Solution |
| BB-75 | 64258-02-2 | 2,4,4′,6-Tetrabromobiphenyl Solution |
| BB-77 | 77102-82-0 | 3,3′,4,4′-Tetrabromobiphenyl Solution |
| BB-80 | 16400-50-3 | 3,3′,5,5′-Tetrabromobiphenyl Solution |
| BB-101 | 67888-96-4 | 2,2′,4,5,5′-Pentabromobiphenyl Solution |
| BB-103 | 59080-39-6 | 2,2′,4,5′,6-Pentabromobiphenyl Solution |
| BB-153 | 59080-40-9 | 2,2′,4,4′,5,5′-Hexabromobiphenyl Solution |
| BB-154 | 36402-15-0 | 2,2′,4,4′,5,6′-Hexabromobiphenyl Solution |
| BB-155 | 59261-08-4 | 2,2′,4,4′,6,6′-Hexabromobiphenyl Solution |
| BB-156 | 77607-09-1 | 2,3,3′,4,4′,5-Hexabromobiphenyl Solution |
| BB-169 | 60044-26-0 | 3,3′,4,4′,5,5′-Hexabromobiphenyl Solution |
| BB-180 | 67733-52-2 | 2,2′,3,4,4′,5,5′-Heptabromobiphenyl Solution |
| BB-194 | 67889-00-3 | 2,2′,3,3′,4,4′,5,5′-Octabromobiphenyl Solution |
| BB-205 | N/A | 2,3,3′,4,4′,5,5′,6-Octabromobiphenyl Solution |
| BB-206 | 69278-62-2 | 2,2′,3,3′,4,4′,5,5′,6-Nonabromobiphenyl Solution |
| BB-209 | 13654-09-6 | Decabromobiphenyl Solution |
| PBB-MXA | M/C | Native PBB Solution/Mixture |
| TBB-BP6 | 59536-65-1 | Great Lakes Chemical Firemaster BP-6 Hexabromobiphenyl Solution/Mixture |
| TBB-809D | 27753-52-2 | Chemische Fabrik Kalk Bromkal 80-9D Nonabromobiphenyl Solution/Mixture |
| MBB-52 | 1401248-99-4 | 2,2′,5,5′-Tetrabromo(13C12)biphenyl Solution |
| MBB-153 | 1401249-00-0 | 2,2′,4,4′,5,5′-Hexabromo(13C12)biphenyl Solution |
| MBB-194 | 1401249-01-1 | 2,2′,3,3′,4,4′,5,5′-Octabromo(13C12)biphenyl Solution |
| MBB-209 | N/A | Decabromo(13C12)biphenyl Solution |
| MBB-MXA | M/C | Mass-Labelled PBB Solution/Mixture |
| BDD-1 | 105908-71-2 | 1-Bromodibenzo-p-dioxin Solution |
| BDD-27/28 | 39073-07-9; 105836-96-2 |
2,7/2,8-Dibromodibenzo-p-dioxin Solution/Mixture |
| BDD-237 | 51974-40-4 | 2,3,7-Tribromodibenzo-p-dioxin Solution |
| BDD-1234 | 104549-41-9 | 1,2,3,4-Tetrabromodibenzo-p-dioxin Solution |
| BDD-1378 | 109333-31-5 | 1,3,7,8-Tetrabromodibenzo-p-dioxin Solution |
| BDD-2378 | 50585-41-6 | 2,3,7,8-Tetrabromodibenzo-p-dioxin Solution |
| BDD-12378 | 109333-34-8 | 1,2,3,7,8-Pentabromodibenzo-p-dioxin Solution |
| BDD-12478 | 109333-35-9 | 1,2,4,7,8-Pentabromodibenzo-p-dioxin Solution |
| BDD-1234678 | 110999-47-8 | 1,2,3,4,6,7,8-Heptabromodibenzo-p-dioxin Solution |
| BDD-12346789 | 2170-45-8 | Octabromodibenzo-p-dioxin Solution |
| MBDD-2378 | N/A | 2,3,7,8-Tetrabromo(13C12)dibenzo-p-dioxin Solution |
| BDF-4 | 89827-45-2 | 4-Bromodibenzofuran Solution |
| BDF-24 | 133953-36-3 | 2,4-Dibromodibenzofuran Solution |
| BDF-28 | 10016-52-1 | 2,8-Dibromodibenzofuran Solution |
| BDF-138 | 142408-19-3 | 1,3,8-Tribromodibenzofuran Solution |
| BDF-234 | N/A | 2,3,4-Tribromodibenzofuran Solution |
| BDF-238 | 84761-82-0 | 2,3,8-Tribromodibenzofuran Solution |
| BDF-247 | 617707-53-6 | 2,4,7-Tribromodibenzofuran Solution |
| BDF-1278 | 84761-80-8 | 1,2,7,8-Tetrabromodibenzofuran Solution |
| BDF-2378 | 67733-57-7 | 2,3,7,8-Tetrabromodibenzofuran Solution |
| BDF-12378 | 107555-93-1 | 1,2,3,7,8-Pentabromodibenzofuran Solution |
| BDF-23478 | 131166-92-2 | 2,3,4,7,8-Pentabromodibenzofuran Solution |
| BDF-1234678 | 107555-95-3 | 1,2,3,4,6,7,8-Heptabromodibenzofuran Solution |
| BDF-12346789 | 103582-29-2 | Octabromodibenzofuran Solution |
| 7-B-23-CDD | 97741-74-7 | 7-Bromo-2,3-dichlorodibenzo-p-dioxin Solution (>97%) |
| 2-B-378-CDD | 109333-33-7 | 2-Bromo-3,7,8-trichlorodibenzo-p-dioxin Solution (>95%) |
| 2-B-1378-CDD | 131167-13-0 | 2-Bromo-1,3,7,8-tetrachlorodibenzo-p-dioxin Solution (>95%) |
| 23-B-78-CDD | 50585-40-5 | 2,3-Dibromo-7,8-dichlorodibenzo-p-dioxin Solution |
| M23-B-78-CDD | N/A | 2,3-Dibromo-7,8-dichloro(13C12)dibenzo-p-dioxin Solution |
| 8-B-23-CDF | 103124-75-0 | 8-Bromo-2,3-dichlorodibenzofuran Solution |
| 3-B-278-CDF | 131166-87-5 | 3-Bromo-2,7,8-trichlorodibenzofuran Solution |
| 8-B-234-CDF | 103124-72-7 | 8-Bromo-2,3,4-trichlorodibenzofuran Solution |
| 4-B-2378-CDF | 115656-08-1 | 4-Bromo-2,3,7,8-tetrachlorodibenzofuran Solution |
| 12-B-78-CDF | N/A | 1,2-Dibromo-7,8-dichlorodibenzofuran Solution |
| 23-B-78-CDF | N/A | 2,3-Dibromo-7,8-dichlorodibenzofuran Solution |
| 13-B-278-CDF | N/A | 1,3-Dibromo-2,7,8-trichlorodibenzofuran Solution |
| M8-B-23-CDF | N/A | 8-Bromo-2,3-dichloro(13C12)dibenzofuran Solution |
| M3-B-278-CDF | N/A | 3-Bromo-2,7,8-trichloro(13C12)dibenzofuran Solution |
| M4-B-2378-CDF | N/A | 4-Bromo-2,3,7,8-tetrachloro(13C12)dibenzofuran Solution |
| M23-B-78-CDF | N/A | 2,3-Dibromo-7,8-dichloro(13C12)dibenzofuran Solution |
| M13-B-278-CDF | N/A | 1,3-Dibromo-2,7,8-trichloro(13C12)dibenzofuran Solution |
| PFC-CVS-C | M/C | Perfluoroalkylcarboxylic Acid (PFCA)/Perfluoroalkanesulfonate (PFSA) Calibration Kit (with 4 mole eq. NaOH) |
| MPFAC-C-ES | M/C | Mass-Labelled PFAS Extraction Standard Solution (with 4 mole eq. NaOH) |
| MPFAC-C-IS | M/C | Mass-Labelled PFAS Injection Standard Solution (with 4 mole eq. NaOH) |
| PFAC-MXC | M/C | Native PFAS Stock Solution (with 4 mole eq. NaOH) |
| L-PFPrS | 359868-82-9 | Sodium perfluoro-1-propanesulfonate Solution |
| L-PFBS | 29420-49-3 | Potassium perfluoro-1-butanesulfonate Solution |
| L-PFPeS | N/A | Sodium perfluoro-1-pentanesulfonate Solution |
| L-PFHxS | 82382-12-5 | Sodium perfluoro-1-hexanesulfonate Solution |
| br-PFHxSK | M/C | Potassium perfluorohexanesulfonate Solution/Mixture of Linear and Branched Isomers |
| L-PFHpS | 21934-50-9 | Sodium perfluoro-1-heptanesulfonate Solution |
| NaP3MHpS | 1202827-34-6 | Sodium perfluoro-3-methylheptanesulfonate Solution |
| NaP6MHpS | 1202827-38-0 | Sodium perfluoro-6-methylheptanesulfonate Solution |
| L-PFOS | 4021-47-0 | Sodium perfluoro-1-octanesulfonate Solution |
| L-PFOSK | 2795-39-3 | Potassium perfluoro-1-octanesulfonate Solution |
| br-PFOSK | M/C | Potassium perfluorooctanesulfonate Solution/Mixture of Linear and Branched Isomers |
| T-PFOS | N/A | Potassium perfluorooctanesulfonate (Technical Grade) Solution |
| 8Cl-PFOS | 2481740-05-8 | Sodium 8-chloroperfluoro-1-octanesulfonate Solution |
| L-PFNS | 98789-57-2 | Sodium perfluoro-1-nonanesulfonate Solution |
| ipPFNS | 1383788-15-5 | Sodium perfluoro-7-methyloctanesulfonate Solution |
| L-PFDS | 2806-15-7 | Sodium perfluoro-1-decanesulfonate Solution |
| L-PFDoS | 1260224-54-1 | Sodium perfluoro-1-dodecanesulfonate Solution |
| M3PFBS | 2708218-84-0 | Sodium perfluoro-1-(2,3,4-13C3)butanesulfonate Solution |
| MPFHxS | N/A | Sodium perfluoro-1-hexane(18O2)sulfonate Solution |
| M3PFHxS | 2708218-86-2 | Sodium perfluoro-1-(1,2,3-13C3)hexanesulfonate Solution |
| MPFOS | 960315-53-1 | Sodium perfluoro-1-(1,2,3,4-13C4)octanesulfonate Solution |
| M8PFOS | 2522762-16-7 | Sodium perfluoro-(13C8)octanesulfonate Solution |
| PFBA | 375-22-4 | Perfluoro-n-butanoic acid Solution (with 4 mole eq. NaOH) |
| PFPeA | 2706-90-3 | Perfluoro-n-pentanoic acid Solution (with 4 mole eq. NaOH) |
| PFHxA | 307-24-4 | Perfluoro-n-hexanoic acid Solution (with 4 mole eq. NaOH) |
| PFHpA | 375-85-9 | Perfluoro-n-heptanoic acid Solution (with 4 mole eq. NaOH) |
| PFOA | 335-67-1 | Perfluoro-n-octanoic acid Solution (with 4 mole eq. NaOH) |
| T-PFOA | 3825-26-1 | Ammonium perfluorooctanoate (Technical Grade) Solution (with 4 mole eq. NaOH) |
| P3MHpA | 705240-04-6 | Perfluoro-3-methylheptanoic acid Solution (with 4 mole eq. NaOH) |
| PFNA | 375-95-1 | Perfluoro-n-nonanoic acid Solution (with 4 mole eq. NaOH) |
| P4MOA | N/A | Perfluoro-4-methyloctanoic acid Solution (with 4 mole eq. NaOH) |
| ipPFNA | 15899-31-7 | Perfluoro-7-methyloctanoic acid Solution (with 4 mole eq. NaOH) |
| P355TMHxA | 238403-51-5 | Perfluoro-3,5,5-trimethylhexanoic acid Solution (with 4 mole eq. NaOH) |
| PFDA | 335-76-2 | Perfluoro-n-decanoic acid Solution (with 4 mole eq. NaOH) |
| P37DMOA | 172155-07-6 | Perfluoro-3,7-dimethyloctanoic acid Solution (with 4 mole eq. NaOH) |
| PFUdA | 2058-94-8 | Perfluoro-n-undecanoic acid Solution (with 4 mole eq. NaOH) |
| PFDoA | 307-55-1 | Perfluoro-n-dodecanoic acid Solution (with 4 mole eq. NaOH) |
| PFTrDA | 72629-94-8 | Perfluoro-n-tridecanoic acid Solution (with 4 mole eq. NaOH) |
| PFTeDA | 376-06-7 | Perfluoro-n-tetradecanoic acid Solution (with 4 mole eq. NaOH) |
| PFHxDA | 67905-19-5 | Perfluoro-n-hexadecanoic acid Solution (with 4 mole eq. NaOH) |
| PFODA | 16517-11-6 | Perfluoro-n-octadecanoic acid Solution (with 4 mole eq. NaOH) |
| M3PFBA | 2483735-33-5 | Perfluoro-n-(2,3,4-13C3)butanoic acid Solution (with 4 mole eq. NaOH) |
| MPFBA | 1017281-29-6 | Perfluoro-n-(1,2,3,4-13C4)butanoic acid Solution (with 4 mole eq. NaOH) |
| M3PFPeA | N/A | Perfluoro-n-(3,4,5-13C3)pentanoic acid Solution (with 4 mole eq. NaOH) |
| M5PFPeA | 2283397-79-3 | Perfluoro-n-(1,2,3,4,5-13C5)pentanoic acid Solution (with 4 mole eq. NaOH) |
| MPFHxA | 960315-47-3 | Perfluoro-n-(1,2-13C2)hexanoic acid Solution (with 4 mole eq. NaOH) |
| M5PFHxA | 2328024-54-8 | Perfluoro-n-(1,2,3,4,6-13C5)hexanoic acid Solution (with 4 mole eq. NaOH) |
| M4PFHpA | 2328024-55-9 | Perfluoro-n-(1,2,3,4-13C4)heptanoic acid Solution (with 4 mole eq. NaOH) |
| M2PFOA | 864071-08-9 | Perfluoro-n-(1,2-13C2)octanoic acid Solution (with 4 mole eq. NaOH) |
| MPFOA | N/A | Perfluoro-n-(1,2,3,4-13C4)octanoic acid Solution (with 4 mole eq. NaOH) |
| M8PFOA | 1350614-84-4 | Perfluoro-n-(13C8)octanoic acid Solution (with 4 mole eq. NaOH) |
| MPFNA | 960315-49-5 | Perfluoro-n-(1,2,3,4,5-13C5)nonanoic acid Solution (with 4 mole eq. NaOH) |
| M9PFNA | 2283397-80-6 | Perfluoro-n-(13C9)nonanoic acid Solution (with 4 mole eq. NaOH) |
| MPFDA | 960315-50-8 | Perfluoro-n-(1,2-13C2)decanoic acid Solution (with 4 mole eq. NaOH) |
| M6PFDA | 2328024-56-0 | Perfluoro-n-(1,2,3,4,5,6-13C6)decanoic acid Solution (with 4 mole eq. NaOH) |
| MPFUdA | 960315-51-9 | Perfluoro-n-(1,2-13C2)undecanoic acid Solution (with 4 mole eq. NaOH) |
| M7PFUdA | N/A | Perfluoro-n-(1,2,3,4,5,6,7-13C7)undecanoic acid Solution (with 4 mole eq. NaOH) |
| MPFDoA | 960315-52-0 | Perfluoro-n-[1,2-13C2]dodecanoic acid Solution (with 4 mole eq. NaOH) |
| M2PFTeDA | 2708218-82-8 | Perfluoro-n-[1,2-13C2]tetradecanoic acid Solution (with 4 mole eq. NaOH) |
| M2PFHxDA | N/A | Perfluoro-n-[1,2-13C2]hexadecanoic acid Solution (with 4 mole eq. NaOH) |
| PFC-MXA | M/C | Native PFCA Solution/Mixture (with 4 mole eq. NaOH) |
| PFS-MXA | M/C | Native Perfluoroalkanesulfonate Solution/Mixture |
| PFAC-MXA | M/C | Native PFAS Solution/Mixture (with 4 mole eq. NaOH) |
| PFAC-MXB | M/C | Native PFAS Solution/Mixture (with 4 mole eq. NaOH) |
| PFAC-24PAR | M/C | Native PFAS Precision and Recovery Standard Solution (with 4 mole eq. NaOH, containing brPFHxS & brPFOS) |
| MPFAC-MXA | M/C | Mass-Labelled PFAS Solution/Mixture (with 4 mole eq. NaOH) |
| EPA-537SS-R1 | M/C | U.S. EPA Method 537 PFAS Surrogate Primary Dilution Standard Solution/Mixture (SUR PDS with 4 mole eq. NaOH) |
| EPA-537IS | M/C | U.S. EPA Method 537 PFAS Internal Standard Primary Dilution Standard Solution/Mixture (IS PDS with 4 mole eq. NaOH) |
| MPFAC-24ES | M/C | Mass-Labelled PFAS Extraction Standard Solution (with 4 mole eq. NaOH) |
| P3MHpS | M/C | Perfluoro-3-methylheptane sulfonate/Perfluoro-3-methylheptanoic acid Solution (with 4 mole eq. NaOH) |
| P4MHpS | M/C | Perfluoro-4-methylheptane sulfonate/Perfluoro-4-methylheptanoic acid Solution (with 4 mole eq. NaOH) |
| P5MHpS | M/C | Perfluoro-5-methylheptane sulfonate/Perfluoro-5-methylheptanoic acid Solution (with 4 mole eq. NaOH) |
| P6MHpS | M/C | Perfluoro-6-methylheptane sulfonate/Perfluoro-6-methylheptanoic acid Solution (with 4 mole eq. NaOH) |
| P55DMHxS | M/C | Perfluoro-5,5-dimethylhexane sulfonate/Perfluoro-5,5-dimethylhexanoic acid Solution (with 4 mole eq. NaOH) |
| P45DMHxS | M/C | Perfluoro-4,5-dimethylhexane sulfonate/Perfluoro-4,5-dimethylhexanoic acid/Perfluoro-3,5-dimethylhexane sulfonate/Perfluoro-3,5-dimethylhexanoic acid Solution (with 4 mole eq. NaOH) |
| FOSA-I | 754-91-6 | Perfluoro-1-octanesulfonamide Solution |
| N-MeFOSA-M | 31506-32-8 | N-Methylperfluoro-1-octansulfonamide Solution |
| N,N-Me2FOSA-M | 213181-78-3 | N,N-Dimethylperfluoro-1-octanesulfonamide Solution |
| N-EtFOSA-M | 4151-50-2 | N-Ethylperfluoro-1-octanesulfonamide Solution |
| M8FOSA-I | N/A | Perfluoro-1-(13C8)octanesulfonamide Solution |
| d-N-MeFOSA-M | 936109-37-4 | N-Methyl-d3-perfluoro-1-octanesulfonamide Solution |
| d-N-EtFOSA-M | 936109-40-9 | N-Ethyl-d5-perfluoro-1-octanesulfonamide Solution |
| N-MeFOSE-M | 24448-09-7 | 2-(N-Methylperfluoro-1-octanesulfonamido)-ethanol Solution |
| N-EtFOSE-M | 1691-99-2 | 2-(N-Ethylperfluoro-1-octanesulfonamido)-ethanol Solution |
| d7-N-MeFOSE-M | 1265205-95-5 | 2-(N-Methyl-d3-perfluoro-1-octanesulfonamido)ethan-d4-ol Solution |
| d9-N-EtFOSE-M | 1265205-96-6 | 2-(N-Ethyl-d5-perfluoro-1-octanesulfonamido)ethan-d4-ol Solution |
| FOSAA | 2806-24-8 | Perfluoro-1-octanesulfonamidoacetic acid Solution (with 4 mole eq. NaOH) |
| N-MeFOSAA | 2355-31-9 | N-Methylperfluoro-1-octanesulfonamidoacetic acid Solution (with 4 mole eq. NaOH) |
| N-EtFOSAA | 2991-50-6 | N-Ethylperfluoro-1-octanesulfonamidoacetic acid Solution (with 4 mole eq. NaOH) |
| d3-N-MeFOSAA | N/A | N-Methyl-d3-perfluoro-1-octanesulfonamidoacetic acid Solution (with 4 mole eq. NaOH) |
| d5-N-EtFOSAA | 1265205-97-7 | N-Ethyl-d5-perfluoro-1-octanesulfonamidoacetic acid Solution (with 4 mole eq. NaOH) |
| FBET | 2043-47-2 | 2-Perfluorobutyl ethanol (4:2 FTOH) Solution |
| 5:2sFTOH | 914637-05-1 | 1-Perfluoropentyl ethanol (5:2 secondary FTOH) Solution |
| FHET | 647-42-7 | 2-Perfluorohexyl ethanol (6:2 FTOH) Solution |
| 7:2sFTOH | 24015-83-6 | 1-Perfluoroheptyl ethanol (7:2 secondary FTOH) Solution |
| FOET | 678-39-7 | 2-Perfluorooctyl ethanol (8:2 FTOH) Solution |
| FDET | 865-86-1 | 2-Perfluorodecyl ethanol (10:2 FTOH) Solution |
| MFBET | N/A | 2-Perfluorobutyl (1,1,2,2-2H4)ethanol (2H4-4:2 FTOH) Solution (>97%) |
| MFHET | 872398-72-6 | 2-Perfluorohexyl (1,1-2H2,1,2-13C2)ethanol (2H2,13C2-6:2 FTOH) Solution |
| M2FHET | N/A | 2-Perfluorohexyl (1,2-13C2)ethanol (13C2-6:2 FTOH) Solution (>96%) |
| MFOET | 872398-73-7 | 2-Perfluorooctyl (1,1-2H2, 1,2-13C2)ethanol (2H2,13C2-8:2 FTOH) Solution |
| M2FOET | N/A | 2-Perfluorooctyl (13C2)ethanol (13C2-8:2 FTOH) Solution |
| MFDET | 872398-74-8 | 2-Perfluorodecyl (1,1-2H2, 1,2-13C2)ethanol (2H2,13C2-10:2 FTOH) Solution |
| FHEA | 53826-12-3 | 2-Perfluorohexyl ethanoic acid (6:2 FTCA) Solution (with 1.2 mole eq. HCI) |
| FOEA | 27854-31-5 | 2-Perfluorooctyl ethanoic acid (8:2 FTCA) Solution (with 1.2 mole eq. HCI) |
| FDEA | 53826-13-4 | 2-Perfluorodecyl ethanoic acid (10:2 FTCA) Solution (with 1.2 mole eq. HCI) |
| FPrPA | 356-02-5 | 3-Perfluoropropyl propanoic acid (3:3 FTCA) Solution |
| FPePA | 914637-49-3 | 3-Perfluoropentyl propanoic acid (5:3 FTCA) Solution |
| FHpPA | 812-70-4 | 3-Perfluoroheptyl propanoic acid (7:3 FTCA) Solution |
| FTA-MXA | M/C | Native FTCA Solution/Mixture (with 1.2 mole eq. HCl) |
| MFHEA | 872398-75-9 | 2-Perfluorohexyl (13C2)ethanoic acid (13C2-6:2 FTCA) Solution (with 1.2 mole eq. HCI) |
| MFOEA | 872398-76-0 | 2-Perfluorooctyl (13C2)ethanoic acid (13C2-8:2 FTCA) Solution (with 1.2 mole eq. HCI) |
| MFDEA | 872398-77-1 | 2-Perfluorodecyl (13C2)ethanoic acid (13C2-10:2 FTCA) Solution (with 1.2 mole eq. HCI) |
| MFTA-MXA | M/C | Mass-Labelled FTCA Solution/Mixture (with 1.2 mole eq. HCl) |
| FHUEA | 70887-88-6 | (2Z)-2H-Perfluoro-2-octenoic acid (6:2 FTUCA) Solution |
| FOUEA | 70887-84-2 | (2Z)-2H-Perfluoro-2-decenoic acid (8:2 FTUCA) Solution |
| FDUEA | 70887-94-4 | (2Z)-2H-Perfluoro-2-dodecenoic acid (10:2 FTUCA) Solution |
| MFHUEA | 872398-78-2 | (2Z)-2H-Perfluoro-2-(1,2-13C2)octenoic acid (13C2-6:2 FTUCA) Solution |
| MFOUEA | 872398-79-3 | (2Z)-2H-Perfluoro-2-(1,2-13C2)decenoic acid (13C2-8:2 FTUCA) Solution |
| MFDUEA | 872398-80-6 | (2Z)-2H-Perfluoro-2-(1,2-13C2)dodecenoic acid (13C2-10:2 FTUCA) Solution |
| 9Cl-PF3ONS | 73606-19-6 (F-53B) |
Potassium 9-chlorohexadecafluoro-3-oxanonane-1-sulfonate Solution (major component of F-53B) |
| 11Cl-PF3OUdS | 83329-89-9 | Potassium 11-chloroeicosafluoro-3-oxaundecane-1-sulfonate Solution (minor component of F-53B) |
| NaDONA | 2250081-67-3 | Sodium rac-dodecafluoro-3H-4,8-dioxanonanoate Solution (with 4 mole eq. NaOH, ADONA CAS 958445-44-8 ) |
| HFPO-DA | 13252-13-6 | Hexafluoropropylene oxide dimer acid Solution (GenX) |
| M3HFPO-DA | 3030247-97-0 | 13C3-Hexafluoropropylene oxide dimer acid Solution (13C3-GenX) |
| 4:2FTS | 27619-93-8 | Sodium 1H,1H,2H,2H-perfluorohexane sulfonate (4:2 FTS) Solution |
| 6:2FTS | 27619-94-9 | Sodium 1H,1H,2H,2H-perfluorooctane sulfonate (6:2 FTS) Solution |
| 8:2FTS | 27619-96-1 | Sodium 1H,1H,2H,2H-perfluorodecane sulfonate (8:2 FTS) Solution |
| 10:2FTS | 108026-35-3 | Sodium 1H,1H,2H,2H-perfluorododecane sulfonate (10:2 FTS) Solution |
| M2-4:2FTS | 2708218-88-4 | Sodium 1H,1H,2H,2H-perfluoro(1,2-13C2)hexanesulfonate (13C2-4:2 FTS) Solution |
| M2-6:2FTS | 2708218-89-5 | Sodium 1H,1H,2H,2H-perfluoro-1-(1,2-13C2)-octane sulfonate (13C2-6:2 FTS) Solution |
| M2-8:2FTS | 2708218-90-8 | Sodium 1H,1H,2H,2H-perfluoro-1-(1,2-13C2)-decane sulfonate (13C2-8:2 FTS) Solution |
| 8:2FTOAc | 37858-04-1 | 1H,1H,2H,2H-Perfluorodecyl acetate Solution |
| 10:2FTOAc | 37858-05-2 | 1H,1H,2H,2H-Perfluorododecyl acetate Solution |
| 8:2FTAcr | 27905-45-9 | 1H,1H,2H,2H-Perfluorodecyl acrylate Solution |
| 10:2FTAcr | 17741-60-5 | 1H,1H,2H,2H-Perfluorododecyl acrylate Solution (>95%) |
| PFHxPA | 40143-76-8 | Perfluorohexylphosphonic acid Solution |
| PFOPA | 40143-78-0 | Perfluorooctylphosphonic acid Solution |
| PFDPA | 52299-26-0 | Perfluorodecylphosphonic acid Solution |
| Cl-PFHxPA | N/A | 6-Chloroperfluorohexylphosphonic acid Solution |
| Cl-PFOPA | N/A | 8-Chloroperfluorooctylphosphonic acid Solution |
| 6:6PFPi | 70609-44-8 | Sodium bis(perfluorohexyl)phosphinate Solution |
| 6:8PFPi | 2361298-14-6 | Sodium perfluorohexyl(perfluorooctyl)phosphinate Solution |
| 8:8PFPi | 500776-69-2 | Sodium bis(perfluorooctyl)phosphinate Solution |
| 6:2PAP | 150033-29-7 | Disodium 1H,1H,2H,2H-perfluorooctyl phosphate Solution |
| 8:2PAP | 438237-75-3 | Disodium 1H,1H,2H,2H-perfluorodecyl phosphate Solution |
| 6:2diPAP | 407582-79-0 | Sodium bis(1H,1H,2H,2H-perfluorooctyl) phosphate Solution |
| 8:2diPAP | 114519-85-6 | Sodium bis(1H,1H,2H,2H-perfluorodecyl) phosphate Solution |
| 6:2/8:2diPAP | N/A | Sodium (1H,1H,2H,2H-perfluorooctyl-1H,1H.2H,2H-perfluorodecyl) phosphate Solution |
| SAmPAP | 2624-80-8 | Disodium 2-(N-ethylperfluorooctane-1-sulfonamido)ethyl phosphate Solution |
| diSAmPAP | 23282-60-2 | Sodium bis-[2-(N-ethylperfluorooctane-1-sulfonamido)ethyl] phosphate Solution |
| M2-6:2PAP | N/A | Disodium 1H,1H,2H,2H-(1,2-13C2)perfluorooctyl phosphate Solution |
| M2-8:2PAP | N/A | Disodium 1H,1H,2H,2H-(1,2-13C2)perfluorodecyl phosphate Solution |
| M4-6:2diPAP | N/A | Sodium bis[1H,1H,2H,2H-perfluoro(1,2-13C2)octyl] phosphate Solution |
| M4-8:2diPAP | N/A | Sodium bis[1H,1H,2H,2H-perfluoro(1,2-13C2)decyl] phosphate Solution |
| PAH-CVS-B | M/C | Polycyclic Aromatic Hydrocarbon (PAH) Calibration Kit |
| PAH-LCS-B | M/C | PAH Labelled Compound Solution |
| PAH-ISS-B | M/C | PAH Internal Standard Spiking Solution |
| PAH-SS-B | M/C | PAH Sampling Standard Solution |
| PAH-STK-B | M/C | PAH Native Stock Solution |
| L429-CVS | M/C | California EPA Air Resources Board Method 429 PAH Calibration Kit |
| L429-SS | M/C | California EPA Air Resources Board Method 429 PAH Surrogate Standard Stock Solution |
| L429-IS | M/C | California EPA Air Resources Board Method 429 PAH Internal Standard Stock Solution |
| L429-AS | M/C | California EPA Air Resources Board Method 429 PAH Alternate Standard Stock Solution |
| L429-RS | M/C | California EPA Air Resources Board Method 429 PAH Recovery Standard Stock Solution |
| L429-PAR | M/C | California EPA Air Resources Board Method 429 Native PAH Stock Solution |
| EPA-PAH-STK | M/C | Native PAH Solution/Mixture |
| EPA-PAH-LCS | M/C | Deuterated PAH Solution/Mixture |
| EPA-EU-PAH-ISS | M/C | Deuterated PAH Solution/Mixture |
| EU-PAH-STK | M/C | Native PAH Solution/Mixture |
| EU-PAH-LCS | M/C | Deuterated PAH Solution/Mixture |
| 4H107 | 152969-11-4 | 2,3,3′,4′,5-Pentachloro-4-biphenylol Solution |
| 3H118 | 170946-11-9 | 2,3′,4,4′,5-Pentachloro-3-biphenylol Solution |
| 4H130 | 158076-62-1 | 2,2′,3,3′,4′,5-Hexachloro-4-biphenylol Solution |
| 3H138 | N/A | 2,2′,3′,4,4′,5-Hexachloro-3-biphenylol Solution |
| 4H146 | 145413-90-7 | 2,2′,3,4′,5,5′-Hexachloro-4-biphenylol Solution |
| 3H153 | 54284-55-8 | 2,2′,4,4′,5,5′-Hexachloro-3-biphenylol Solution |
| 4H172 | 158076-64-3 | 2,2′,3,3′,4′,5,5′-Heptachloro-4-biphenylol Solution |
| 3H180 | 158076-69-8 | 2,2′,3′,4,4′,5,5′-Heptachloro-3-biphenylol Solution |
| 4H187 | 158076-68-7 | 2,2′,3,4′,5,5′,6-Heptachloro-4-biphenylol Solution |
| M4H12 | N/A | 3′,4′-Dichloro-4-(13C12)biphenylol Solution |
| M4H29 | N/A | 2′,4′,5′-Trichloro-4-(13C12)biphenylol Solution |
| M4H61 | N/A | 2′,3′,4′,5′-Tetrachloro-4-(13C12)biphenylol Solution |
| M4H120 | N/A | 2′,3,4′,5,5′-Pentachloro-4-(13C12)biphenylol Solution |
| M4H159 | N/A | 2′,3,3′,4′,5,5′-Hexachloro-4-(13C12)biphenylol Solution |
| M4H172 | N/A | 2,2′,3,3′,4′,5,5′-Heptachloro-4-(13C12)biphenylol Solution |
| M4H187 | N/A | 2,2′,3,4′,5,5′,6-Heptachloro-4-(13C12)biphenylol Solution |
| MHPCB-MXA | M/C | Mass-Labelled Chlorinated Biphenylol Solution/Mixture |
| 4PM79 | N/A | 3,3′,4′,5-Tetrachloro-4-methoxybiphenyl Solution |
| 4PM97 | N/A | 2,2′,3,4′,5′-Pentachloro-4-methoxybiphenyl Solution |
| 4PM101 | N/A | 2,2′,4,5,5′-Pentachloro-4′-methoxybiphenyl Solution |
| 4M107 | N/A | 2,3,3′,4′,5-Pentachloro-4-methoxybiphenyl Solution |
| 4PM108 | N/A | 2,3,3′,4,5′-Pentachloro-4′-methoxybiphenyl Solution |
| 3M118 | N/A | 2,3′,4,4′,5-Pentachloro-3-methoxybiphenyl Solution |
| 4PM120 | N/A | 2,3′,4,5,5′-Pentachloro-4′-methoxybiphenyl Solution |
| 4PM127 | N/A | 3,3′,4,5,5′-Pentachloro-4′-methoxybiphenyl Solution |
| 4PM130 | N/A | 2,2′,3,3′,4′,5-Hexachloro-4-methoxybiphenyl Solution |
| 4M134 | N/A | 2,2′,3,3′,5,6-Hexachloro-4-methoxybiphenyl Solution |
| 3PM138 | N/A | 2,2′,3′,4,4′,5-Hexachloro-3-methoxybiphenyl Solution |
| 4M146 | N/A | 2,2′,3,4′,5,5′-Hexachloro-4-methoxybiphenyl Solution |
| 33PDM155 | N/A | 2,2′,4,4′,6,6′-Hexachloro-3,3′-dimethoxybiphenyl Solution |
| 4PM159 | N/A | 2,3,3′,4,5,5′-Hexachloro-4′-methoxybiphenyl Solution |
| 4M162 | N/A | 2,3,3′,4′,5,5′-Hexachloro-4-methoxybiphenyl Solution |
| 4M163 | N/A | 2,3,3′,4′,5,6-Hexachloro-4-methoxybiphenyl Solution |
| 4PM172 | N/A | 2,2′,3,3′,4,5,5′-Heptachloro-4′-methoxybiphenyl Solution |
| 4M177 | N/A | 2,2′,3,3′,4′,5,6-Heptachloro-4-methoxybiphenyl Solution |
| 4M178 | N/A | 2,2′,3,3′,5,5′,6-Heptachloro-4-methoxybiphenyl Solution |
| 3PM180 | N/A | 2,2′,3,4,4′,5,5′-Heptachloro-3′-methoxybiphenyl Solution |
| 3PM182 | N/A | 2,2′,3,4,4′,5,6′-Heptachloro-3′-methoxybiphenyl Solution |
| 3PM183 | N/A | 2,2′,3′,4,4′,5,6′-Heptachloro-3-methoxybiphenyl Solution |
| 3PM184 | N/A | 2,2′,3,4,4′,6,6′-Heptachloro-3′-methoxybiphenyl Solution |
| 4M187 | N/A | 2,2′,3,4′,5,5′,6-Heptachloro-4-methoxybiphenyl Solution |
| 4M193 | N/A | 2,3,3′,4′,5,5′,6-Heptachloro-4-methoxybiphenyl Solution |
| 4PM198 | N/A | 2,2′,3,3′,4,5,5′,6-Octachloro-4′-methoxybiphenyl Solution |
| 4PM199 | N/A | 2,2′,3,3′,4′,5,5′,6-Octachloro-4-methoxybiphenyl Solution |
| 4PM200 | N/A | 2,2′,3,3′,4,5,6,6′-Octachloro-4′-methoxybiphenyl Solution |
| 4PM201 | N/A | 2,2′,3,3′,4′,5,6,6′-Octachloro-4-methoxybiphenyl Solution |
| 4M202 | N/A | 2,2′,3,3′,5,5′,6,6′-Octachloro-4-methoxybiphenyl Solution |
| 44PDM202 | N/A | 2,2′,3,3′,5,5′,6,6′-Octachloro-4,4′-dimethoxybiphenyl Solution |
| 3PM203 | N/A | 2,2′,3,4,4′,5,5′,6-Octachloro-3′-methoxybiphenyl Solution |
| 4PM208 | N/A | 2,2′,3,3′,4,5,5′,6,6′-Nonachloro-4′-methoxybiphenyl Solution |
| MPCB-MXA | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXB | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXC | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXD | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXE | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXF | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXG | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXH | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXI | M/C | Native Polychlorinated Methoxybiphenyl Solution/Mixture |
| M4M29 | N/A | 2,4,5-Trichloro-4′-methoxy(13C12)biphenyl Solution |
| M4M61 | N/A | 2,3,4,5-Tetrachloro-4′-methoxy(13C12)biphenyl Solution |
| M4M120 | N/A | 2,3′,4,5,5′-Pentachloro-4′-methoxy(13C12)biphenyl Solution |
| M4M159 | N/A | 2,3,3′,4,5,5′-Hexachloro-4′-methoxy(13C12)biphenyl Solution |
| M4M172 | N/A | 2,2′,3,3′,4,5,5′-Heptachloro-4′-methoxy(13C12)biphenyl Solution |
| M4M187 | N/A | 2,2′,3,4′,5,5′,6-Heptachloro-4-methoxy(13C12)biphenyl Solution |
| MMPCB-MXA | M/C | Mass-Labelled Polychlorinated Methoxybiphenyl Solution/Mixture |
| CBP-2 | 50558-21-9 | 2-Chlorobiphenylene Solution |
| CBP-23 | 909024-10-8 | 2,3-Dichlorobiphenylene Solution |
| CBP-236 | 909024-09-5 | 2,3,6-Trichlorobiphenylene Solution |
| CBP-2367 | 7090-41-7 | 2,3,6,7-Tetrachlorobiphenylene Solution |
| MCBP-2367 | N/A | 2,3,6,7-Tetrachloro(13C12)biphenylene Solution |
| TCC | 101-20-2 | N-(4-chlorophenyl)-N’-(3,4-dichlorophenyl)urea Solution |
| MTCC | N/A | N-(4-chloro(13C6)phenyl)-N’-(3,4-dichloro(13C6)phenyl)(13C)urea Solution |
| TCS | 3380-34-5 | 5-Chloro-2-(2,4-dichlorophenoxy)phenol Solution (Triclosan) |
| TCS-M | 3380-34-5 | 5-Chloro-2-(2,4-dichlorophenoxy)phenol Solution (Triclosan) |
| MeTCS | 4640-01-1 | 5-Chloro-2-(2,4-dichlorophenoxy)anisole Solution (Methyl Triclosan) |
| MTCS | 1365620-36-5 | 5-Chloro-2-[2,4-dichloro(13C6)phenoxy](13C6)phenol Solution (Triclosan-13C12) |
| MTCS-M | 1365620-36-5 | 5-Chloro-2-(2,4-dichloro(13C6)phenoxy)(13C6)phenol Solution (Triclosan-13C12) |
| MMeTCS | N/A | 5-Chloro-2-(2,4-dichloro(13C6)phenoxy)(1,2,3,4,5,6-13C6)anisole Solution (Methyl Triclosan-13C12) |
| 6TCS | 63709-57-9 | 2,3-Dichloro-6-(2,4-dichlorophenoxy)phenol Solution (6-Chlorotriclosan) |
| 6MeTCS | N/A | 2,3-Dichloro-6-(2,4-dichlorophenoxy)anisole Solution (Methyl 6-Chlorotriclosan) |
| 4TCS | 3380-44-7 | 4,5-Dichloro-2-(2,4-dichlorophenoxy)phenol Solution (4-Chlorotriclosan) |
| 4MeTCS | N/A | 4,5-Dichloro-2-(2,4-dichlorophenoxy)anisole Solution (Methyl 4-Chlorotriclosan) |
| 46TCS | 53555-01-4 | 2,3,4-Trichloro-6-(2,4-dichlorophenoxy)phenol Solution (4,6-Dichlorotriclosan) |
| 46MeTCS | N/A | 2,3,4-Trichloro-6-(2,4-dichlorophenoxy)anisole Solution (Methyl 4,6-Dichlorotriclosan) |
| XE-2367-S | 118516-13-5 | 2,3,6,7-Tetrachloroxanthene Solution |
| T4CPM | 27575-78-6 | Tris(4-chlorophenyl)methane Solution |
| T4CPME | 3010-80-8 | Tris(4-chlorophenyl)methanol Solution |
| MT4CPM | N/A | Tris(4-chlorophenyl)methane-13C19 Solution |
| MT4CPME | N/A | Tris(4-chlorophenyl)methanol-13C19 Solution |
| PN-2S | 91-58-7 | 2-Chloronaphthalene Solution |
| PN-6S | 1825-30-5 | 1,5-Dichloronaphthalene Solution |
| PN-12S | 2198-77-8 | 2,7-Dichloronaphthalene Solution |
| PN-13S | 50402-52-3 | 1,2,3-Trichloronaphthalene Solution |
| PN-27S | 20020-02-4 | 1,2,3,4-Tetrachloronaphthalene Solution |
| PN-28S | 53555-63-8 | 1,2,3,5-Tetrachloronaphthalene Solution |
| PN-31S | 149864-81-3 | 1,2,3,8-Tetrachloronaphthalene Solution |
| PN-36S | 67922-22-9 | 1,2,5,6-Tetrachloronaphthalene Solution |
| PN-46S | 3432-57-3 | 1,4,5,8-Tetrachloronaphthalene Solution (>96%) |
| PN-48S | 34588-40-4 | 2,3,6,7-Tetrachloronaphthalene Solution |
| PN-50S | 67922-26-3 | 1,2,3,4,6-Pentachloronaphthalene Solution |
| PN-52S | 53555-65-0 | 1,2,3,5,7-Pentachloronaphthalene Solution |
| PN-53S | 150224-24-1 | 1,2,3,5,8-Pentachloronaphthalene Solution |
| PN-66S | 103426-96-6 | 1,2,3,4,6,7-Hexachloronaphthalene Solution |
| PN-69S | 103426-94-4 | 1,2,3,5,7,8-Hexachloronaphthalene Solution |
| PN-72S | 103426-92-2 | 1,2,4,5,7,8-Hexachloronaphthalene Solution |
| PN-73S | 58863-14-2 | 1,2,3,4,5,6,7-Heptachloronaphthalene Solution |
| PN-75S | 2234-13-1 | Octachloronaphthalene Solution |
| PCN-MXA | M/C | Native PCN Solution/Mixture |
| PCN-MXC | M/C | Native PCN Solution/Mixture |
| DPE-0 | 101-84-8 | Diphenyl ether Solution |
| DPE-3 | 7005-72-3 | 4-Chlorodiphenyl ether Solution |
| DPE-15 | 2444-89-5 | 4,4′-Dichlorodiphenyl ether Solution |
| DPE-28 | 59039-21-3 | 2,4,4′-Trichlorodiphenyl ether Solution |
| DPE-74 | 61328-45-8 | 2,4,4′,5-Tetrachlorodiphenyl ether Solution |
| DPE-77 | 56348-72-2 | 3,3′,4,4′-Tetrachlorodiphenyl ether Solution |
| DPE-99 | 60123-64-0 | 2,2′,4,4′,5-Pentachlorodiphenyl ether Solution |
| DPE-209 | 31710-30-2 | Decachlorodiphenyl ether Solution |
| MCDE-0 | 2483735-44-8 | (13C12)Diphenyl ether Solution |
| MCDE-3 | N/A | 4-Chloro(13C12)diphenyl ether Solution |
| MCDE-12 | N/A | 3,4-Dichloro(13C12)diphenyl ether Solution |
| MCDE-37 | N/A | 3,4,4′-Trichloro(13C12)diphenyl ether Solution |
| MCDE-61 | N/A | 2,3,4,5-Tetrachloro(13C12)diphenyl ether Solution |
| MCDE-86 | 1621005-50-2 | 2,2′,3,4,5-Pentachloro(13C12)diphenyl ether Solution |
| MCDE-141 | N/A | 2,2′,3,4,5,5′-Hexachloro(13C12)diphenyl ether Solution |
| MCDE-180 | N/A | 2,2′,3,4,4′,5,5′-Heptachloro(13C12)diphenyl ether Solution |
| 8-M-237-CDD | N/A | 2,3,7-Trichloro-8-methyldibenzo-p-dioxin Solution |
| 7-M-1234-CDD | N/A | 1,2,3,4-Tetrachloro-7-methyldibenzo-p-dioxin Solution |
| 8-M-23-CDF | N/A | 2,3-Dichloro-8-methyldibenzofuran Solution |
| 6-M-138-CDF | N/A | 1,3,8-Trichloro-6-methyldibenzofuran Solution |
| 78-M-234-CDF | N/A | 2,3,4-Trichloro-7,8-dimethyldibenzofuran Solution |
| 8-M-1247-CDF | N/A | 1,2,4,7-Tetrachloro-8-methyldibenzofuran Solution |
| 6-M-1248-CDF | N/A | 1,2,4,8-Tetrachloro-6-methyldibenzofuran Solution |
| CBS | M/C | Native Polychlorobenzene Solution/Mixture |
| MCBS | M/C | Mass-Labelled Polychlorobenzene Solution/Mixture |
| MBZ-1235 | 208461-25-0 | 1,2,3,5-Tetrachloro(13C6)benzene Solution |
| MBZ-123456 | 93952-14-8 | 13C6-Hexachlorobenzene Solution |
| CPS | M/C | Native Polychlorophenol Solution/Mixture |
| MCPS | M/C | Mass-Labelled Polychlorophenol Solution/Mixture |
| MCP-25 | 2483735-42-6 | 2,5-Dichloro(13C6)phenol Solution |
| MCP-246 | 208461-28-3 | 2,4,6-Trichloro(13C6)phenol Solution |
| MCP-345 | 208461-30-7 | 3,4,5-Trichloro(13C6)phenol Solution |
| MCP-23456 | 85380-74-1 | Pentachloro(13C6)phenol Solution |
| MEL | 108-78-1 | Melamine Solution |
| CYA | 108-80-5 | Cyanuric Acid Solution |
| M3-MEL | 1173022-88-2 | (13C3)Melamine Solution |
| M3-CYA | 201996-37-4 | (13C3)Cyanuric Acid Solution |
| M6-CYA | N/A | (13C3,15N3)Cyanuric Acid Solution |
| BPA | 80-05-7 | Bisphenol A Solution |
| BPAF | 1478-61-1 | Bisphenol AF Solution |
| BPAP | 1571-75-1 | Bisphenol AP Solution |
| BPB | 77-40-7 | Bisphenol B Solution |
| BPF | 620-92-8 | Bisphenol F Solution |
| BPP | 2167-51-3 | Bisphenol P Solution |
| BPS | 80-09-1 | Bisphenol S Solution |
| BPZ | 843-55-0 | Bisphenol Z Solution |
| MBPA | 263261-65-0 | Bisphenol A (13C12-rings) Solution |
| TCDT-83 | 133513-17-4 | 2,3,7,8-Tetrachlorodibenzothiophene Solution |
| TCDT-85 | 134705-49-0 | 2,4,6,8-Tetrachlorodibenzothiophene Solution |
| MTCDT-85 | N/A | 2,4,6,8-Tetrachloro(13C12)dibenzothiophene Solution |
| CCZ-3 | 2732-25-4 | 3-Chloro-9H-carbazole Solution |
| CCZ-36 | 5599-71-3 | 3,6-Dichloro-9H-carbazole Solution |
| CCZ-1368 | 58910-96-6 | 1,3,6,8-Tetrachloro-9H-carbazole Solution |
| CCZ-2367 | 697298-02-5 | 2,3,6,7-Tetrachloro-9H-carbazole Solution |
| CBCZ-MXB | M/C | Native Halogenated Carbazoles Solution/Mixture |
| MCCZ-36 | N/A | 3,6-Dichloro-9H-(13C12)carbazole Solution |
| MCCZ-1368 | N/A | 1,3,6,8-Tetrachloro-9H-(13C12)carbazole Solution |
| MCCZ-MIX-A | M/C | Mass-Labelled Polychlorinated Carbazoles Solution/Mixture |
| BCZ-3 | 1592-95-6 | 3-Bromo-9H-carbazole Solution |
| BCZ-27 | 136630-39-2 | 2,7-Dibromo-9H-carbazole Solution |
| BCZ-36 | 6825-20-3 | 3,6-Dibromo-9H-carbazole Solution |
| BCZ-136 | 55119-10-3 | 1,3,6-Tribromo-9H-carbazole Solution |
| BCZ-1368 | 55119-09-0 | 1,3,6,8-Tetrabromo-9H-carbazole Solution |
| 1-B-36-CCZ | 100125-05-1 | 1-Bromo-3,6-dichloro-9H-carbazole Solution |
| 18-B-36-CCZ | 100131-03-1 | 1,8-Dibromo-3,6-dichloro-9H-carbazole Solution |
| WMS-01 | N/A | Reference Lake Sediment for Organic Contaminant Analysis |
| CARP-2 | N/A | Reference Fish Tissue (homogenate) for Organic Contaminant Analysis |
| TPCB-CVS-A | M/C | Polychlorinated Biphenyl (PCB) Calibration Kit |
| DFP-IS-B10 | M/C | Mass-Labelled PCDD/PCB Syringe Spike Solution |
| DF-LCS-B20 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-IS-J100 | M/C | Mass-Labelled PCDD Syringe Spike Solution |
| DF-IS-J20 | M/C | Mass-Labelled PCDD Syringe Spike Solution |
| DF-SS-A | M/C | Mass-Labelled PCDD Sampling Spike Solution |
| DF-SS-A100 | M/C | Mass-Labelled PCDD Sampling Spike Solution |
| DF-SS-A20 | M/C | Mass-Labelled PCDD Sampling Spike Solution |
| TPCB-LCS-A100 | M/C | Mass-Labelled PCB Extraction Standard Solution/Mixture |
| TPCB-LCS-A20 | M/C | Mass-Labelled PCB Extraction Standard Solution/Mixture |
| TPCB-LCS-B100 | M/C | Mass-Labelled PCB Extraction Standard Solution/Mixture |
| TPCB-LCS-B20 | M/C | Mass-Labelled PCB Extraction Standard Solution/Mixture |
| TPCB-IS-A100 | M/C | Mass-Labelled PCB Recovery/Internal Standard Solution/Mixture |
| TPCB-IS-A20 | M/C | Mass-Labelled PCB Recovery/Internal Standard Solution/Mixture |
| TPCB-SS-A100 | M/C | Mass-Labelled PCB Sampling/Cleanup Standard Solution/Mixture |
| TPCB-SS-A20 | M/C | Mass-Labelled PCB Sampling/Cleanup Standard Solution/Mixture |
| DFP-ST-C10 | M/C | Native PCDD/PCDF/Dioxin-like PCB Solution/Mixture |
| DF-ST-C | M/C | Native PCDD/PCDF Solution/Mixture |
| DF-ST-C10 | M/C | Native PCDD/PCDF Solution/Mixture |
| PCB-ST-C | M/C | Native PCB Solution/Mixture |
| PCB-ST-C20 | M/C | Native Dioxin-like PCB Solution/Mixture |
| PCB-ST-D | M/C | Native PCB Solution/Mixture |
| OIL-CVS-B | M/C | Polychlorinated Biphenyl (PCB) Calibration Kit |
| MBP-MXP | M/C | Mass-Labelled PCB Internal Standard Solution |
| BP-MXP | M/C | Native PCB Solution/Mixture |
| BP-PG-MXA | M/C | Native PCB Solution/Mixture |
| MBP-PG-MXA | M/C | Mass-Labelled PCB Mixture/Solution |
| br-NMeFOSAA | N/A | N-Methylperfluorooctanesulfonamidoacetic acid Solution/Mixture of Linear and Branched Isomers (with 4 mole eq. NaOH) |
| br-NEtFOSAA | N/A | N-Ethylperfluorooctanesulfonamidoacetic acid Solution/Mixture of Linear and Branched Isomers (with 4 mole eq. NaOH) |
| EPA-537PDS-R1 | M/C | U.S. EPA Method 537.1 PFAS Native PFAS Primary Dilution Standard Solution/Mixture (branched/linear mix with 4 mole eq. NaOH) |
| EPA-537PDSL-R1 | M/C | U.S. EPA Method 537.1 PFAS Native PFAS Primary Dilution Standard Solution/Mixture (linear isomers only with 4 mole eq. NaOH) |
| PFECHS | 335-24-0 | Potassium perfluoro-4-ethylcyclohexanesulfonate Solution (isomeric mixture) |
| MDD-27 | N/A | 2,7-Dichloro(13C12)dibenzo-p-dioxin Solution |
| MDD-28 | N/A | 2,8-Dichloro(13C12)dibenzo-p-dioxin Solution |
| (+)aHBCD | 138257-19-9 | (+)-alpha-1S,2S,5R,6S,9S,10R-Hexabromocyclododecane Solution |
| (-)aHBCD | 678970-15-5 | (-)-alpha-1R,2R,5S,6R,9R,10S-Hexabromocyclododecane Solution |
| (+)gHBCD | 678970-17-7 | (+)-gamma-1R,2R,5R,6S,9S,10R-Hexabromocyclododecane Solution |
| (-)gHBCD | 169102-57-2 | (-)-gamma-1S,2S,5S,6R,9R,10S-Hexabromocyclododecane Solution |
| FBSA-I | 30334-69-1 | Perfluoro-1-butanesulfonamide Solution |
| FHxSA-I | 41997-13-1 | Perfluoro-1-hexanesulfonamide Solution |
| N-AP-FHxSA | 50598-28-2 | N-[3-(Dimethylamino)propan-1-yl]perfluoro-1-hexanesulfonamide Solution |
| N-TAmP-FHxSA | 38850-51-0 | N-[3-(Trimethylammonio)propan-1-yl]perfluoro-1-hexanesulfonazanide Solution |
| N-CMAmP-6:2FOSA | 34455-29-3 | 6:2 Fluorotelomer sulfonamide alkylbetaine (6:2 FTAB; Capstone B) Solution |
| Ma-DP | N/A | anti-(13C10)Dechlorane Plus Solution |
| PCN-WD | M/C | PCN Window Defining Solution/Mixture for DB-5 |
| PCN-HWX | M/C | PCN Major Halowax Congeners Solution/Mixture |
| PCN-INC | M/C | PCN Major Incineration Congeners Solution/Mixture |
| PCN-TOX | M/C | PCN Potentially Toxic Congeners Solution/Mixture |
| OCP-MXA | M/C | Native OC Pesticide Solution/Mixture |
| MOCP-MXA | M/C | Mass-Labelled OC Pesticide Solution/Mixture |
| DET-MXA | M/C | Native DDT & Related Compound Solution/Mixture |
| MDET-MXA | M/C | Mass-Labelled DDT & Related Compound Solution/Mixture |
| HCH-MXA | M/C | Native HCH Solution/Mixture |
| MHCH-MXA | M/C | Mass-Labelled HCH Solution/Mixture |
| WMF-02 | N/A | Reference “Freeze-Dried” Fish Tissue (Naturally Fortified Salmon) |
| WMF-03 | N/A | Reference “Freeze-Dried” Fish Tissue (Low Level Salmon) |
| WMF-EX | N/A | Reference Fish Tissue Extract (Isooctane/20% Salmon Oil) |
| PFAC30PAR | M/C | Native PFAS Precision and Recovery Standard Solution (with 4 mole eq. NaOH) |
| PF4OPeA | 377-73-1 | Perfluoro-4-oxapentanoic acid (PFMPA) Solution (with 4 mole eq. NaOH) |
| PF5OHxA | 863090-89-5 | Perfluoro-5-oxahexanoic acid (PFMBA) Solution (with 4 mole eq. NaOH) |
| 3,6-OPFHpA | 151772-58-6 | Perfluoro-3,6-dioxaheptanoic acid (NFDHA) Solution (with 4 mole eq. NaOH) |
| PFEESA | 117205-07-9 | Potassium perfluoro(2-ethoxyethane)sulfonate Solution |
| FDSA-I | 4262-70-8 | Perfluoro-1-decanesulfonamide Solution |
| N-MeFBSA-M | 68298-12-4 | N-Methylperfluoro-1-butanesulfonamide Solution |
| axCl11DP | 1826842-25-4 | exo–anti-Cl11-Dechlorane Plus Solution |
| axxCl10DP | 2305587-45-3 | exo–exo–anti-Cl10-Dechlorane Plus Solution |
| 3tBPDPP | N/A | 3-tert-Butylphenyl diphenyl phosphate Solution |
| T3tBPP | N/A | Tris(3-tert-butylphenyl) phosphate Solution |
| B3tBPPP | N/A | Bis(3-tert-butylphenyl) phenyl phosphate Solution |
| T24DtBPP | 95906-11-9 | Tris(2,4-di-tert-butylphenyl) phosphate Solution |
| 3IPPDPP | 69515-46-4 | 3-Isopropylphenyl diphenyl phosphate Solution |
| B3IPPPP | 69500-30-7 | Bis(3-isopropylphenyl) phenyl phosphate Solution |
| 5:3FTB | 171184-14-8 | 2-[(4,4,5,5,6,6,7,7,8,8,8-Undecafluorooctyl)dimethylammonio]acetate Solution |
| 5:1:2FTB | 171184-02-4 | 2-[(3,4,4,5,5,6,6,7,7,8,8,8-Dodecafluorooctyl)dimethylammonio]acetate Solution |
| EPA-533PAR | M/C | U.S. EPA Method 533 Native PFAS Analyte Primary Dilution Standard Solution/Mixture (br/linear mix with 4 mole eq. NaOH) |
| EPA-533ES | M/C | U.S. EPA Method 533 PFAS Mass-Labelled Isotope Dilution Standard Solution/Mixture (PDS with 4 mole eq. NaOH) |
| EPA-533IS | M/C | U.S. EPA Method 533 Mass-Labelled PFAS Isotope Performance Standard Solution/Mixture (PDS with 4 mole eq. NaOH) |
| PFAC-MXF | M/C | Native Replacement PFAS Solution/Mixture (with 4 mole eq. NaOH, compatible with EPA Draft Method 1633) |
| PFAC-MXG | M/C | Native Perfluoroether Carboxylic Acid and Sulfonate Solution/Mixture (with 4 mole eq. NaOH, compatible with EPA Draft Method 1633) |
| L-PFUdS | 3016286-99-7 | Sodium perfluoro-1-undecanesulfonate Solution |
| L-PFTrDS | 174675-49-1 | Sodium perfluoro-1-tridecanesulfonate Solution |
| EU-5813-NSS | M/C | EU 5813/20 Native PFAS Solution/Mixture (with 4 mole eq. NaOH) |
| ISO 21675-NSS | M/C | ISO 21675:2019 PFAS Native Stock Solution (with 4 mole eq. NaOH) |
| ISO 21675-LSS | M/C | ISO 21675:2019 PFAS Labelled Stock Solution (with 4 mole eq. NaOH) |
| MPFAC-HIF-ES | M/C | U.S. EPA Method 1633 Mass-Labelled PFAS Extraction Standard Solution/Mixture (with 4 mole eq. NaOH) |
| MPFAC-HIF-IS | M/C | U.S. EPA Method 1633 Mass-Labelled PFAS Injection Standard Solution/Mixture (with 4 mole eq. NaOH) |
| PFAC-MXH | M/C | Native PFAS Solution/Mixture (with 4 mole eq. NaOH) |
| PFAC-MXI | M/C | Native N-Substituted FOSA/FOSE Solution/Mixture |
| PFAC-MXJ | M/C | Native X:3 Fluorotelomer Carboxylic Acid Solution/Mixture |
| 16130CVS | M/C | Alternative Method 16130 PCDD/PCDF Calibration Kit |
| 16130CSL | M/C | Alternative Method 16130 PCDD/PCDF Extended Calibration/Low Level Solution (CSL) |
| 16130CS05 | M/C | Alternative Method 16130 PCDD/PCDF Extended Calibration/Low Level Solution (CS0.5) |
| MD5CWDS | M/C | Mass-Labelled PCDD Window Defining Mixture for DB-5/BP5/HP-2/Rtx-5/SPB-5 |
| MF5CWDS | M/C | Mass-Labelled PCDF Window Defining Mixture for DB-5/BP5/HP-2/Rtx-5/SPB-5 |
| DF-14678-S | 83704-35-2 | 1,4,6,7,8-Pentachlorodibenzofuran (or 2,3,4,6,9) Solution |
| MDD-1289 | N/A | 1,2,8,9-Tetrachloro(13C12)dibenzo-p-dioxin Solution |
| MDD-124679 | N/A | 1,2,4,6,7,9-Hexachloro(13C12)dibenzo-p-dioxin Solution |
| MDF-12389 | N/A | 1,2,3,8,9-Pentachloro(13C12)dibenzofuran Solution |
| MDF-123489 | N/A | 1,2,3,4,8,9-Hexachloro(13C12)dibenzofuran Solution |
| FHpSA-I | 82765-77-3 | Perfluoro-1-heptanesulfonamide Solution |
| N-MeFBSE-M | 34454-97-2 | 2-(N-methylperfluoro-1-butanesulfonamido)ethanol Solution |
| PeCB | 608-93-5 | Pentachlorobenzene Solution |
| HxCB | 118-74-1 | Hexachlorobenzene Solution |
| aHCH | 319-84-6 | alpha-1,2,3,4,5,6-Hexachlorocyclohexane Solution |
| bHCH | 319-85-7 | beta-1,2,3,4,5,6-Hexachlorocyclohexane Solution |
| gHCH | 58-89-9 | gamma-1,2,3,4,5,6-Hexachlorocyclohexane Solution |
| dHCH | 319-86-8 | delta-1,2,3,4,5,6-Hexachlorocyclohexane Solution |
| 24P-DMDT | 30667-99-3 | o,p’-Methoxychlor Solution |
| 44P-DMDT | 72-43-5 | p,p’-Methoxychlor Solution |
| 24P-DDD | 53-19-0 | 1,1-Dichloro-2-(2-chlorophenyl)-2-(4-chlorophenyl)ethane Solution |
| 44P-DDD | 72-54-8 | 1,1-Dichloro-2,2-bis(4-chlorophenyl)ethane Solution |
| 24P-DDE | 3424-82-6 | 1,1-Dichloro-2-(2-chlorophenyl)-2-(4-chlorophenyl)ethene Solution |
| 44P-DDE | 72-55-9 | 1,1-Dichloro-2,2-bis(4-chlorophenyl)ethene Solution |
| 24P-DDT | 789-02-6 | 1,1,1-Trichloro-2-(2-chlorophenyl)-2-(4-chlorophenyl)ethane Solution |
| 44P-DDT | 50-29-3 | 1,1,1-Trichloro-2,2-bis(4-chlorophenyl)ethane Solution |
| HxChlor | 3734-48-3 | Chlordene Solution |
| 1H-HxChlor | 2597-11-7 | 1-Hydroxychlordene Solution |
| HpChlor | 76-44-8 | Heptachlor Solution |
| HpChlor-nEp | 28044-83-9 | Heptachlor-endo-epoxide (isomer A) Solution |
| HpChlor-xEp | 1024-57-3 | Heptachlor-exo-epoxide (isomer B) Solution |
| cChlorD | 5103-71-9 | cis-Chlordane (alpha) Solution |
| tChlorD | 5103-74-2 | trans-Chlordane (gamma) Solution |
| OxyChlorD | 27304-13-8 | OxyChlordane Solution |
| cNChlor | 5103-73-1 | cis-Nonachlor Solution |
| tNChlor | 39765-80-5 | trans-Nonachlor Solution |
| ALD | 309-00-2 | Aldrin Solution |
| ISOD | 465-73-6 | Isodrin Solution |
| DELD | 60-57-1 | Dieldrin Solution |
| END | 72-20-8 | Endrin Solution |
| END-Ald | 7421-93-4 | Endrin Aldehyde Solution |
| END-Ket | 53494-70-5 | Endrin Ketone Solution |
| KEP | 143-50-0 | Kepone Solution |
| MRX | 2385-85-5 | Mirex Solution |
| aENDOS | 959-98-8 | Endosulfan I (alpha) Solution |
| bENDOS | 33213-65-9 | Endosulfan II (beta) Solution |
| ENDOS-S | 1031-07-8 | Endosulfan Sulfate Solution |
| MPeCB | 2483735-54-0 | Pentachloro(13C6)benzene Solution |
| MHxCB | 93952-14-8 | Hexachloro(13C6)benzene Solution |
| MaHCH | 222966-66-7 | alpha-1,2,3,4,5,6-Hexachloro(13C6)cyclohexane Solution |
| MbHCH | 222966-68-9 | beta-1,2,3,4,5,6-Hexachloro(13C6)cyclohexane Solution |
| MgHCH | 104215-85-2 | gamma-1,2,3,4,5,6-Hexachloro(13C6)cyclohexane Solution |
| MdHCH | N/A | delta-1,2,3,4,5,6-Hexachloro(13C6)cyclohexane Solution |
| M44P-DMDT | 2483735-96-0 | p,p’-(13C12)Methoxychlor Solution |
| M24P-DDD | 2483736-36-1 | 1,1-Dichloro-2-[2-chloro(13C6)phenyl]-2-[4-chloro(13C6)phenyl]ethane Solution |
| M44P-DDD | 1571957-95-3 | 1,1-Dichloro-2,2-bis[4-chloro(13C6)phenyl]ethane Solution |
| M24P-DDE | 2483735-97-1 | 1,1-Dichloro-2-[2-chloro(13C6)phenyl]-2-[4-chloro(13C6)phenyl]ethene Solution |
| M44P-DDE | 201612-50-2 | 1,1-Dichloro-2,2-bis[4-chloro(13C6)phenyl]ethene Solution |
| M24P-DDT | 1396995-26-8 | 1,1,1-Trichloro-2-[2-chloro(13C6)phenyl]-2-[4-chloro(13C6)phenyl]ethane Solution |
| M44P-DDT | 104215-84-1 | 1,1,1-Trichloro-2,2-bis[4-chloro(13C6)phenyl]ethane Solution |
| MHxChlor | N/A | (13C10)Chlordene Solution |
| MHpChlor | N/A | (13C10)Heptachlor Solution |
| McChlorD | 475275-01-5 | cis-(13C10)Chlordane (alpha) Solution |
| MtChlorD | 1262969-05-0 | trans-(13C10)Chlordane (gamma) Solution |
| McNChlor | 2484171-06-2 | cis-(13C10)Nonachlor Solution |
| MALD | 475274-95-4 | (13C12)Aldrin Solution |
| MISOD | 475274-98-7 | (13C12)Isodrin Solution |
| MDELD | 475274-96-5 | (13C12)Dieldrin Solution |
| MEND | 475274-99-8 | (13C12)Endrin Solution |
| MKEP | 2483736-05-4 | (13C10)Kepone Solution |
| MMRX | 2483736-04-3 | (13C10)Mirex Solution |
| PCN-CVS-A | M/C | Polychlorinated Naphthalene (PCN) Calibration Kit |
| PCN-LCS-A | M/C | PCN Extraction Standard Solution |
| PCN-ISS-A | M/C | PCN Injection Standard Solution |
| PCN-SS-A | M/C | PCN Sampling Standard Solution |
| PCN-STK-A | M/C | PCN Native Stock Solution |
| PN-1S | 90-13-1 | 1-Chloronaphthalene Solution |
| PN-4S | 2198-75-6 | 1,3-Dichloronaphthalene Solution |
| PN-5S | 1825-31-6 | 1,4-Dichloronaphthalene Solution |
| PN-9S | 2050-74-0 | 1,8-Dichloronaphthalene Solution |
| PN-17S | 55720-34-8 | 1,2,7-Trichloronaphthalene Solution |
| PN-18S | 55720-35-9 | 1,2,8-Trichloronaphthalene Solution |
| PN-19S | 51570-43-5 | 1,3,5-Trichloronaphthalene Solution |
| PN-20S | 55720-36-0 | 1,3,6-Trichloronaphthalene Solution |
| PN-21S | 55720-37-1 | 1,3,7-Trichloronaphthalene Solution |
| PN-23S | 2437-55-0 | 1,4,5-Trichloronaphthalene Solution |
| PN-24S | 2737-54-9 | 1,4,6-Trichloronaphthalene Solution |
| PN-33S | 51570-45-7 | 1,2,4,6-Tetrachloronaphthalene Solution |
| PN-34S | 67922-21-8 | 1,2,4,7-Tetrachloronaphthalene Solution |
| PN-35S | 6529-87-9 | 1,2,4,8-Tetrachloronaphthalene Solution |
| PN-37S | 67922-23-0 | 1,2,5,7-Tetrachloronaphthalene Solution |
| PN-40S | 67922-24-1 | 1,2,6,8-Tetrachloronaphthalene Solution |
| PN-41S | 149864-82-4 | 1,2,7,8-Tetrachloronaphthalene Solution |
| PN-42S | 53555-64-9 | 1,3,5,7-Tetrachloronaphthalene Solution |
| PN-54S | 150224-16-1 | 1,2,3,6,7-Pentachloronaphthalene Solution |
| PN-56S | 150205-21-3 | 1,2,3,7,8-Pentachloronaphthalene Solution |
| PN-57S | 150224-20-7 | 1,2,4,5,6-Pentachloronaphthalene Solution |
| PN-59S | 150224-25-2 | 1,2,4,5,8-Pentachloronaphthalene Solution |
| PN-63S | 58877-88-6 | 1,2,3,4,5,6-Hexachloronaphthalene Solution |
| PN-68S | 103426-95-5 | 1,2,3,5,6,8-Hexachloronaphthalene Solution |
| PN-70S | 17062-87-2 | 1,2,3,6,7,8-Hexachloronaphthalene Solution |
| PN-74S | 58863-15-3 | 1,2,3,4,5,6,8-Heptachloronaphthalene Solution |
| MPN-1 | N/A | 1-Chloro(13C10)naphthalene Solution |
| MPN-5 | N/A | 1,4-Dichloro(13C10)]naphthalene Solution |
| MPN-23 | N/A | 1,4,5-Trichloro(13C10)naphthalene Solution |
| MPN-24 | N/A | 1,4,6-Trichloro(13C10)naphthalene Solution |
| MPN-48 | N/A | 2,3,6,7-Tetrachloro(13C10)naphthalene Solution |
| MPN-54 | N/A | 1,2,3,6,7-Pentachloro(13C10)naphthalene Solution |
| MPN-56 | N/A | 1,2,3,7,8-Pentachloro(13C10)naphthalene Solution |
| MPN-59 | N/A | 1,2,4,5,8-Pentachloro(13C10)naphthalene Solution |
| MPN-67 | 219526-47-3 | 1,2,3,5,6,7-Hexachloro(13C10)naphthalene Solution |
| MPN-70 | N/A | 1,2,3,6,7,8-Hexachloro(13C10)naphthalene Solution |
| MPN-72 | N/A | 1,2,4,5,7,8-Hexachloro(13C10)naphthalene Solution |
| MPN-73 | 219526-49-5 | 1,2,3,4,5,6,7-Heptachloro(13C10)naphthalene Solution |
| MPN-74 | N/A | 1,2,3,4,5,6,8-Heptachloro(13C10)naphthalene Solution |
| MPN-75 | 219526-50-8 | Octachloro(13C10)]naphthalene Solution |
| MtNChlor | 1262969-06-1 | trans-(13C10)Nonachlor Solution |
| MHpChlor-xEp | 2483736-00-9 | (13C10)Heptachlor-exo-epoxide (isomer B) Solution |
| MOxyChlorD | 2483735-99-3 | (13C10)Oxychlordane Solution |
| MaENDOS | 2483736-15-6 | (13C9)Endosulfan I (alpha) Solution |
| MbENDOS | 2484171-16-4 | (13C9)Endosulfan II (beta) Solution |
| MENDOS-S | N/A | (13C9)Endosulfan Sulfate Solution |
| FPeSA-I | 82765-76-2 | Perfluoro-1-pentanesulfonamide Solution |
| N-EtFBSA-M | 40630-67-9 | N-Ethylperfluoro-1-butanesulfonamide Solution |
| N-EtFBSE-M | 34449-89-3 | 2-(N-Ethylperfluoro-1-butanesulfonamido)ethanol Solution |
| br-FOSA | M/C | Perfluorooctanesulfonamide Solution/Mixture of Linear and Branched Isomers |
| br-NMeFOSA | M/C | N-Methylperfluorooctanesulfonamide Solution/Mixture of Linear and Branched Isomers |
| br-NEtFOSA | M/C | N-Ethylperfluorooctanesulfonamide Solution/Mixture of Linear and Branched Isomers |
| br-NMeFOSE | M/C | 2-(N-Methylperfluorooctanesulfonamido)ethanol Solution/Mixture of Linear and Branched Isomers |
| br-NEtFOSE | M/C | 2-(N-Ethylperfluorooctanesulfonamido)ethanol Solution/Mixture of Linear and Branched Isomers |
| br-PFOA | M/C | Perfluorooctanoic Acid Solution/Mixture of Linear and Branched Isomers (with 4 mole eq. NaOH) |
| br-PFNA | M/C | Perfluorononanoic Acid Solution/Mixture of Linear and Branched Isomers (with 4 mole eq. NaOH) |
| PFMeS | 2926-30-9 | Sodium trifluoromethanesulfonate Solution |
| PFEtS | 2923-21-9 | Sodium perfluoroethanesulfonate Solution |
| TFA | 76-05-1 | Trifluoroacetic acid Solution |
| PFPrA | 422-64-0 | Perfluoropropanoic acid Solution |
| EPA-533APDS | M/C | U.S. EPA Method 533 Native PFAS Analyte Primary Dilution Standard Solution/Mixture (expanded br/linear mixture) |
| EPA-537APDS | M/C | U.S. EPA Method 537.1 Native PFAS Analyte Primary Dilution Standard Solution/Mixture (expanded br/linear mixture with 4 mole eq. NaOH) |
| EPA-8327STK | M/C | U.S. EPA Method 8327 Native PFAS Precision and Recovery Standard Stock Solution/Mixture (with 4 mole eq. NaOH) |
| EPA-1633STK | M/C | U.S. EPA Method 1633 Native PFAS Stock Solution/Mixture (with 4 mole eq. NaOH) |
| UV-328 | 25973-55-1 | 2-(2H-Benzotriazol-2-yl)-4,6-bis(1,1-dimethylpropyl)phenol Solution |
| M6UV-328 | N/A | 2-[2H-(13C6)Benzotriazol-2-yl]-4,6-bis(1,1-dimethylpropyl)phenol Solution |
| N-OxAmP-6:2FOSA | 80475-32-7 | 6:2 Fluorotelomer sulfonamide amine oxide (6:2 FTNO; Capstone A) Solution |
| N-AP-6:2FOSA | 34455-22-6 | 6:2 Fluorotelomer sulfonamide alkylamine (6:2 FTAA) Solution |
| M3N-CMAmP-6:2FOSA | N/A | 13C3-6:2 Fluorotelomer sulfonamide alkylbetaine (13C3-6:2 FTAB; mass-labelled Capstone B) Solution |
| aPFNOBS (OBS) | 70829-87-7 | Sodium p-perfluorous nonenoxybenzenesulfonate Solution |
| PFAS-3PAR | M/C | Native PFAS Precision and Recovery Standard Solution (with 4 mole eq. NaOH) |
| MPFAS-3ES | M/C | Mass-Labelled PFAS Extraction Standard Solution (with 4 mole eq. NaOH) |
| M2-10:2FTS | N/A | Sodium 1H,1H,2H,2H-perfluoro(1,2-13C2)dodecanesulfonate (13C2-10:2 FTS) Solution |
| LiPFMeSI | 90076-65-6 | Lithium bis(trifluoromethanesulfonyl)imide Solution (HQ-115) |
| LiPFEtSI | 132843-44-8 | Lithium bis(pentafluoroethanesulfonyl)imide Solution |
| N-AP-FBSA | 68555-77-1 | N-[3-(Dimethylamino)propan-1-yl]perfluoro-1-butanesulfonamide Solution |
| N-AP-FPeSA | 68555-78-2 | N-[3-(Dimethylamino)propan-1-yl]perfluoro-1-pentanesulfonamide Solution |
| N-AP-FOSA | 13417-01-1 | N-[3-(Dimethylamino)propan-1-yl]perfluoro-1-octanesulfonamide Solution |
| ISO 21675-LSSA | M/C | ISO 21675:2019 PFAS Labelled Stock Solution Additional Analytes (with 4 mole eq. NaOH) |
| HFPO-TrA | 13252-14-7 | Hexafluoropropylene oxide trimer acid Solution |
| HFPO-TeA | 65294-16-8 | Hexafluoropropylene oxide tetramer acid Solution |
