Product Search
Looking for a specific product? Use our product filter to find it!
The search field below was designed to enable our customers to conveniently search our products using product codes, CAS numbers, or product descriptions.
- Simply enter a Product Code, CAS number, or Description into the search box and the table will be filtered to display only the most applicable items.
- Please note that CAS numbers are only listed for individual component solutions
(M/C = multiple components, N/A = not available).
For more information on specific products, view our catalogue
| Product Code | CAS number | Description |
|---|---|---|
| EPA-1613CVS | M/C | EPA Method 1613 Calibration Kit |
| EPA-1613CSL | M/C | Extended Calibration/Low Level Solution |
| EPA-1613CS0.5 | M/C | Extended Calibration/Low Level Solution ((CS1)/2) |
| EPA-1613LCS | M/C | Labelled Compound Stock Solution |
| EPA-1613CSS | N/A | Cleanup Standard Spiking Solution |
| EPA-1613CSS-STK | M/C | Cleanup Standard Stock Solution |
| EPA-1613ISS | M/C | Internal Standard Spiking Solution |
| EPA-1613ISS-STK | M/C | Internal Standard Spiking Stock Solution |
| EPA-1613PAR | M/C | Precision and Recovery Stock Solution |
| EPA-1613STOCK | M/C | EPA Method 1613 Native Stock Solution |
| CS3WT | M/C | EPA-1613CS3 + Window Defining/2378-TCDD Resolution Mix |
| EPA-513CVS | M/C | EPA Method 513 Calibration Kit |
| 513-CS0.25 | M/C | Custom Calibration Solution |
| 513-CS4-1/10 | M/C | Custom Calibration Solution |
| 513-CS4RT | M/C | Custom Calibration Solution |
| EPA-513LCSS | M/C | Labelled TCDD/TCDF Spiking Solution |
| EPA-513ISS | M/C | Internal Standard Spiking Solution |
| EPA-513CSSA | M/C | Cleanup Standard Spiking Solution |
| EPA-513CSSB | M/C | Alternative Cleanup Standard Spiking Solution |
| EPA-513PAR | M/C | Precision and Recovery Solution |
| 513-P-CS4 | M/C | 513-P-CS4 |
| EPA-8280CVS | M/C | EPA Method 8280 Calibration Kit |
| EPA-8280IS | M/C | Internal Standard Solution |
| EPA-8280ISB | M/C | Additional Internal Standard Solution |
| EPA-8280CS | M/C | Cleanup Standard Solution |
| EPA-8280RS | M/C | Recovery Standard Solution |
| EPA-8280MSS | M/C | Matrix Spiking Solution |
| EPA-8290HRCC1-5 | M/C | EPA Method 8290 Calibration Kit |
| EPA-8290HRCC0.25 | M/C | Supplemental Calibration Solution |
| EPA-8290HRCC0.5 | M/C | Supplemental Calibration Solution |
| EPA-8290SFS | M/C | Sample Fortification Solution |
| EPA-8290RSS | M/C | Recovery Standard Solution |
| EPA-8290MSS | M/C | Matrix Spiking Solution |
| EPA-8290STN | M/C | Native Stock PCDDs and PCDFs |
| EPA-23CS1-5 | M/C | EPA Method 23 Calibration Kit |
| EPA-23IS | M/C | Internal Standard Solution |
| EPA-23ISS | M/C | Internal Standard Stock Solution |
| EPA-23SS | M/C | Surrogate Standard Solution |
| EPA-23SSS | M/C | Surrogate Standard Stock Solution |
| EPA-23RS | M/C | Recovery Standard Solution |
| EPA-23AS | M/C | Alternative Standard |
| EN-1948CVS | M/C | European Method EN-1948 Calibration Kit |
| EN-1948CSL | M/C | Extended Calibration/Low Level Solution |
| EN-1948ES | M/C | Extraction Standard Solution |
| EN-1948IS | M/C | Syringe Standard Solution |
| EN-1948SS | M/C | Sampling Standard Solution |
| EN-1948STK | M/C | PCDD/PCDF Solution/Mixture |
| 48B-CVS | M/C | HRGC/HRMS Calibration Solutions (PCDDs/PCDFs) |
| 5CWDS | M/C | Window Defining Mixture for DB5/BP5/HP2/Rtx-5/SPB-5 |
| 5TCDD | M/C | 2378-TCDD Specificity Mix for DB5/BP5/HP2/Rtx-5/SPB-5 |
| 225TCDF | M/C | 2378-TCDF Specificity Mix for DB/BP/HP/Rtx/SPB -225 |
| 5TDWD | M/C | Combined Window Defining/TCDD Resolution Mix |
| TDTFWD | M/C | Multi-Column Combined Window Defining/Resolution Mix |
| DD-0-S | 262-12-4 | Dibenzo-p-dioxin |
| DD-1-S | 39227-53-7 | 1-Chlorodibenzo-p-dioxin |
| DD-2-S | 39227-54-8 | 2-Chlorodibenzo-p-dioxin |
| DD-23-S | 29446-15-9 | 2,3-Dichlorodibenzo-p-dioxin |
| DD-27-S | 33857-26-0 | 2,7-Dichlorodibenzo-p-dioxin |
| DD-28-S | 38964-22-6 | 2,8-Dichlorodibenzo-p-dioxin |
| DD-123-S | 54536-17-3 | 1,2,3-Trichlorodibenzo-p-dioxin |
| DD-124-S | 39227-58-2 | 1,2,4-Trichlorodibenzo-p-dioxin |
| DD-237-S | 33857-28-2 | 2,3,7-Trichlorodibenzo-p-dioxin |
| DD-1234-S | 30746-58-8 | 1,2,3,4-Tetrachlorodibenzo-p-dioxin |
| DD-1247/8-S | 71669-28-8; 71669-29-9 |
1,2,4,7/1,2,4,8-Tetrachlorodibenzo-p-dioxin mix |
| DD-1278-S | 34816-53-0 | 1,2,7,8-Tetrachlorodibenzo-p-dioxin |
| DD-1289-S | 62470-54-6 | 1,2,8,9-Tetrachlorodibenzo-p-dioxin |
| DD-1368-S | 33423-92-6 | 1,3,6,8-Tetrachlorodibenzo-p-dioxin |
| DD-1378-S | 50585-46-1 | 1,3,7,8-Tetrachlorodibenzo-p-dioxin |
| DD-1379-S | 62470-53-5 | 1,3,7,9-Tetrachlorodibenzo-p-dioxin |
| DD-1478-S | 40581-94-0 | 1,4,7,8-Tetrachlorodibenzo-p-dioxin |
| DD-2378-S | 1746-01-6 | 2,3,7,8-Tetrachlorodibenzo-p-dioxin |
| DD-12378-S | 40321-76-4 | 1,2,3,7,8-Pentachlorodibenzo-p-dioxin |
| DD-12478-S | 58802-08-7 | 1,2,4,7,8-Pentachlorodibenzo-p-dioxin |
| DD-123467-S | 58200-66-1 | 1,2,3,4,6,7-Hexachlorodibenzo-p-dioxin |
| DD-123468-S | 58200-67-2 | 1,2,3,4,6,8-Hexachlorodibenzo-p-dioxin |
| DD-123478-S | 39227-28-6 | 1,2,3,4,7,8-Hexachlorodibenzo-p-dioxin |
| DD-123678-S | 57653-85-7 | 1,2,3,6,7,8-Hexachlorodibenzo-p-dioxin |
| DD-123789-S | 19408-74-3 | 1,2,3,7,8,9-Hexachlorodibenzo-p-dioxin |
| DD-124679-S | 39227-62-8 | 1,2,4,6,7,9-Hexachlorodibenzo-p-dioxin |
| DD-1234678-S | 35822-46-9 | 1,2,3,4,6,7,8-Heptachlorodibenzo-p-dioxin |
| DD-12346789-S | 3268-87-9 | Octachlorodibenzo-p-dioxin |
| DF-0-S | 132-64-9 | Dibenzofuran |
| DF-2-S | 51230-49-0 | 2-Chlorodibenzofuran |
| DF-4-S | 74992-96-4 | 4-Chlorodibenzofuran |
| DF-23-S | 64126-86-9 | 2,3-Dichlorodibenzofuran |
| DF-24-S | 24478-74-8 | 2,4-Dichlorodibenzofuran |
| DF-26-S | 60390-27-4 | 2,6-Dichlorodibenzofuran |
| DF-27-S | 74992-98-6 | 2,7-Dichlorodibenzofuran |
| DF-28-S | 5409-83-6 | 2,8-Dichlorodibenzofuran |
| DF-136-S | 83704-39-6 | 1,3,6-Trichlorodibenzofuran |
| DF-138-S | 76621-12-0 | 1,3,8-Trichlorodibenzofuran |
| DF-146-S | 82911-60-2 | 1,4,6-Trichlorodibenzofuran |
| DF-147-S | 83704-41-0 | 1,4,7-Trichlorodibenzofuran |
| DF-149-S | 70648-13-4 | 1,4,9-Trichlorodibenzofuran |
| DF-234-S | 57117-34-7 | 2,3,4-Trichlorodibenzofuran |
| DF-236-S | 57117-33-6 | 2,3,6-Trichlorodibenzofuran |
| DF-238-S | 57117-32-5 | 2,3,8-Trichlorodibenzofuran |
| DF-246-S | 58802-14-5 | 2,4,6-Trichlorodibenzofuran |
| DF-247-S | 83704-42-1 | 2,4,7-Trichlorodibenzofuran |
| DF-248-S | 54589-71-8 | 2,4,8-Trichlorodibenzofuran |
| DF-267-S | 83704-45-4 | 2,6,7-Trichlorodibenzofuran |
| DF-1236-S | 83704-21-6 | 1,2,3,6-Tetrachlorodibenzofuran |
| DF-1238-S | 62615-08-1 | 1,2,3,8-Tetrachlorodibenzofuran |
| DF-1239-S | 83704-23-8 | 1,2,3,9-Tetrachlorodibenzofuran |
| DF-1246-S | 71998-73-7 | 1,2,4,6-Tetrachlorodibenzofuran |
| DF-1247-S | 83719-40-8 | 1,2,4,7-Tetrachlorodibenzofuran |
| DF-1248-S | 64126-87-0 | 1,2,4,8-Tetrachlorodibenzofuran |
| DF-1267-S | 83704-25-0 | 1,2,6,7-Tetrachlorodibenzofuran |
| DF-1278-S | 58802-20-3 | 1,2,7,8-Tetrachlorodibenzofuran |
| DF-1279-S | 83704-26-1 | 1,2,7,9-Tetrachlorodibenzofuran |
| DF-1347-S | 70648-16-7 | 1,3,4,7-Tetrachlorodibenzofuran |
| DF-1348-S | 92341-04-3 | 1,3,4,8-Tetrachlorodibenzofuran |
| DF-1349-S | 83704-28-3 | 1,3,4,9-Tetrachlorodibenzofuran |
| DF-1367-S | 57117-36-9 | 1,3,6,7-Tetrachlorodibenzofuran |
| DF-1368-S | 71998-72-6 | 1,3,6,8-Tetrachlorodibenzofuran |
| DF-1369-S | 83690-98-6 | 1,3,6,9-Tetrachlorodibenzofuran |
| DF-1378-S | 57117-35-8 | 1,3,7,8-Tetrachlorodibenzofuran |
| DF-1467-S | 66794-59-0 | 1,4,6,7-Tetrachlorodibenzofuran |
| DF-1478-S | 83704-29-4 | 1,4,7,8-Tetrachlorodibenzofuran |
| DF-2346-S | 83704-30-7 | 2,3,4,6-Tetrachlorodibenzofuran |
| DF-2347-S | 83704-31-8 | 2,3,4,7-Tetrachlorodibenzofuran |
| DF-2348-S | 83704-32-9 | 2,3,4,8-Tetrachlorodibenzofuran |
| DF-2368-S | 57117-37-0 | 2,3,6,8-Tetrachlorodibenzofuran |
| DF-2378-S | 51207-31-9 | 2,3,7,8-Tetrachlorodibenzofuran |
| DF-2467-S | 57117-38-1 | 2,4,6,7-Tetrachlorodibenzofuran |
| DF-2468-S | 58802-19-0 | 2,4,6,8-Tetrachlorodibenzofuran |
| DF-3467-S | 57117-40-5 | 3,4,6,7-Tetrachlorodibenzofuran |
| DF-12347-S | 83704-48-7 | 1,2,3,4,7-Pentachlorodibenzofuran |
| DF-12348-S | 67517-48-0 | 1,2,3,4,8-Pentachlorodibenzofuran |
| DF-12367-S | 57117-42-7 | 1,2,3,6,7-Pentachlorodibenzofuran |
| DF-12378-S | 57117-41-6 | 1,2,3,7,8-Pentachlorodibenzofuran |
| DF-12379-S | 83704-53-4 | 1,2,3,7,9-Pentachlorodibenzofuran |
| DF-12389-S | 83704-54-5 | 1,2,3,8,9-Pentachlorodibenzofuran |
| DF-12467-S | 83704-50-1 | 1,2,4,6,7-Pentachlorodibenzofuran |
| DF-12468-S | 69698-57-3 | 1,2,4,6,8-Pentachlorodibenzofuran |
| DF-12478-S | 58802-15-6 | 1,2,4,7,8-Pentachlorodibenzofuran |
| DF-13467-S | 83704-36-3 | 1,3,4,6,7-Pentachlorodibenzofuran |
| DF-13478-S | 58802-16-7 | 1,3,4,7,8-Pentachlorodibenzofuran |
| DF-13479-S | 70648-20-3 | 1,3,4,7,9-Pentachlorodibenzofuran |
| DF-13678-S | 70648-21-4 | 1,3,6,7,8-Pentachlorodibenzofuran |
| DF-23467-S | 57117-43-8 | 2,3,4,6,7-Pentachlorodibenzofuran |
| DF-23469-S | 83704-35-2 | 2,3,4,6,9-Pentachlorodibenzofuran (or 1,4,6,7,8) |
| DF-23478-S | 57117-31-4 | 2,3,4,7,8-Pentachlorodibenzofuran |
| DF-123467-S | 79060-60-9 | 1,2,3,4,6,7-Hexachlorodibenzofuran |
| DF-123468-S | 69698-60-8 | 1,2,3,4,6,8-Hexachlorodibenzofuran |
| DF-123478-S | 70648-26-9 | 1,2,3,4,7,8-Hexachlorodibenzofuran |
| DF-123489-S | 92341-07-6 | 1,2,3,4,8,9-Hexachlorodibenzofuran |
| DF-123678-S | 57117-44-9 | 1,2,3,6,7,8-Hexachlorodibenzofuran |
| DF-123789-S | 72918-21-9 | 1,2,3,7,8,9-Hexachlorodibenzofuran |
| DF-124678-S | 67562-40-7 | 1,2,4,6,7,8-Hexachlorodibenzofuran |
| DF-234678-S | 60851-34-5 | 2,3,4,6,7,8-Hexachlorodibenzofuran |
| DF-1234678-S | 67562-39-4 | 1,2,3,4,6,7,8-Heptachlorodibenzofuran |
| DF-1234689-S | 69698-58-4 | 1,2,3,4,6,8,9-Heptachlorodibenzofuran |
| DF-1234789-S | 55673-89-7 | 1,2,3,4,7,8,9-Heptachlorodibenzofuran |
| DF-12346789-S | 39001-02-0 | Octachlorodibenzofuran |
| MDD-0 | N/A | [13C12]Dibenzo-p-dioxin |
| MDD-2 | N/A | 2-Chloro[13C12]dibenzo-p-dioxin |
| MDD-23 | N/A | 2,3-Dichloro[13C12]dibenzo-p-dioxin |
| MDD-237 | N/A | 2,3,7-Trichloro[13C12]dibenzo-p-dioxin |
| MDD-1234 | N/A | 1,2,3,4-Tetrachloro[13C12]dibenzo-p-dioxin (97.5%) |
| MDD-1278 | N/A | 1,2,7,8-Tetrachloro[13C12]dibenzo-p-dioxin |
| MDD-1368 | N/A | 1,3,6,8-Tetrachloro[13C12]dibenzo-p-dioxin |
| MDD-1378 | N/A | 1,3,7,8-Tetrachloro[13C12]dibenzo-p-dioxin |
| MDD-2378 | 76523-40-5 | 2,3,7,8-Tetrachloro[13C12]dibenzo-p-dioxin |
| MDD-12378 | 109719-79-1 | 1,2,3,7,8-Pentachloro[13C12]dibenzo-p-dioxin |
| MDD-12389 | N/A | 1,2,3,8,9-Pentachloro[13C12]dibenzo-p-dioxin |
| MDD-12478 | N/A | 1,2,4,7,8-Pentachloro[13C12]dibenzo-p-dioxin |
| MDD-12479 | N/A | 1,2,4,7,9-Pentachloro[13C12]dibenzo-p-dioxin |
| MDD-123467 | N/A | 1,2,3,4,6,7-Hexachloro[13C12]dibenzo-p-dioxin |
| MDD-123468 | N/A | 1,2,3,4,6,8-Hexachloro[13C12]dibenzo-p-dioxin |
| MDD-123478 | 109719-80-4 | 1,2,3,4,7,8-Hexachloro[13C12]dibenzo-p-dioxin |
| MDD-123678 | 109719-81-5 | 1,2,3,6,7,8-Hexachloro[13C12]dibenzo-p-dioxin |
| MDD-123789 | 109719-82-6 | 1,2,3,7,8,9-Hexachloro[13C12]dibenzo-p-dioxin |
| MDD-1234678 | 109719-83-7 | 1,2,3,4,6,7,8-Heptachloro[13C12]dibenzo-p-dioxin |
| MDD-1234679 | N/A | 1,2,3,4,6,7,9-Heptachloro[13C12]dibenzo-p-dioxin |
| MDD-12346789 | 114423-97-1 | Octachloro[13C12]dibenzo-p-dioxin |
| MCDD-2378 | 85508-50-5 | 2,3,7,8-[37Cl4]-Tetrachlorodibenzo-p-dioxin |
| MDF-0 | N/A | [13C12]Dibenzofuran |
| MDF-2 | N/A | 2-Chloro[13C12]dibenzofuran |
| MDF-23 | N/A | 2,3-Dichloro[13C12]dibenzofuran |
| MDF-238 | N/A | 2,3,8-Trichloro[13C12]dibenzofuran |
| MDF-1234 | N/A | 1,2,3,4-Tetrachloro[13C12]dibenzofuran (97.5% purity) |
| MDF-1278-1 | N/A | 1,2,7,8-Tetrachloro[13C12]dibenzofuran |
| MDF-1278 | N/A | 1,2,7,8-Tetrachloro[13C12]dibenzofuran |
| MDF-1368 | N/A | 1,3,6,8-Tetrachloro[13C12]dibenzofuran |
| MDF-2378 | 89059-46-1 | 2,3,7,8-Tetrachloro[13C12]dibenzofuran |
| MDF-12346-1 | N/A | 1,2,3,4,6-Pentachloro[13C12]dibenzofuran |
| MDF-12346 | N/A | 1,2,3,4,6-Pentachloro[13C12]dibenzofuran |
| MDF-12378 | 109719-77-9 | 1,2,3,7,8-Pentachloro[13C12]dibenzofuran |
| MDF-13468 | N/A | 1,3,4,6,8-Pentachloro[13C12]dibenzofuran |
| MDF-23478 | 116843-02-8 | 2,3,4,7,8-Pentachloro[13C12]dibenzofuran |
| MDF-123469-1 | N/A | 1,2,3,4,6,9-Hexachloro[13C12]dibenzofuran |
| MDF-123469 | N/A | 1,2,3,4,6,9-Hexachloro[13C12]dibenzofuran |
| MDF-123478 | 114423-98-2 | 1,2,3,4,7,8-Hexachloro[13C12]dibenzofuran |
| MDF-123678 | 116843-03-9 | 1,2,3,6,7,8-Hexachloro[13C12]dibenzofuran |
| MDF-123789 | 116843-04-0 | 1,2,3,7,8,9-Hexachloro[13C12]dibenzofuran |
| MDF-234678 | 116843-05-1 | 2,3,4,6,7,8-Hexachloro[13C12]dibenzofuran |
| MDF-1234678 | 109719-84-8 | 1,2,3,4,6,7,8-Heptachloro[13C12]dibenzofuran |
| MDF-1234689-1 | N/A | 1,2,3,4,6,8,9-Heptachloro[13C12]dibenzofuran |
| MDF-1234689 | N/A | 1,2,3,4,6,8,9-Heptachloro[13C12]dibenzofuran |
| MDF-1234789 | 109719-94-0 | 1,2,3,4,7,8,9-Heptachloro[13C12]dibenzofuran |
| MDF-12346789 | N/A | Octachloro[13C12]dibenzofuran |
| DF-CVS-A10 | M/C | PCDD/PCDF HRMS Calibration and Verification Solutions |
| DF-CVS-A5 | M/C | PCDD/PCDF HRMS Calibration and Verification Solutions |
| DF-CVS-B10 | M/C | PCDD/PCDF HRMS Calibration and Verification Solutions |
| DF-CVS-C10 | M/C | PCDD/PCDF HRMS Calibration and Verification Solutions |
| DF-C10-CS8 | M/C | High Level Calibration Solution |
| DFP-CVS-B10 | M/C | PCDD/PCDF/PCB Calibration Kit |
| NK-CVS-J | M/C | PCDD & PCDF Calibration Kit |
| DF-LCS-A | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-A200 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-A40 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-A20 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-B | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-B200 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-B100 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-B40 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-C | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-DOW2010 | M/C | Mass-Labelled PCDD/PCDF Custom Solution/Mixture |
| DF-LCS-C200 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-C100 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DF-LCS-C40 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| DS-1000 | M/C | Mass-Labelled PCDD Solution/Mixture |
| FS-1000 | M/C | Mass-Labelled PCDF Solution/Mixture |
| NK-LCS-A | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| NK-LCS-A1 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| NK-LCS-G | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| NK-LCS-I | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| NK-LCS-O | M/C | Mass-Labelled PCDD/PCDF Solution Mixture |
| NK-LCS-T | M/C | Mass-Labelled PCDD/PCDF Solution Mixture |
| DF-IS-A | M/C | Mass-Labelled PCDD Internal Standard Solution |
| DF-IS-A200 | M/C | Mass-Labelled PCDD Internal Standard Solution |
| DF-IS-A40 | M/C | Mass-Labelled PCDD Internal Standard Solution |
| DF-IS-B | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-B200 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-B40 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-C | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-C200 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-C40 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-D | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-D200 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-D40 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| DF-IS-E | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-E200 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-E40 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-F | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-F200 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-F40 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-G | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-G200 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-G40 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-H | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-H200 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-H40 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-I | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-I200 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-I40 | M/C | Mass-Labelled PCDF Internal Standard Solution |
| DF-IS-J | M/C | Mass-Labelled PCDD Internal Standard Solution |
| DF-IS-J100 | M/C | Mass-Labelled PCDD Internal Standard Solution |
| DF-IS-J20 | M/C | Mass-Labelled PCDD Internal Standard Solution |
| DF-SS-A | M/C | Mass-Labelled PCDD Sampling Spike Solution |
| DF-SS-A100 | M/C | Mass-Labelled PCDD Sampling Spike Solution |
| DF-SS-A20 | M/C | Mass-Labelled PCDD Sampling Spike Solution |
| NK-IS-D | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
| NK-IS-J4 | M/C | Internal Standard Solution |
| NK-IS-J5 | M/C | Internal Standard Solution |
| DFP-LCS-B | M/C | Mass-Labelled PCDDs/PCDFs/PCBs Solution/Mixture |
| DFP-LCS-B100 | M/C | Mass-Labelled PCDDs/PCDFs/PCBs Solution/Mixture |
| DFP-LCS-B20 | M/C | Mass-Labelled PCDDs/PCDFs/PCBs Solution/Mixture |
| DFP-LCS-A | M/C | Mass-Labelled PCDD/PCDF/PCB Solution/Mixture |
| DFP-IS-A | M/C | Mass-Labelled PCDF/PCB Syringe Spike |
| DFP-SS-A | M/C | Mass-Labelled PCDD/PCB Sampling Spike |
| DFP-IS-B10 | M/C | Mass-Labelled PCDD & PCB Internal Standard Solution |
| DFP-SS-A10 | M/C | Mass-Labelled PCDD & PCB Sampling Spike Solution |
| DF-ST-A | M/C | Native PCDD/PCDF Solution/Mixture |
| DF-ST-B | M/C | Native PCDD/PCDF Solution/Mixture |
| DF-ST-C | M/C | Native PCDD/PCDF Solution/Mixture |
| NK-ST-A | M/C | Native PCDD/PCDF Solution/Mixture |
| NK-ST-A4 | M/C | Native PCDD/PCDF Solution/Mixture |
| NK-ST-B2 | M/C | Native PCDD/PCDF Solution/Mixture |
| NK-ST-B3 | M/C | Native PCDD/PCDF Solution/Mixture |
| NK-ST-B4 | M/C | Native PCDD/PCDF Solution/Mixture |
| DDF-MDT | M/C | Native PCDD/PCDF Solution/Mixture |
| MDDF-MDT | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
| WP-CVS | M/C | Dioxin-Like PCBs Calibration Kit |
| WP-LCS | M/C | Surrogate Spiking Solution |
| WP-ISS | M/C | Internal Standard Solution |
| WP-STK | M/C | Native PCB Solution |
| WP-CVS-F | M/C | WHO/EPA PCB Calibration Kit |
| WP-FS | M/C | Mass-Labelled WHO/EPA PCB Field Spiking Solution |
| 68C-CVS | M/C | EPA Method 1668C Calibration Kit(5x200ul + 500ul CS3) |
| 68C-LCS | M/C | Labelled Toxics/LOC/Window Defining Stock Solution |
| 68C-CS | M/C | Labelled Cleanup Stock Solution |
| 68C-IS | M/C | Labelled Injection/Internal Standard Stock Solution |
| 68C-PAR | M/C | Native Toxics/LOC Stock Solution |
| EPA-1668CVS | M/C | EPA Method 1668 Calibration Kit |
| EPA-1668LCS | M/C | Labelled Compound Stock Solution |
| EPA-1668CS | M/C | Cleanup Standard Solution |
| EPA-1668IS | M/C | Internal Standard Stock Solution |
| EPA-1668PAR | M/C | Precision and Recovery Solution |
| EC9605-CVS | M/C | PCB Calibration Solutions for GC/MS Calibration Kit |
| EC9605-RS | M/C | Recovery Standard Solution |
| EC9605-SS | M/C | Surrogate Solution |
| EC9605-PAR | M/C | Precision and Recovery Solution |
| EC-PCB-STOCK | M/C | Native PCB Solution/Mixture |
| P48-W-CVS | M/C | Calibration Kit for WHO (Dioxin-like) PCBs; EN 1948-4:2010 |
| P48-M-CVS | M/C | Calibration Kit for Marker PCBs; EN 1948-4:2010 |
| WM48-CVS | M/C | Calibration Kit for WHO & Marker PCBs; EN 1948-4:2010 |
| P48-W-PAR | M/C | Precision and Recovery Stock Solution: WHO PCBs |
| P48-M-PAR | M/C | Precision and Recovery Stock Solution: Marker PCBs |
| P48-W-ES | M/C | WHO PCB Extraction Standard |
| P48-M-ES | M/C | Marker PCB Extraction Standard |
| P48-SS | M/C | Mass-Labelled PCB Sampling Standard |
| P48-RS | M/C | Mass-Labelled PCB Recovery Standard |
| P48-SS-STK | M/C | Mass-Labelled PCB Sampling Standard Stock Solution |
| P48-RS-STK | M/C | Mass-Labelled PCB Recovery Standard Stock Solution |
| P48-W-ES-STK | M/C | WHO PCB Extraction Standard Stock Solution |
| P48-M-PAR-STK | M/C | Native Marker PCB Stock Solution |
| MBP-1 | 234432-85-0 | 2-Chloro[13C12]biphenyl |
| MBP-3 | 208263-77-8 | 4-Chloro[13C12]biphenyl |
| MBP-4 | 234432-86-1 | 2,2′-Dichloro[13C12]biphenyl |
| MBP-5 | N/A | 2,3-Dichloro[13C12]biphenyl |
| MBP-8 | N/A | 2,4′-Dichloro[13C12]biphenyl |
| MBP-9 | 250694-89-4 | 2,5-Dichloro[13C12]biphenyl |
| MBP-11 | N/A | 3,3′-Dichloro[13C12]biphenyl |
| MBP-15 | 208263-67-6 | 4,4′-Dichloro[13C12]biphenyl |
| MBP-19 | 234432-87-2 | 2,2′,6-Trichloro[13C12]biphenyl |
| MBP-28 | 208263-76-7 | 2,4,4′-Trichloro[13C12]biphenyl |
| MBP-31 | N/A | 2,4′,5-Trichloro[13C12]biphenyl |
| MBP-37 | 208263-79-0 | 3,4,4′-Trichloro[13C12]biphenyl |
| MBP-52 | 208263-80-3 | 2,2′,5,5′-Tetrachloro[13C12]biphenyl |
| MBP-54 | 234432-88-3 | 2,2′,6,6′-Tetrachloro[13C12]biphenyl |
| MBP-60 | N/A | 2,3,4,4′-Tetrachloro[13C12]biphenyl |
| MBP-70 | N/A | 2,3′,4′,5-Tetrachloro[13C12]biphenyl |
| MBP-77 | 105600-23-5 | 3,3′,4,4′-Tetrachloro[13C12]biphenyl |
| MBP-79 | N/A | 3,3′,4,5′-Tetrachloro[13C12]biphenyl |
| MBP-81 | 208461-24-9 | 3,4,4′,5-Tetrachloro[13C12]biphenyl |
| MBP-95 | N/A | 2,2′,3,5′,6-Pentachloro[13C12]biphenyl |
| MBP-101 | 104130-39-4 | 2,2′,4,5,5′-Pentachloro[13C12]biphenyl |
| MBP-104 | 234432-89-4 | 2,2′,4,6,6′-Pentachloro[13C12]biphenyl |
| MBP-105 | 208263-62-1 | 2,3,3′,4,4′-Pentachloro[13C12]biphenyl |
| MBP-111 | 235416-29-2 | 2,3,3′,5,5′-Pentachloro[13C12]biphenyl |
| MBP-114 | 208263-63-2 | 2,3,4,4′,5-Pentachloro[13C12]biphenyl |
| MBP-118 | 104130-40-7 | 2,3′,4,4′,5-Pentachloro[13C12]biphenyl |
| MBP-123 | 208263-64-3 | 2′,3,4,4′,5-Pentachloro[13C12]biphenyl |
| MBP-126 | 208263-65-4 | 3,3′,4,4′,5-Pentachloro[13C12]biphenyl |
| MBP-127 | N/A | 3,3′,4,5,5′-Pentachloro[13C12]biphenyl |
| MBP-133 | N/A | 2,2′,3,3′,5,5′-Hexachloro[13C12]biphenyl |
| MBP-138 | 208263-66-5 | 2,2′,3,4,4′,5′-Hexachloro[13C12]biphenyl |
| MBP-153 | N/A | 2,2′,4,4′,5,5′-Hexachloro[13C12]biphenyl |
| MBP-155 | 234432-90-7 | 2,2′,4,4′,6,6′-Hexachloro[13C12]biphenyl |
| MBP-156 | 208263-68-7 | 2,3,3′,4,4′,5-Hexachloro[13C12]biphenyl |
| MBP-157 | 235416-30-5 | 2,3,3′,4,4′,5′-Hexachloro[13C12]biphenyl |
| MBP-159 | N/A | 2,3,3′,4,5,5′-Hexachloro[13C12]biphenyl |
| MBP-162 | N/A | 2,3,3′,4′,5,5′-Hexachloro[13C12]biphenyl |
| MBP-167 | 208263-69-8 | 2,3′,4,4′,5,5′-Hexachloro[13C12]biphenyl |
| MBP-169 | 208263-70-1 | 3,3′,4,4′,5,5′-Hexachloro[13C12]biphenyl |
| MBP-170 | 160901-80-4 | 2,2′,3,3′,4,4′,5-Heptachloro[13C12]biphenyl |
| MBP-178 | 232919-67-4 | 2,2′,3,3′,5,5′,6-Heptachloro[13C12]biphenyl |
| MBP-180 | 160901-82-6 | 2,2′,3,4,4′,5,5′-Heptachloro[13C12]biphenyl |
| MBP-188 | 234432-91-8 | 2,2′,3,4′,5,6,6′-Heptachloro[13C12]biphenyl |
| MBP-189 | 208263-73-4 | 2,3,3′,4,4′,5,5′-Heptachloro[13C12]biphenyl |
| MBP-194 | 208263-74-5 | 2,2′,3,3′,4,4′,5,5′-Octachloro[13C12]biphenyl |
| MBP-202 | 105600-26-8 | 2,2′,3,3′,5,5′,6,6′-Octachloro[13C12]biphenyl |
| MBP-205 | 234446-64-1 | 2,3,3′,4,4′,5,5′,6-Octachloro[13C12]biphenyl |
| MBP-206 | 208263-75-6 | 2,2′,3,3′,4,4′,5,5′,6-Nonachloro[13C12]biphenyl |
| MBP-208 | 234432-92-9 | 2,2′,3,3′,4,5,5′,6,6′-Nonachloro[13C12]biphenyl |
| MBP-209 | 105600-27-9 | Decachloro[13C12]biphenyl |
| PCB-CVS-H | M/C | Calibration Kit for HRGC/HRMS Analysis of PCBs |
| PCB-LCS-H | M/C | Mass-Labelled PCB Extraction Standards |
| PCB-ISS-H | M/C | Mass-Labelled PCB Internal/Recovery Standards |
| PCB-SCS-H | M/C | Mass-Labelled PCB Cleanup/Sampling Standards |
| PCB-PAR-H | M/C | Native PCB Solution |
| PCB-CVS-A10 | M/C | PCB HRGC/HRMS Calibration and Verification Solutions |
| PCB-CVS-A5 | M/C | PCB HRGC/HRMS Calibration and Verification Solutions |
| PCB-CVS-B10 | M/C | PCB HRGC/HRMS Calibration and Verification Solutions |
| PCB-B10-CS8 | M/C | High Level Calibration Solution |
| PCB-CVS-JQ | M/C | PCB HRGC/HRMS Calibration and Verification Solutions |
| PCB-LCS-A | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-LCS-A1 | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-LCS-A200 | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-LCS-A100 | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-LCS-A20 | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-IS-A | M/C | Mass-Labelled PCB Solution |
| PCB-IS-A100 | M/C | Mass-Labelled PCB Solution |
| PCB-IS-A20 | M/C | Mass-Labelled PCB Solution |
| PCB-IS-B | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-IS-B100 | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-IS-B20 | M/C | Mass-Labelled PCB Solution/Mixture |
| PCB-IS-C | M/C | Mass-Labelled PCB Syringe Spike Solution |
| PCB-IS-C100 | M/C | Mass-Labelled PCB Syringe Spike Solution |
| PCB-IS-C20 | M/C | Mass-Labelled PCB Syringe Spike Solution |
| PCB-SS-A | M/C | Mass-Labelled PCB Solution |
| PCB-SS-A100 | M/C | Mass-Labelled PCB Solution |
| PCB-SS-A20 | M/C | Mass-Labelled PCB Solution |
| BP-D7 | M/C | Native PCB Congener Solution/Mixture |
| MBP-D7 | M/C | Mass-Labelled PCB Congener Solution/Mixture |
| MBP-CP | M/C | Mass-Labelled Coplanar PCB Solution/Mixture |
| MBP-MO | M/C | Mass-Labelled Mono-Ortho PCB Solution/Mixture |
| MBP-CG | M/C | Mass-Labelled Mono to Decachloro PCB Solution/Mixture |
| NK-MBP-MXC | M/C | Solution/Mixture of Mass-Labelled PCBs |
| MBP-MXE | M/C | Mass-Labelled PCB Solution/Mixture |
| MBP-MXF | M/C | Mass-Labelled PCB Solution/Mixture |
| MBP-MXK | M/C | Mass-Labelled PCB Solution/Mixture |
| MBP-MXQ | M/C | Mass-Labelled PCB Solution/Mixture |
| MBP-MXR | M/C | Mass-Labelled PCB Solution/Mixture |
| MBP-MXS | M/C | Mass-Labelled PCB Solution/Mixture |
| MBP-70-(0.1) | N/A | Mass-Labelled PCB Solution |
| MBP-70-(0.2) | N/A | Mass-Labelled PCB Solution |
| MBP-79-(0.1) | N/A | Mass-Labelled PCB Solution |
| MBP-114-0.05 | N/A | Mass-Labelled PCB Solution |
| PCB-ST-A | M/C | Native PCB Stock Solution |
| PCB-ST-A10 | M/C | Native PCB Stock Solution |
| PCB-ST-A2 | M/C | Native PCB Stock Solution |
| BP-CP81 | M/C | Native Coplanar PCB Solution/Mixture |
| BP-MX-C1 | M/C | Solution/Mixture of Native PCBs |
| BP-WD | M/C | Native PCB Window Defining Solution/Mixture for DB-5 |
| BP-MO | M/C | Solution/Mixture of Native Mono-ortho PCBs |
| BP-MS | M/C | Native PCB Solution/Mixture for MS Detection |
| BP-MS2 | M/C | Native PCB Solution/Mixture for MS Detection |
| BP-MS3 | M/C | Native PCB Solution/Mixture for MS Detection |
| BP-MS-PL1 | M/C | Native PCB Solution/Mixture for MS Detection |
| BP-MS-PL2 | M/C | Native PCB Solution/Mixture for MS Detection |
| BP-MS-PL3 | M/C | Native PCB Solution/Mixture for MS Detection |
| BFR-CVS | M/C | PBDE/BFR Calibration Kit |
| BFR-LCS | M/C | Labelled Compound Solution |
| BFR-ISS | M/C | Internal/Injection Standards |
| BFR-SCS | M/C | Sampling/Cleanup Standard |
| BFR-PAR | M/C | Native Compounds StockSolution |
| BFR-LCS-STK | M/C | Labelled Compound Stock Solution |
| BFR-ISS-STK | M/C | Internal/Injection Standard Stock Solution |
| BDE-CVS-E | M/C | BDE-CVS-E Calibration Kit |
| MBDE-MXE | M/C | Mass-Labelled PBDE Solution/Mixture |
| BDE-MXE | M/C | Native PBDE Solution/Mixture |
| BDE-CVS-EISS | N/A | Mass-Labelled PBDE Internal Standard Solution |
| MBDE-MXE-STK | M/C | Mass-Labelled PBDE Solution/Mixture Stock Solution |
| BDE-CVS-EISS-STK | N/A | Mass-Labelled PBDE Internal Standard Stock Solution |
| BDE-CVS-F | M/C | BDE-CVS-F Calibration Kit |
| MBDE-MXFS | M/C | Mass-Labelled PBDE Surrogate Stock |
| MBDE-MXFR | M/C | Mass-Labelled PBDE Recovery Stock |
| BDE-MXF | M/C | Native PBDE Stock |
| BDE-CVS-G | M/C | BDE-CVS-G Calibration Kit |
| MBDE-MXG | M/C | Mass-Labelled PBDE Solution/Mixture |
| MBDE-ISS-G | M/C | Mass-Labelled PBDE Internal Standard Solution |
| MBDE-MXG-STK | M/C | Mass-Labelled PBDE Stock Solution/Mixture |
| MBDE-ISS-G-STK | M/C | Mass-Labelled PBDE Internal Standard Stock Solution |
| BDE-1 | 7025-06-1 | 2-Bromodiphenyl ether |
| BDE-2 | 6876-00-2 | 3-Bromodiphenyl ether |
| BDE-3 | 101-55-3 | 4-Bromodiphenyl ether |
| BDE-7 | 171977-44-9 | 2,4-Dibromodiphenyl ether |
| BDE-10 | 51930-04-2 | 2,6-Dibromodiphenyl ether |
| BDE-15 | 2050-47-7 | 4,4′-Dibromodiphenyl ether |
| BDE-17 | 147217-75-2 | 2,2′,4-Tribromodiphenyl ether |
| BDE-21 | 337513-67-4 | 2,3,4-Tribromodiphenyl ether |
| BDE-28 | 41318-75-6 | 2,4,4′-Tribromodiphenyl ether |
| BDE-30 | 155999-95-4 | 2,4,6-Tribromodiphenyl ether |
| BDE-37 | 147217-81-0 | 3,4,4′-Tribromodiphenyl ether |
| BDE-47 | 5436-43-1 | 2,2′,4,4′-Tetrabromodiphenyl ether |
| BDE-49 | 243982-82-3 | 2,2′,4,5′-Tetrabromodiphenyl ether |
| BDE-54 | N/A | 2,2′,6,6′-Tetrabromodiphenyl ether |
| BDE-60 | 446254-31-5 | 2,3,4,4′-Tetrabromodiphenyl ether |
| BDE-66 | 189084-61-5 | 2,3′,4,4′-Tetrabromodiphenyl ether |
| BDE-71 | 189084-62-6 | 2,3′,4′,6-Tetrabromodiphenyl ether |
| BDE-77 | 93703-48-1 | 3,3′,4,4′-Tetrabromodiphenyl ether |
| BDE-82 | N/A | 2,2′,3,3′,4-Pentabromodiphenyl ether |
| BDE-85 | 182346-21-0 | 2,2′,3,4,4′-Pentabromodiphenyl ether |
| BDE-99 | 60348-60-9 | 2,2′,4,4′,5-Pentabromodiphenyl ether |
| BDE-100 | 189084-64-8 | 2,2′,4,4′,6-Pentabromodiphenyl ether |
| BDE-104 | 446254-68-8 | 2,2′,4,6,6′-Pentabromodiphenyl ether |
| BDE-105 | 373594-78-6 | 2,3,3′,4,4′-Pentabromodiphenyl ether |
| BDE-119 | 189084-66-0 | 2,3′,4,4′,6-Pentabromodiphenyl ether |
| BDE-126 | 366791-32-4 | 3,3′,4,4′,5-Pentabromodiphenyl ether |
| BDE-128 | N/A | 2,2′,3,3′,4,4′-Hexabromodiphenyl ether |
| BDE-138 | 182677-30-1 | 2,2′,3,4,4′,5′-Hexabromodiphenyl ether |
| BDE-139 | 446254-96-2 | 2,2′,3,4,4′,6-Hexabromodiphenyl ether |
| BDE-140 | 243982-83-4 | 2,2′,3,4,4′,6′-Hexabromodiphenyl ether |
| BDE-149 | N/A | 2,2′,3,4′,5′,6-Hexabromodiphenyl ether |
| BDE-153 | 68631-49-2 | 2,2′,4,4′,5,5′-Hexabromodiphenyl ether |
| BDE-154 | 207122-15-4 | 2,2′,4,4′,5,6′-Hexabromodiphenyl ether |
| BDE-155 | 35854-94-5 | 2,2′,4,4′,6,6′-Hexabromodiphenyl ether |
| BDE-156 | N/A | 2,3,3′,4,4′,5-Hexabromodiphenyl ether |
| BDE-169 | N/A | 3,3′,4,4′,5,5′-Hexabromodiphenyl ether |
| BDE-170 | 327185-13-7 | 2,2′,3,3′,4,4′,5-Heptabromodiphenyl ether |
| BDE-171 | N/A | 2,2′,3,3′,4,4′,6-Heptabromodiphenyl ether |
| BDE-175 | 446255-22-7 | 2,2′,3,3′,4,5′,6-Heptabromodiphenyl ether |
| BDE-176 | N/A | 2,2′,3,3′,4,6,6′-Heptabromodiphenyl ether |
| BDE-177 | N/A | 2,2′,3,3′,4′,5,6-Heptabromodiphenyl ether |
| BDE-179 | N/A | 2,2′,3,3′,5,6,6′-Heptabromodiphenyl ether |
| BDE-180 | N/A | 2,2′,3,4,4′,5,5′-Heptabromodiphenyl ether |
| BDE-181 | 189084-67-1 | 2,2′,3,4,4′,5,6-Heptabromodiphenyl ether |
| BDE-182 | N/A | 2,2′,3,4,4′,5,6′-Heptabromodiphenyl ether |
| BDE-183 | 207122-16-5 | 2,2′,3,4,4′,5′,6-Heptabromodiphenyl ether |
| BDE-184 | 117948-63-7 | 2,2′,3,4,4′,6,6′-Heptabromodiphenyl ether |
| BDE-188 | N/A | 2,2′,3,4′,5,6,6′-Heptabromodiphenyl ether |
| BDE-189 | N/A | 2,3,3′,4,4′,5,5′-Heptabromodiphenyl ether |
| BDE-191 | 446255-30-7 | 2,3,3′,4,4′,5′,6-Heptabromodiphenyl ether |
| BDE-194 | 85446-17-9 | 2,2′,3,3′,4,4′,5,5′-Octabromodiphenyl ether |
| BDE-195 | 446255-38-5 | 2,2′,3,3′,4,4′,5,6-Octabromodiphenyl ether |
| BDE-196 | N/A | 2,2′,3,3′,4,4′,5,6′-Octabromodiphenyl ether |
| BDE-197 | 117964-21-3 | 2,2′,3,3′,4,4′,6,6′-Octabromodiphenyl ether |
| BDE-198 | N/A | 2,2′,3,3′,4,5,5′,6-Octabromodiphenyl ether |
| BDE-199 | N/A | 2,2′,3,3′,4,5,5′,6′-Octabromodiphenyl ether |
| BDE-200 | N/A | 2,2′,3,3′,4,5,6,6′-Octabromodiphenyl ether |
| BDE-201 | 446255-50-1 | 2,2′,3,3′,4,5′,6,6′-Octabromodiphenyl ether |
| BDE-202 | 67797-09-5 | 2,2′,3,3′,5,5′,6,6′-Octabromodiphenyl ether |
| BDE-203 | 337513-72-1 | 2,2′,3,4,4′,5,5′,6-Octabromodiphenyl ether |
| BDE-204 | 446255-54-5 | 2,2′,3,4,4′,5,6,6′-Octabromodiphenyl ether |
| BDE-205 | 446255-56-7 | 2,3,3′,4,4′,5,5′,6-Octabromodiphenyl ether |
| BDE-206 | 63387-28-0 | 2,2′,3,3′,4,4′,5,5′,6-Nonabromodiphenyl ether |
| BDE-207 | 437701-79-6 | 2,2′,3,3′,4,4′,5,6,6′-Nonabromodiphenyl ether |
| BDE-208 | 437701-78-5 | 2,2′,3,3′,4,5,5′,6,6′-Nonabromodiphenyl ether |
| BDE-209 | 1163-19-5 | Decabromodiphenyl ether |
| 4PC-BDE-208 | N/A | 2,2′,3,3′,4,5,5′,6,6′-Nonabromo-4′-chlorodiphenyl ether |
| BDE-WD | M/C | PBDE Window Defining Solution/Mixture for DB-5HT |
| BDE-OND | M/C | Solution/Mixture of Octa-, Nona-, and Deca-BDEs |
| BDE-MXA | M/C | Native PBDE Solution/Mixture |
| BDE-MXB | M/C | Native PBDE Solution/Mixture |
| BDE-MXD | M/C | Native PBDE Solution/Mixture |
| MBDE-3 | N/A | 4-Bromo[13C12]diphenyl ether |
| MBDE-15 | N/A | 4,4′-Dibromo[13C12]diphenyl ether |
| MBDE-28 | N/A | 2,4,4′-Tribromo[13C12]diphenyl ether |
| MBDE-47 | N/A | 2,2′,4,4′-Tetrabromo[13C12]diphenyl ether |
| MBDE-77 | N/A | 3,3′,4,4′-Tetrabromo[13C12]diphenyl ether |
| MBDE-79 | N/A | 3,3′,4,5′-Tetrabromo[13C12]diphenyl ether |
| MBDE-99 | N/A | 2,2′,4,4′,5-Pentabromo[13C12]diphenyl ether |
| MBDE-100 | N/A | 2,2′,4,4′,6-Pentabromo[13C12]diphenyl ether |
| MBDE-126 | N/A | 3,3′,4,4′,5-Pentabromo[13C12]diphenyl ether |
| MBDE-138 | N/A | 2,2′,3,4,4′,5′-Hexabromo[13C12]diphenyl ether |
| MBDE-139 | N/A | 2,2′,3,4,4′,6-Hexabromo[13C12]diphenyl ether |
| MBDE-153 | N/A | 2,2′,4,4′,5,5′-Hexabromo[13C12]diphenyl ether |
| MBDE-154 | N/A | 2,2′,4,4′,5,6′-Hexabromo[13C12]diphenyl ether |
| MBDE-169 | N/A | 3,3′,4,4′,5,5′-Hexabromo[13C12]diphenyl ether |
| MBDE-180 | N/A | 2,2′,3,4,4′,5,5′-Heptabromo[13C12]diphenyl ether |
| MBDE-183 | N/A | 2,2′,3,4,4′,5′,6-Heptabromo[13C12]diphenyl ether |
| MBDE-197 | N/A | 2,2′,3,3′,4,4′,6,6′-Octabromo[13C12]diphenyl ether |
| MBDE-205 | N/A | 2,3,3′,4,4′,5,5′,6-Octabromo[13C12]diphenyl ether |
| MBDE-206 | N/A | 2,2′,3,3′,4,4′,5,5′,6-Nonabromo[13C12]diphenyl ether |
| MBDE-207 | N/A | 2,2′,3,3′,4,4′,5,6,6′-Nonabromo[13C12]diphenyl ether |
| MBDE-209 | N/A | Decabromo[13C12]diphenyl ether |
| MBDE-MXA | M/C | Mass-Labelled PBDE Solution/Mixture |
| MBDE-MXB | M/C | Mass-Labelled PBDE Solution/Mixture |
| MBDE-MXC | M/C | Mass-Labelled PBDE Solution/Mixture |
| TBDE-71 | 32534-81-9 | Great Lakes Chemical DE-71Ôäó Pentabromodiphenyl Oxide |
| TBDE-79 | 32536-52-0 | Great Lakes Chemical DE-79Ôäó Octabromodiphenyl Oxide |
| TBDE-83R | 1163-19-5 | Great Lakes Chemical DE-83Ôäó Decabromodiphenyl Oxide |
| 5MBDE47 | N/A | 2,2′,4,4′-Tetrabromo-5-methoxydiphenyl ether |
| 6MBDE47 | N/A | 2,2′,4,4′-Tetrabromo-6-methoxydiphenyl ether |
| 4PMBDE49 | N/A | 2,2′,4′,5-Tetrabromo-4-methoxydiphenyl ether |
| 2PMBDE68 | N/A | 2′,3,4′,5-Tetrabromo-2-methoxydiphenyl ether |
| 5PMBDE99 | N/A | 2,2′,4,4′,5-Pentabromo-5′-methoxydiphenyl ether |
| 5PMBDE100 | N/A | 2,2′,4,4′,6′-Pentabromo-5-methoxydiphenyl ether |
| 4PMBDE101 | N/A | 2,2′,4,5,5′-Pentabromo-4′-methoxydiphenyl ether |
| 4PMBDE103 | N/A | 2,2′,4′,5,6′-Pentabromo-4-methoxydiphenyl ether |
| MeOBDES | M/C | Methoxy-Bromodiphenyl Ethers Solution/Mixture |
| M6MBDE47 | N/A | 2,2′,4,4′-Tetrabromo-6-methoxy[13C12]diphenyl ether |
| M6PMBDE100 | N/A | 2,2′,4,4′,6-Pentabromo-6′-methoxy[13C12]diphenyl ether |
| M6HBDE47 | N/A | 2,2′,4,4′-Tetrabromo-6-hydroxy[13C12]diphenyl ether |
| M6PHBDE100 | N/A | 2,2′,4,4′,6-Pentabromo-6′-hydroxy[13C12]diphenyl ether |
| aHBCD | 134237-50-6 | alpha-1,2,5,6,9,10-Hexabromocyclododecane |
| bHBCD | 134237-51-7 | beta-1,2,5,6,9,10-Hexabromocyclododecane |
| gHBCD | 134237-52-8 | gamma-1,2,5,6,9,10-Hexabromocyclododecane |
| dHBCD | 3194-55-6 | delta-1,2,5,6,9,10-Hexabromocyclododecane |
| eHBCD | 3194-55-6 | epsilon-1,2,5,6,9,10-Hexabromocyclododecane |
| zHBCD | 3194-55-6 | zeta-1,2,5,6,9,10-Hexabromocyclododecane |
| etaHBCD | 3194-55-6 | eta-1,2,5,6,9,10-Hexabromocyclododecane |
| tHBCD | 3194-55-6 | theta-1,2,5,6,9,10-Hexabromocyclododecane |
| iHBCD | 3194-55-6 | iota-1,2,5,6,9,10-Hexabromocyclododecane |
| kHBCD | 3194-55-6 | kappa-1,2,5,6,9,10-Hexabromocyclododecane |
| MaHBCD | N/A | alpha-1,2,5,6,9,10-Hexabromo[13C12]cyclododecane |
| MbHBCD | N/A | beta-1,2,5,6,9,10-Hexabromo[13C12]cyclododecane |
| MgHBCD | N/A | gamma-1,2,5,6,9,10-Hexabromo[13C12]cyclododecane |
| DaHBCD | N/A | d18-alpha-1,2,5,6,9,10-Hexabromocyclododecane |
| DbHBCD | N/A | d18-beta-1,2,5,6,9,10-Hexabromocyclododecane |
| DgHBCD | N/A | d18-gamma-1,2,5,6,9,10-Hexabromocyclododecane |
| HBCD-MXA | M/C | Native HBCD Mixture |
| HBCD-MXB | M/C | Native HBCD Mixture |
| MHBCD-MXA | M/C | 13C-Labelled HBCD Mixture |
| PBCD | N/A | rac-(1,5R,6S,9S,10R)-pentabromocyclododecene |
| TBBPA | 79-94-7 | 3,3′,5,5′-Tetrabromobisphenol-A |
| MTBBPA | N/A | 3,3′,5,5′-Tetrabromobisphenol-A [rings; 13C12] |
| DBDPE | 84852-53-9 | 1,2-Bis(pentabromophenyl)ethane |
| MDBDPE | N/A | 1,2-Bis(pentabromophenyl)ethane [13C14] |
| BTBPE | 37853-59-1 | 1,2-Bis(2,4,6-tribromophenoxy)ethane |
| MBTBPE | N/A | 1,2-Bis(2,4,6-tribromo[13C6]phenoxy)ethane |
| HBBZ | 87-82-1 | Hexabromobenzene |
| MHBBZ | N/A | Hexabromo[13C6]benzene |
| PBBZ | 608-90-2 | Pentabromobenzene |
| MPBBZ | N/A | Pentabromo[13C6]benzene |
| PBEB | 85-22-3 | Pentabromoethylbenzene |
| PBT | 87-83-2 | Pentabromotoluene |
| pTBX | 23488-38-2 | 2,3,5,6-Tetrabromo-p-xylene |
| aTBCO | 3194-57-8 | (1R,2R,5S,6S)-1,2,5,6-Tetrabromocyclooctane |
| bTBCO | 3194-57-8 | rac-(1R,2R,5R,6R)-1,2,5,6-Tetrabromocyclooctane |
| bTBECH | 3322-93-8 | rac-(1R,2R)-1,2-dibromo-(4S)-4-((1S)-1,2-dibromoethyl)cyclohexane |
| gTBECH | 3322-93-8 | rac-(1R,2R)-1,2-dibromo-(4R)-4-((1R)-1,2-dibromoethyl)cyclohexane |
| abTBECH | 3322-93-8 | TBECH Isomeric Solution/Mixture |
| gdTBECH | 3322-93-8 | TBECH Isomeric Solution/Mixture |
| OBIND | 155613-93-7 | 4,5,6,7-Tetrabromo-1,1,3-trimethyl-3-(2,3,4,5-tetrabromophenyl)-indane |
| BEHTBP | 26040-51-7 | Bis(2-ethyl-1-hexyl)tetrabromophthalate |
| MBEHTBP | N/A | Bis(2-Ethylhexyl-d17)-tetrabromo[13C6]phthalate |
| EHTBB | 183658-27-7 | 2-Ethylhexyl-2,3,4,5-tetrabromobenzoate |
| MEHTBB | N/A | 2-Ethylhexyl-d17-2,3,4,5-tetrabromo[13C6]benzoate |
| HCDBCO | 51936-55-1 | Hexachlorocyclopentenyl-dibromocyclooctane |
| TBCT | 39569-21-6 | Tetrabromo-o-chlorotoluene |
| PBBA | 59447-55-1 | Pentabromobenzyl acrylate |
| ATE | 3278-89-5 | Allyl 2,4,6-tribromophenyl ether |
| DPTE | 35109-60-5 | 2,3-Dibromopropyl 2,4,6-tribromophenyl ether |
| BATE | N/A | 2-Bromoallyl 2,4,6-tribromophenyl ether |
| s-DP | 135821-03-3 | syn-Dechlorane Plus |
| a-DP | 135821-74-8 | anti-Dechlorane Plus |
| aCl10DP | N/A | Cl10 Dechlorane Plus |
| aCl11DP | N/A | Cl11 Dechlorane Plus |
| DPMA(1,5-DPMA) | 135821-04-4 | Dechlorane Plus Mono adduct |
| 1,3-DPMA | N/A | 1,3-Dechlorane Plus Mono adduct |
| DBCD | 18300-04-4 | Dibromochlordene |
| Dec-601 | 13560-90-2 | Dechlorane 601 |
| Dec-602 | 31107-44-5 | Dechlorane 602 |
| Dec-603 | 13560-92-4 | Dechlorane 603 |
| Dec-604 | 34571-16-9 | Dechlorane 604 |
| Dec-604CB | 56890-89-2 | Dechlorane 604 Component B |
| CPlus | N/A | Chlordene Plus |
| DBALD | N/A | Dibromoaldrin |
| HCPN | N/A | Hexachloro(phenyl)norbornene |
| T23BPIC | 52434-90-9 | Tris(2,3-dibromopropyl)isocyanurate |
| TBBA | 27581-13-1 | 2,3,4,5-Tetrabromobenzoic acid |
| MeTBBA | N/A | Methyl-2,3,4,5-tetrabromobenzoate |
| MTBBA | N/A | 2,3,4,5-Tetrabromobenzoic acid [13C6-ring] |
| TBPAn | 632-79-1 | Tetrabromophthalic anhydride |
| MTBPAn | N/A | Tetrabromo[13C6]phthalic anhydride |
| BDCP | 72236-72-7 | Bis(1,3-dichloro-2-propyl)phosphate (97%) |
| TPP | 115-86-6 | Triphenyl phosphate |
| TOTP | 78-30-8 | Tri-o-tolyl phosphate |
| TMTP | 563-04-2 | Tri-m-tolyl phosphate (97%) |
| TPTP | 78-32-0 | Tri-p-tolyl phosphate |
| B2tBPPP | 65652-41-7 | Bis(2-tert-butylphenyl) phenyl phosphate |
| B4tBPPP | 115-87-7 | Bis(4-tert-butylphenyl) phenyl phosphate |
| 2tBPDPP | N/A | 2-tert-Butylphenyl diphenyl phosphate |
| 4tBPDPP | 981-40-8 | 4-tert-Butylphenyl diphenyl phosphate |
| T4tBPP | 78-33-1 | Tris(4-tert-butylphenyl) phosphate |
| T2IPPP | 64532-95-2 | Tris(2-isopropylphenyl) phosphate |
| T3IPPP | 72668-27-0 | Tris(3-isopropylphenyl) phosphate |
| T4IPPP | 2502-15-0 | Tris(4-isopropylphenyl) phosphate |
| T34DMPP | 3862-11-1 | Tris(3,4-dimethylphenyl) phosphate |
| T35DMPP | 25653-16-1 | Tris(3,5-dimethylphenyl) phosphate |
| B24DIPPPP | N/A | Bis(2,4-diisopropylphenyl) phenyl phosphate |
| B2IPPPP | 69500-29-4 | Bis(2-isopropylphenyl) phenyl phosphate |
| B4IPPPP | N/A | Bis(4-isopropylphenyl) phenyl phosphate |
| 2IPPDPP | 64532-94-1 | 2-Isopropylphenyl diphenyl phosphate |
| 4IPPDPP | 55864-04-5 | 4-Isopropylphenyl diphenyl phosphate |
| 24DIPPDPP | N/A | 2,4-Diisopropylphenyl diphenyl phosphate |
| MTPP | N/A | 13C18-Triphenyl phosphate |
| TEP | 78-40-0 | Tri-ethyl phosphate |
| TPrP | 513-08-6 | Tri-n-propyl phosphate |
| TBP | 126-73-8 | Tri-n-butyl phosphate |
| TBEP | 78-51-3 | Tris(2-butoxyethyl) phosphate |
| TDBPP | 126-72-7 | Tris(2,3-dibromopropyl) phosphate |
| EHDP | 1241-94-7 | 2-Ethylhexyl diphenyl phosphate |
| TEHP | 78-42-2 | Tris(2-ethylhexyl) phosphate |
| TCEP | 115-96-8 | Tris(2-chloroethyl) phosphate |
| TCPP | 13674-84-5 | Tris[(2R)-1-chloro-2-propyl] phosphate |
| TDCPP | 13674-87-8 | Tris(1,3-dichloro-2-propyl) phosphate |
| M6TBEP | N/A | Tris(2-butoxy-[13C2]-ethyl) phosphate |
| dTEP | 135942-11-9 | Tri-ethyl phosphate-d15 |
| dTPrP | 1219794-92-9 | Tri-n-propyl phosphate-d21 |
| dTBP | 61196-26-7 | Tri-n-butyl phophate-d27 |
| dTPP | 1173020-30-8 | Triphenyl phosphate-d15 |
| dTCEP | 1276500-47-0 | Tris(2-chloroethyl) phosphate-d12 |
| dTDCPP | 1447569-77-8 | Tris(1,3-dichloro-2-propyl) phophate-d15 |
| dBDCP | N/A | Bis(1,3-dichloro-2-propyl) phosphate-d10 |
| BB-1 | 2052-07-5 | 2-Bromobiphenyl |
| BB-2 | 2113-57-7 | 3-Bromobiphenyl |
| BB-3 | 92-66-0 | 4-Bromobiphenyl |
| BB-4 | 13029-09-9 | 2,2′-Dibromobiphenyl |
| BB-7 | 53592-10-2 | 2,4-Dibromobiphenyl |
| BB-9 | 57422-77-2 | 2,5-Dibromobiphenyl |
| BB-10 | 59080-32-9 | 2,6-Dibromobiphenyl |
| BB-15 | 92-86-4 | 4,4′-Dibromobiphenyl |
| BB-18 | 59080-34-1 | 2,2′,5-Tribromobiphenyl |
| BB-22 | N/A | 2,3,4′-Tribromobiphenyl |
| BB-26 | 59080-35-2 | 2,3′,5-Tribromobiphenyl |
| BB-29 | 115245-07-3 | 2,4,5-Tribromobiphenyl |
| BB-30 | 59080-33-0 | 2,4,6-Tribromobiphenyl |
| BB-31 | 59080-36-3 | 2,4′,5-Tribromobiphenyl |
| BB-37 | 6683-35-8 | 3,4,4′-Tribromobiphenyl |
| BB-38 | 115245-08-4 | 3,4,5-Tribromobiphenyl |
| BB-49 | 60044-24-8 | 2,2′,4,5′-Tetrabromobiphenyl |
| BB-52 | 59080-37-4 | 2,2′,5,5′-Tetrabromobiphenyl |
| BB-53 | 60044-25-9 | 2,2′,5,6′-Tetrabromobiphenyl |
| BB-56 | N/A | 2,3,3′,4′-Tetrabromobiphenyl |
| BB-75 | 64258-02-2 | 2,4,4′,6-Tetrabromobiphenyl |
| BB-77 | 77102-82-0 | 3,3′,4,4′-Tetrabromobiphenyl |
| BB-80 | 16400-50-3 | 3,3′,5,5′-Tetrabromobiphenyl |
| BB-101 | 67888-96-4 | 2,2′,4,5,5′-Pentabromobiphenyl |
| BB-103 | 59080-39-6 | 2,2′,4,5′,6-Pentabromobiphenyl |
| BB-153 | 59080-40-9 | 2,2′,4,4′,5,5′-Hexabromobiphenyl |
| BB-154 | 36402-15-0 | 2,2′,4,4′,5,6′-Hexabromobiphenyl |
| BB-155 | 59261-08-4 | 2,2′,4,4′,6,6′-Hexabromobiphenyl |
| BB-156 | 77607-09-1 | 2,3,3′,4,4′,5-Hexabromobiphenyl |
| BB-169 | 60044-26-0 | 3,3′,4,4′,5,5′-Hexabromobiphenyl |
| BB-180 | 67733-52-2 | 2,2′,3,4,4′,5,5′-Heptabromobiphenyl |
| BB-194 | 67889-00-3 | 2,2′,3,3′,4,4′,5,5′-Octabromobiphenyl |
| BB-205 | N/A | 2,3,3′,4,4′,5,5′,6-Octabromobiphenyl |
| BB-206 | 69278-62-2 | 2,2′,3,3′,4,4′,5,5′,6-Nonabromobiphenyl |
| BB-209 | 13654-09-6 | Decabromobiphenyl |
| PBB-MXA | M/C | Native PBB Solution/Mixture |
| TBB-BP6 | 59536-65-1 | Great Lakes Chemical Firemaster BP-6 Hexabromobiphenyl |
| TBB-809D | 27753-52-2 | Chemische Fabrik Kalk Bromkal80-9D Nonabromobiphenyl |
| MBB-52 | N/A | 2,2′,5,5′-Tetrabromo[13C12]biphenyl |
| MBB-153 | N/A | 2,2′,4,4′,5,5′-Hexabromo[13C12]biphenyl |
| MBB-194 | N/A | 2,2′,3,3′,4,4′,5,5′-Octabromo[13C12]biphenyl |
| MBB-209 | N/A | Decabromo[13C12]biphenyl |
| MBB-MXA | M/C | Mass-Labelled PBB Solution/Mixture |
| BDD-1 | 105908-71-2 | 1-Bromodibenzo-p-dioxin |
| BDD-27/28 | 39073-07-9; 105836-96-2 |
2,7/2,8-Dibromodibenzo-p-dioxin mix |
| BDD-237 | 51974-40-4 | 2,3,7-Tribromodibenzo-p-dioxin |
| BDD-1234 | 104549-41-9 | 1,2,3,4-Tetrabromodibenzo-p-dioxin |
| BDD-1378 | 109333-31-5 | 1,3,7,8-Tetrabromodibenzo-p-dioxin |
| BDD-2378 | 50585-41-6 | 2,3,7,8-Tetrabromodibenzo-p-dioxin |
| BDD-12378 | 109333-34-8 | 1,2,3,7,8-Pentabromodibenzo-p-dioxin |
| BDD-12478 | 109333-35-9 | 1,2,4,7,8-Pentabromodibenzo-p-dioxin |
| BDD-1234678 | 110999-47-8 | 1,2,3,4,6,7,8-Heptabromodibenzo-p-dioxin |
| BDD-12346789 | 2170-45-8 | Octabromodibenzo-p-dioxin |
| MBDD-2378 | N/A | 2,3,7,8-Tetrabromo[13C12]dibenzo-p-dioxin |
| BDF-4 | 89827-45-2 | 4-Bromodibenzofuran |
| BDF-24 | N/A | 2,4-Dibromodibenzofuran |
| BDF-28 | 10016-52-1 | 2,8-Dibromodibenzofuran |
| BDF-138 | N/A | 1,3,8-Tribromodibenzofuran |
| BDF-234 | N/A | 2,3,4-Tribromodibenzofuran |
| BDF-238 | 84761-82-0 | 2,3,8-Tribromodibenzofuran |
| BDF-247 | N/A | 2,4,7-Tribromodibenzofuran |
| BDF-1278 | 84761-80-8 | 1,2,7,8-Tetrabromodibenzofuran |
| BDF-2378 | 67733-57-7 | 2,3,7,8-Tetrabromodibenzofuran |
| BDF-12378 | 107555-93-1 | 1,2,3,7,8-Pentabromodibenzofuran |
| BDF-23478 | 131166-92-2 | 2,3,4,7,8-Pentabromodibenzofuran |
| BDF-1234678 | 107555-95-3 | 1,2,3,4,6,7,8-Heptabromodibenzofuran |
| BDF-12346789 | 103582-29-2 | Octabromodibenzofuran (96%) |
| 7-B-23-CDD | 97741-74-7 | 7-Bromo-2,3-dichlorodibenzo-p-dioxin(96%) |
| 2-B-378-CDD | 109333-33-7 | 2-Bromo-3,7,8-trichlorodibenzo-p-dioxin(96%) |
| 2-B-1378-CDD | 131167-13-0 | 2-Bromo-1,3,7,8-tetrachlorodibenzo-p-dioxin(96%) |
| 23-B-78-CDD | 50585-40-5 | 2,3-Dibromo-7,8-dichlorodibenzo-p-dioxin |
| M23-B-78-CDD | N/A | 2,3-Dibromo-7,8-dichloro[13C12]dibenzo-p-dioxin |
| 8-B-23-CDF | 103124-75-0 | 8-Bromo-2,3-dichlorodibenzofuran |
| 3-B-278-CDF | 131166-87-5 | 3-Bromo-2,7,8-trichlorodibenzofuran |
| 8-B-234-CDF | 103124-72-7 | 8-Bromo-2,3,4-trichlorodibenzofuran |
| 4-B-2378-CDF | 115656-08-1 | 4-Bromo-2,3,7,8-tetrachlorodibenzofuran |
| 12-B-78-CDF | N/A | 1,2-Dibromo-7,8-dichlorodibenzofuran |
| 23-B-78-CDF | N/A | 2,3-Dibromo-7,8-dichlorodibenzofuran |
| 13-B-278-CDF | N/A | 1,3-Dibromo-2,7,8-trichlorodibenzofuran |
| M8-B-23-CDF | N/A | 8-Bromo-2,3-dichloro[13C12]dibenzofuran |
| M3-B-278-CDF | N/A | 3-Bromo-2,7,8-trichloro[13C12]dibenzofuran |
| M4-B-2378-CDF | N/A | 4-Bromo-2,3,7,8-tetrachloro[13C12]dibenzofuran |
| M23-B-78-CDF | N/A | 2,3-Dibromo-7,8-dichloro[13C12]dibenzofuran |
| M13-B-278-CDF | N/A | 1,3-Dibromo-2,7,8-trichloro[13C12]dibenzofuran |
| BRP-2 | 95-56-7 | 2-Bromophenol |
| BRP-3 | 591-20-8 | 3-Bromophenol |
| BRP-4 | 106-41-2 | 4-Bromophenol |
| BRP-23 | 57383-80-9 | 2,3-Dibromophenol |
| BRP-24 | 615-58-7 | 2,4-Dibromophenol |
| BRP-25 | 28165-52-8 | 2,5-Dibromophenol |
| BRP-26 | 608-33-3 | 2,6-Dibromophenol |
| BRP-34 | 615-56-5 | 3,4-Dibromophenol |
| BRP-35 | 626-41-5 | 3,5-Dibromophenol |
| BRP-234 | 30143-13-6 | 2,3,4-Tribromophenol |
| BRP-235 | N/A | 2,3,5-Tribromophenol |
| BRP-236 | 28165-57-3 | 2,3,6-Tribromophenol |
| BRP-245 | 14401-61-7 | 2,4,5-Tribromophenol |
| BRP-246 | 118-79-6 | 2,4,6-Tribromophenol |
| BRP-345 | N/A | 3,4,5-Tribromophenol |
| BRP-2345 | N/A | 2,3,4,5-Tetrabromophenol |
| BRP-2346 | 14400-94-3 | 2,3,4,6-Tetrabromophenol |
| BRP-2356 | N/A | 2,3,5,6-Tetrabromophenol |
| BRP-23456 | 608-71-9 | Pentabromophenol |
| BRPS | M/C | Native Bromophenol Solution/Mixture |
| MBRP-4 | N/A | 4-Bromo[13C6]phenol |
| MBRP-24 | N/A | 2,4-Dibromo[13C6]phenol |
| MBRP-35 | N/A | 3,5-Dibromo[13C6]phenol |
| MBRP-246 | N/A | 2,4,6-Tribromo[13C6]phenol |
| MBRP-2346 | N/A | 2,3,4,6-Tetrabromo[13C6]phenol |
| MBRP-23456 | N/A | Pentabromo[13C6]phenol |
| MBRPS | M/C | Mass-Labelled Bromophenol Solution/Mixture |
| PFC-CVS-C | M/C | PFC-CVS-C Calibration Kit |
| MPFAC-C-ES | M/C | Mass-Labelled PFC Extraction Standards Solution |
| MPFAC-C-IS | M/C | Mass-Labelled PFC Injection Standards Solution |
| PFAC-MXC | M/C | Native PFC Stock Solution |
| L-PFPrS | N/A | Sodium perfluoro-1-propanesulfonate |
| L-PFBS | 29420-49-3 | Potassium perfluoro-1-butanesulfonate |
| L-PFPeS | N/A | Sodium perfluoro-1-pentanesulfonate |
| L-PFHxS | 82382-12-5 | Sodium perfluoro-1-hexanesulfonate |
| br-PFHxSK | M/C | L-PFHxS with branched isomers (Potassium Salt) |
| L-PFHpS | N/A | Sodium perfluoro-1-heptanesulfonate |
| NaP3MHpS | N/A | Sodium perfluoro-3-methylheptanesulfonate |
| NaP6MHpS | N/A | Sodium perfluoro-6-methylheptanesulfonate |
| L-PFOS | 4021-47-0 | Sodium perfluoro-1-octanesulfonate |
| L-PFOSK | 2795-39-3 | Potassium perfluoro-1-octanesulfonate |
| br-PFOSK | M/C | L-PFOSK with branched isomers |
| T-PFOS | N/A | Potassium perfluorooctanesulfonate (Technical Grade) |
| 8Cl-PFOS | N/A | Sodium 8-chloroperfluoro-1-octanesulfonate |
| L-PFNS | 98789-57-2 | Sodium perfluoro-1-nonanesulfonate |
| ipPFNS | N/A | Sodium perfluoro-7-methyloctanesulfonate |
| L-PFDS | 2806-15-7 | Sodium perfluoro-1-decanesulfonate |
| L-PFDoS | N/A | Sodium perfluoro-1-dodecanesulfonate |
| M3PFBS | N/A | Sodium perfluoro-1-[2,3,4-13C3]butanesulfonate |
| MPFHxS | N/A | Sodium perfluoro-1-hexane[18O2]sulfonate |
| M3PFHxS | N/A | Sodium perfluoro-1-[1,2,3-13C3]hexanesulfonate |
| MPFOS | N/A | Sodium perfluoro-1-[1,2,3,4-13C4]octanesulfonate |
| M8PFOS | N/A | Sodium perfluoro-[13C8]octanesulfonate |
| PFBA | 375-22-4 | Perfluoro-n-butanoic acid |
| PFPeA | 2706-90-3 | Perfluoro-n-pentanoic acid |
| PFHxA | 307-24-4 | Perfluoro-n-hexanoic acid |
| PFHpA | 375-85-9 | Perfluoro-n-heptanoic acid |
| PFOA | 335-67-1 | Perfluoro-n-octanoic acid |
| T-PFOA | 95328-99-7 | Technical Ammonium Perfluorooctanoate |
| P3MHpA | N/A | Perfluoro-3-methylheptanoic acid |
| PFNA | 375-95-1 | Perfluoro-n-nonanoic acid |
| P4MOA | N/A | Perfluoro-4-methyloctanoic acid |
| ipPFNA | N/A | Perfluoro-7-methyloctanoic acid (90%) |
| P355TMHxA | 238403-51-5 | Perfluoro-3,5,5-trimethylhexanoic acid |
| PFDA | 335-76-2 | Perfluoro-n-decanoic acid |
| P37DMOA | 172155-07-6 | Perfluoro-3,7-dimethyloctanoic acid |
| PFUdA | 2058-94-8 | Perfluoro-n-undecanoic acid |
| PFDoA | 307-55-1 | Perfluoro-n-dodecanoic acid |
| PFTrDA | 72629-94-8 | Perfluoro-n-tridecanoic acid |
| PFTeDA | 376-06-7 | Perfluoro-n-tetradecanoic acid |
| PFHxDA | 67905-19-5 | Perfluoro-n-hexadecanoic acid |
| PFODA | 16517-11-6 | Perfluoro-n-octadecanoic acid |
| M3PFBA | N/A | Perfluoro-n-[2,3,4-13C3]butanoic acid |
| MPFBA | N/A | Perfluoro-n-[1,2,3,4-13C4]butanoic acid |
| M3PFPeA | N/A | Perfluoro-n-[3,4,5-13C3]pentanoic acid |
| M5PFPeA | N/A | Perfluoro-n-[1,2,3,4,5-13C5]pentanoic acid |
| MPFHxA | N/A | Perfluoro-n-[1,2-13C2]hexanoic acid |
| M5PFHxA | N/A | Perfluoro-n-[1,2,3,4,6-13C5]hexanoic acid |
| M4PFHpA | N/A | Perfluoro-n-[1,2,3,4-13C4]heptanoic acid |
| M2PFOA | N/A | Perfluoro-n-[1,2-13C2]octanoic acid |
| MPFOA | N/A | Perfluoro-n-[1,2,3,4-13C4]octanoic acid |
| M8PFOA | N/A | Perfluoro-n-[13C8]octanoic acid |
| MPFNA | N/A | Perfluoro-n-[1,2,3,4,5-13C5]nonanoic acid |
| M9PFNA | N/A | Perfluoro-n-[13C9]nonanoic acid |
| MPFDA | N/A | Perfluoro-n-[1,2-13C2]decanoic acid |
| MPFDA-A | N/A | Perfluoro-n-[1,2-13C2]decanoic acid (in acetonitrile) |
| M6PFDA | N/A | Perfluoro-n-[1,2,3,4,5,6-13C6]decanoic acid |
| MPFUdA | N/A | Perfluoro-n-[1,2-13C2]undecanoic acid |
| M7PFUdA | N/A | Perfluoro-n-[1,2,3,4,5,6,7-13C7]undecanoic acid |
| MPFDoA | N/A | Perfluoro-n-[1,2-13C2]dodecanoic acid |
| M2PFTeDA | N/A | Perfluoro-n-[1,2-13C2]tetradecanoic acid |
| M2PFHxDA | N/A | Perfluoro-n-[1,2-13C2]hexadecanoic acid |
| PFC-MXA | M/C | Native PFCA Solution/Mixture |
| PFS-MXA | M/C | Native PFAS Solution/Mixture |
| PFAC-MXA | M/C | Native PFCAs and PFASs Solution/Mixture |
| PFAC-MXB | M/C | Native PFCAs and PFASs Solution/Mixture |
| PFAC-24PAR | M/C | Native PFAS Precision and Recovery Standard Solution (containing brPFHxS & brPFOS) |
| MPFAC-MXA | M/C | Mass-Labelled PFCAs and PFASs Solution/Mixture |
| EPA-537SS | M/C | U.S. EPA Method 537 Surrogate Primary Dilution Standard (SUR PDS) |
| EPA-537IS | M/C | U.S. EPA Method 537 Internal Standard Primary Dilution Standard (IS PDS) |
| MPFAC-24ES | M/C | Mass-Labelled PFAS Extraction Standard Solution |
| P1MHpS | N/A | Perfluoro-1-methylheptane sulfonate |
| P3MHpS | M/C | Perfluoro-3-methylheptane sulfonate; Perfluoro-3-methylheptanoic acid |
| P4MHpS | M/C | Perfluoro-4-methylheptane sulfonate; Perfluoro-4-methylheptanoic acid |
| P5MHpS | M/C | Perfluoro-5-methylheptane sulfonate; Perfluoro-5-methylheptanoic acid |
| P6MHpS | M/C | Perfluoro-6-methylheptane sulfonate; Perfluoro-6-methylheptanoic acid |
| P55DMHxS | M/C | Perfluoro-5,5-dimethylhexane sulfonate; Perfluoro-5,5-dimethylhexanoic acid |
| P44DMHxS | M/C | Perfluoro-4,4-dimethylhexane sulfonate; Perfluoro-4,4-dimethylhexanoic acid |
| P45DMHxS | M/C | Perfluoro-4,5-dimethylhexane sulfonate; Perfluoro-4,5-dimethylhexanoic acid; Perfluoro-3,5-dimethylhexane sulfonate; Perfluoro-3,5-dimethylhexanoic acid |
| FOSA-I | 754-91-6 | Perfluoro-1-octanesulfonamide |
| N-MeFOSA-M | 31506-32-8 | N-methylperfluoro-1-octansulfonamide |
| N,N-Me2FOSA-M | N/A | N,N-dimethylperfluoro-1-octanesulfonamide |
| N-EtFOSA-M | 4151-50-2 | N-ethylperfluoro-1-octanesulfonamide |
| M8FOSA-I | N/A | Perfluoro-1-[13C8]octanesulfonamide |
| d-N-MeFOSA-M | N/A | N-methyl-d3-perfluoro-1-octanesulfonamide |
| d-N-EtFOSA-M | N/A | N-ethyl-d5-perfluoro-1-octanesulfonamide |
| N-MeFOSE-M | 24448-09-7 | 2-(N-methylperfluoro-1-octanesulfonamido)-ethanol |
| N-EtFOSE-M | 1691-99-2 | 2-(N-ethylperfluoro-1-octanesulfonamido)-ethanol |
| d7-N-MeFOSE-M | N/A | 2-(N-methyl-d3-perfluoro-1-octanesulfonamido)ethan-d4-ol |
| d9-N-EtFOSE-M | N/A | 2-(N-ethyl-d5-perfluoro-1-octanesulfonamido)ethan-d4-ol |
| FOSAA | 2806-24-8 | Perfluoro-1-octanesulfonamidoacetic acid |
| N-MeFOSAA | 2355-31-9 | N-methylperfluoro-1-octanesulfonamidoacetic acid |
| N-EtFOSAA | 2991-50-6 | N-ethylperfluoro-1-octanesulfonamidoacetic acid |
| d3-N-MeFOSAA | N/A | N-methyl-d3-perfluoro-1-octanesulfonamidoacetic acid |
| d5-N-EtFOSAA | N/A | N-ethyl-d5-perfluoro-1-octanesulfonamidoacetic acid |
| FBET | 2043-47-2 | 2-Perfluorobutyl ethanol(4:2) |
| 5:2sFTOH | 914637-05-1 | 1-Perfluoropentyl ethanol(5:2 secondary) |
| FHET | 647-42-7 | 2-Perfluorohexyl ethanol(6:2) |
| 7:2sFTOH | 24015-83-6 | 1-Perfluoroheptyl ethanol(7:2 secondary) |
| FOET | 678-39-7 | 2-Perfluorooctyl ethanol(8:2) |
| FDET | 865-86-1 | 2-Perfluorodecyl ethanol(10:2) |
| MFBET | N/A | 2-Perfluorobutyl-[1,1,2,2-2H4]-ethanol(4:2) |
| MFHET | N/A | 2-Perfluorohexyl-[1,1-2H2]-[1,2-13C2]-ethanol(6:2) |
| M2FHET | N/A | 2-Perfluorohexyl-[1,2-13C2]-ethanol(6:2) |
| MFOET | N/A | 2-Perfluorooctyl-[1,1-2H2]-[1,2-13C2]-ethanol(8:2) |
| M2FOET | N/A | 2-Perfluorooctyl-[1,2-13C2]-ethanol(8:2) |
| MFDET | N/A | 2-Perfluorodecyl-[1,1-2H2]-[1,2-13C2]-ethanol(10:2) |
| FHEA | 53826-12-3 | 2-Perfluorohexyl ethanoic acid(6:2) |
| FOEA | 27854-31-5 | 2-Perfluorooctyl ethanoic acid(8:2) |
| FDEA | 53826-13-4 | 2-Perfluorodecyl ethanoic acid(10:2) |
| FPrPA | 356-02-5 | 3-Perfluoropropyl propanoic acid(3:3) |
| FPePA | 914637-49-3 | 3-Perfluoropentyl propanoic acid(5:3) |
| FHpPA | 812-70-4 | 3-Perfluoroheptyl propanoic acid(7:3) |
| FTA-MXA | M/C | Native FTA Solution/Mixture |
| MFHEA | N/A | 2-Perfluorohexyl-[1,2-13C2]-ethanoic acid(6:2) |
| MFOEA | N/A | 2-Perfluorooctyl-[1,2-13C2]-ethanoic acid(8:2) |
| MFDEA | N/A | 2-Perfluorodecyl-[1,2-13C2]-ethanoic acid(10:2) |
| MFTA-MXA | M/C | Mass-Labelled FTA Solution/Mixture |
| FHUEA | N/A | 2H-Perfluoro-2-octenoic acid(6:2) |
| FOUEA | 70887-84-2 | 2H-Perfluoro-2-decenoic acid(8:2) |
| FDUEA | N/A | 2H-Perfluoro-2-dodecenoic acid(10:2) |
| MFHUEA | N/A | 2H-Perfluoro-[1,2-13C2]-2-octenoic acid(6:2) |
| MFOUEA | N/A | 2H-Perfluoro-[1,2-13C2]-2-decenoic acid(8:2) |
| MFDUEA | N/A | 2H-Perfluoro-[1,2-13C2]-2-dodecenoic acid(10:2) |
| 9Cl-PF3ONS | 73606-16-6 (F-53B) | Potassium 9-chlorohexadecafluoro-3-oxanonane-1-sulfonate |
| 11Cl-PF3OUdS | 83329-89-9 | Potassium 11-chloroeicosafluoro-3-oxaundecane-1-sulfonate (minor component of F-53B) |
| NaDONA | 958445-44-8 (ADONA) | Sodium dodecafluoro-3H-4,8-dioxanonanoate |
| HFPO-DA | 13252-13-6 | 2,3,3,3-Tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoic acid (GenX) |
| M3HFPO-DA | N/A | 2,3,3,3-Tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-13C3-propanoic acid (13C-GenX) |
| 4:2FTS | N/A | Sodium 1H,1H,2H,2H-perfluorohexane sulfonate(4:2) |
| 6:2FTS | N/A | Sodium 1H,1H,2H,2H-perfluorooctane sulfonate(6:2) |
| 8:2FTS | N/A | Sodium 1H,1H,2H,2H-perfluorodecane sulfonate(8:2) |
| 10:2FTS | N/A | Sodium 1H,1H,2H,2H-perfluorododecane sulfonate(10:2) |
| M2-4:2FTS | N/A | Sodium 1H,1H,2H,2H-perfluoro-1-[1,2-13C2]-hexane sulfonate(4:2) |
| M2-6:2FTS | N/A | Sodium 1H,1H,2H,2H-perfluoro-1-[1,2-13C2]-octane sulfonate(6:2) |
| M2-8:2FTS | N/A | Sodium 1H,1H,2H,2H-perfluoro-1-[1,2-13C2]-decane sulfonate(8:2) |
| 8:2FTOAc | N/A | 1H,1H,2H,2H-Perfluorodecyl acetate |
| 10:2FTOAc | N/A | 1H,1H,2H,2H-Perfluorododecyl acetate |
| 8:2FTAcr | 27905-45-9 | 1H,1H,2H,2H-Perfluorodecyl acrylate |
| 10:2FTAcr | 17741-60-5 | 1H,1H,2H,2H-Perfluorododecyl acrylate |
| PFHxPA | 40143-76-8 | Perfluorohexylphosphonic acid |
| PFOPA | 40143-78-0 | Perfluorooctylphosphonic acid |
| PFDPA | 52299-26-0 | Perfluorodecylphosphonic acid |
| Cl-PFHxPA | N/A | 6-Chloroperfluorohexylphosphonic acid |
| Cl-PFOPA | N/A | 8-Chloroperfluorooctylphosphonic acid |
| 6:6PFPi | 70609-44-8 | Sodium bis(perfluorohexyl)phosphinate |
| 6:8PFPi | N/A | Sodium perfluorohexylperfluorooctylphosphinate |
| 8:8PFPi | 500776-69-2 | Sodium bis(perfluorooctyl)phosphinate |
| 6:2PAP | N/A | Sodium 1H,1H,2H,2H-perfluorooctylphosphate |
| 8:2PAP | N/A | Sodium 1H,1H,2H,2H-perfluorodecylphosphate |
| 6:2diPAP | N/A | Sodium bis(1H,1H,2H,2H-perfluorooctyl)phosphate |
| 8:2diPAP | N/A | Sodium bis(1H,1H,2H,2H-perfluorodecyl)phosphate |
| 6:2/8:2diPAP | N/A | Sodium (1H,1H,2H,2H-perfluorooctyl-1H,1H.2H,2H-perfluorodecyl)phosphate |
| SAmPAP | N/A | Sodium 2-(N-ethylperfluorooctane-1-sulfonamido)ethyl phosphate |
| diSAmPAP | N/A | Sodium bis-[2-(N-ethylperfluorooctane-1-sulfonamido)ethyl] phosphate |
| M2-6:2PAP | N/A | Sodium 1H,1H,2H,2H-[1,2-13C2]perfluorooctylphosphate |
| M2-8:2PAP | N/A | Sodium 1H,1H,2H,2H-[1,2-13C2]perfluorodecylphosphate |
| M4-6:2diPAP | N/A | Sodium bis(1H,1H,2H,2H-[1,2-13C2]perfluorooctyl)phosphate |
| M4-8:2diPAP | N/A | Sodium bis(1H,1H,2H,2H-[1,2-13C2]perfluorodecyl)phosphate |
| PAH-CVS-A | M/C | PAH-CVS-A Calibration Kit |
| PAH-LCS-A | M/C | PAH Labelled Compound Solution |
| PAH-ISS-A | M/C | PAH Internal Standard Spiking Solution |
| PAH-STK-A | M/C | PAH Native Stock Solution |
| PAH-CVS-B | M/C | PAH-CVS-B Calibration Kit |
| PAH-LCS-B | M/C | PAH Labelled Compound Solution |
| PAH-ISS-B | M/C | PAH Internal Standard Spiking Solution |
| PAH-SS-B | M/C | PAH Sampling Standard Solution |
| PAH-STK-B | M/C | PAH Native Stock Solution |
| L429-CVS | M/C | L429-CVS Calibration Kit |
| L429-SS | M/C | Method 429 Surrogate Standard Stock Solution |
| L429-IS | M/C | Method 429 Internal Standard Stock Solution |
| L429-AS | M/C | Method 429 Alternate Standard Stock Solution |
| L429-RS | M/C | Method 429 Recovery Standard Stock Solution |
| L429-PAR | M/C | Method 429 Native PAH Stock Solution |
| EPA-PAH-STK | M/C | Native PAH Solution/Mixture |
| EPA-PAH-LCS | M/C | Deuterated PAH Solution/Mixture |
| EPA-EU-PAH-ISS | M/C | Deuterated PAH Solution/Mixture |
| EU-PAH-STK | M/C | Native PAH Solution/Mixture |
| EU-PAH-LCS | M/C | Deuterated PAH Solution/Mixture |
| 4H107 | 152969-11-4 | 2,3,3′,4′,5-Pentachloro-4-biphenylol |
| 4H108 | 149589-55-9 | 2′,3,3′,4′,5-Pentachloro-4-biphenylol(97.5%) |
| 3H118 | 170946-11-9 | 2,3′,4,4′,5-Pentachloro-3-biphenylol |
| 4H130 | 158076-62-1 | 2,2′,3,3′,4′,5-Hexachloro-4-biphenylol |
| 3H138 | N/A | 2,2′,3′,4,4′,5-Hexachloro-3-biphenylol |
| 4H146 | 145413-90-7 | 2,2′,3,4′,5,5′-Hexachloro-4-biphenylol |
| 3H153 | 54284-55-8 | 2,2′,4,4′,5,5′-Hexachloro-3-biphenylol |
| 4H172 | 158076-64-3 | 2,2′,3,3′,4′,5,5′-Heptachloro-4-biphenylol |
| 3H180 | 158076-69-8 | 2,2′,3′,4,4′,5,5′-Heptachloro-3-biphenylol |
| 4H187 | 158076-68-7 | 2,2′,3,4′,5,5′,6-Heptachloro-4-biphenylol |
| M4H12 | N/A | 3′,4′-Dichloro-4-[13C12]biphenylol |
| M4H29 | N/A | 2′,4′,5′-Trichloro-4-[13C12]biphenylol |
| M4H61 | N/A | 2′,3′,4′,5′-Tetrachloro-4-[13C12]biphenylol |
| M4H120 | N/A | 2′,3,4′,5,5′-Pentachloro-4-[13C12]biphenylol |
| M4H159 | N/A | 2′,3,3′,4′,5,5′-Hexachloro-4-[13C12]biphenylol |
| M4H172 | N/A | 2,2′,3,3′,4′,5,5′-Heptachloro-4-[13C12]biphenylol |
| M4H187 | N/A | 2,2′,3,4′,5,5′,6-Heptachloro-4-[13C12]biphenylol |
| MHPCB-MXA | M/C | Mass-Labelled Chlorinated Biphenylol Solution/Mixture |
| 4PM79 | N/A | 3,3′,4′,5-Tetrachloro-4-methoxybiphenyl |
| 4PM97 | N/A | 2,2′,3,4′,5′-Pentachloro-4-methoxybiphenyl |
| 4PM101 | N/A | 2,2′,4,5,5′-Pentachloro-4′-methoxybiphenyl |
| 4M107 | N/A | 2,3,3′,4′,5-Pentachloro-4-methoxybiphenyl |
| 4PM108 | N/A | 2,3,3′,4,5′-Pentachloro-4′-methoxybiphenyl |
| 3M118 | N/A | 2,3′,4,4′,5-Pentachloro-3-methoxybiphenyl |
| 4PM120 | N/A | 2,3′,4,5,5′-Pentachloro-4′-methoxybiphenyl |
| 4PM127 | N/A | 3,3′,4,5,5′-Pentachloro-4′-methoxybiphenyl |
| 4PM130 | N/A | 2,2′,3,3′,4′,5-Hexachloro-4-methoxybiphenyl |
| 4M134 | N/A | 2,2′,3,3′,5,6-Hexachloro-4-methoxybiphenyl |
| 3PM138 | N/A | 2,2′,3′,4,4′,5-Hexachloro-3-methoxybiphenyl |
| 4M146 | N/A | 2,2′,3,4′,5,5′-Hexachloro-4-methoxybiphenyl |
| 33PDM155 | N/A | 2,2′,4,4′,6,6′-Hexachloro-3,3′-dimethoxybiphenyl |
| 4PM159 | N/A | 2,3,3′,4,5,5′-Hexachloro-4′-methoxybiphenyl |
| 4M162 | N/A | 2,3,3′,4′,5,5′-Hexachloro-4-methoxybiphenyl |
| 4M163 | N/A | 2,3,3′,4′,5,6-Hexachloro-4-methoxybiphenyl |
| 4PM172 | N/A | 2,2′,3,3′,4,5,5′-Heptachloro-4′-methoxybiphenyl |
| 4M177 | N/A | 2,2′,3,3′,4′,5,6-Heptachloro-4-methoxybiphenyl |
| 4M178 | N/A | 2,2′,3,3′,5,5′,6-Heptachloro-4-methoxybiphenyl |
| 3PM180 | N/A | 2,2′,3,4,4′,5,5′-Heptachloro-3′-methoxybiphenyl |
| 3PM182 | N/A | 2,2′,3,4,4′,5,6′-Heptachloro-3′-methoxybiphenyl |
| 3PM183 | N/A | 2,2′,3′,4,4′,5,6′-Heptachloro-3-methoxybiphenyl |
| 3PM184 | N/A | 2,2′,3,4,4′,6,6′-Heptachloro-3′-methoxybiphenyl |
| 4M187 | N/A | 2,2′,3,4′,5,5′,6-Heptachloro-4-methoxybiphenyl |
| 4M193 | N/A | 2,3,3′,4′,5,5′,6-Heptachloro-4-methoxybiphenyl |
| 4PM198 | N/A | 2,2′,3,3′,4,5,5′,6-Octachloro-4′-methoxybiphenyl |
| 4PM199 | N/A | 2,2′,3,3′,4′,5,5′,6-Octachloro-4-methoxybiphenyl |
| 4PM200 | N/A | 2,2′,3,3′,4,5,6,6′-Octachloro-4′-methoxybiphenyl |
| 4PM201 | N/A | 2,2′,3,3′,4′,5,6,6′-Octachloro-4-methoxybiphenyl |
| 4M202 | N/A | 2,2′,3,3′,5,5′,6,6′-Octachloro-4-methoxybiphenyl |
| 44PDM202 | N/A | 2,2′,3,3′,5,5′,6,6′-Octachloro-4,4′-dimethoxybiphenyl |
| 3PM203 | N/A | 2,2′,3,4,4′,5,5′,6-Octachloro-3′-methoxybiphenyl |
| 4PM208 | N/A | 2,2′,3,3′,4,5,5′,6,6′-Nonachloro-4′-methoxybiphenyl |
| MPCB-MXA | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXB | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXC | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXD | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXE | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXF | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXG | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXH | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| MPCB-MXI | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
| M4M29 | N/A | 2,4,5-Trichloro-4′-methoxy[13C12]biphenyl |
| M4M61 | N/A | 2,3,4,5-Tetrachloro-4′-methoxy[13C12]biphenyl |
| M4M120 | N/A | 2,3′,4,5,5′-Pentachloro-4′-methoxy[13C12]biphenyl |
| M4M159 | N/A | 2,3,3′,4,5,5′-Hexachloro-4′-methoxy[13C12]biphenyl |
| M4M172 | N/A | 2,2′,3,3′,4,5,5′-Heptachloro-4′-methoxy[13C12]biphenyl |
| M4M187 | N/A | 2,2′,3,4′,5,5′,6-Heptachloro-4-methoxy[13C12]biphenyl |
| MMPCB-MXA | M/C | Mass-Labelled Chlorinated Methoxybiphenyl Solution/Mixture |
| CBP-2 | 50558-21-9 | 2-Chlorobiphenylene |
| CBP-23 | N/A | 2,3-Dichlorobiphenylene |
| CBP-236 | N/A | 2,3,6-Trichlorobiphenylene |
| CBP-2367 | 7090-41-7 | 2,3,6,7-Tetrachlorobiphenylene |
| CBP-2-D | 50558-21-9 | 2-Chlorobiphenylene |
| CBP-23-D | N/A | 2,3-Dichlorobiphenylene |
| CBP-236-D | N/A | 2,3,6-Trichlorobiphenylene |
| CBP-2367-D | 7090-41-7 | 2,3,6,7-Tetrachlorobiphenylene |
| MCBP-2367 | N/A | 2,3,6,7-Tetrachloro[13C12]biphenylene |
| TCC | 101-20-2 | N-(4-chlorophenyl)-N’-(3,4-dichlorophenyl)urea |
| MTCC | N/A | N-(4-chloro[13C6]phenyl)-N’-(3,4-dichloro[13C6]phenyl)[13C]urea |
| TCS | 3380-34-5 | 5-Chloro-2-(2,4-dichlorophenoxy)phenol |
| TCS-M | 3380-34-5 | 5-Chloro-2-(2,4-dichlorophenoxy)phenol |
| MeTCS | 4640-01-1 | 5-Chloro-2-(2,4-dichlorophenoxy)anisole |
| MTCS | N/A | 5-Chloro-2-(2,4-dichloro[13C6]phenoxy)[13C6]phenol |
| MTCS-M | N/A | 5-Chloro-2-(2,4-dichloro[13C6]phenoxy)[13C6]phenol |
| MMeTCS | N/A | 5-Chloro-2-(2,4-dichloro[13C6]phenoxy)[1,2,3,4,5,6-13C6]anisole |
| 6TCS | 63709-57-9 | 2,3-Dichloro-6-(2,4-dichlorophenoxy)phenol(6-Chlorotriclosan) |
| 6MeTCS | N/A | 2,3-Dichloro-6-(2,4-dichlorophenoxy)anisole(6-Chloro-methoxytriclosan) |
| 4TCS | 3380-44-7 | 4,5-Dichloro-2-(2,4-dichlorophenoxy)phenol(4-Chlorotriclosan) |
| 4MeTCS | N/A | 4,5-Dichloro-2-(2,4-dichlorophenoxy)anisole(4-Chloro-methoxytriclosan) |
| 46TCS | 53555-01-4 | 2,3,4-Trichloro-6-(2,4-dichlorophenoxy)phenol(4,6-Dichlorotriclosan) |
| 46MeTCS | N/A | 2,3,4-Trichloro-6-(2,4-dichlorophenoxy)anisole(4,6-Dichloro-methoxytriclosan) |
| XE-2367-S | 118516-13-5 | 2,3,6,7-Tetrachloroxanthene |
| T4CPM | 27575-78-6 | Tris(4-chlorophenyl)methane |
| T4CPME | 3010-80-8 | Tris(4-chlorophenyl)methanol |
| MT4CPM | N/A | Tris(4-chlorophenyl)methane-[13C19] |
| MT4CPME | N/A | Tris(4-chlorophenyl)methanol-[13C19] |
| PN-2S | 91-58-7 | 2-Chloronaphthalene |
| PN-6S | 1825-30-5 | 1,5-Dichloronaphthalene |
| PN-12S | 2198-77-8 | 2,7-Dichloronaphthalene |
| PN-13S | 50402-52-3 | 1,2,3-Trichloronaphthalene |
| PN-27S | 20020-02-4 | 1,2,3,4-Tetrachloronaphthalene |
| PN-28S | 53555-63-8 | 1,2,3,5-Tetrachloronaphthalene |
| PN-31S | 149864-81-3 | 1,2,3,8-Tetrachloronaphthalene |
| PN-36S | 67922-22-9 | 1,2,5,6-Tetrachloronaphthalene (90%) |
| PN-46S | 3432-57-3 | 1,4,5,8-Tetrachloronaphthalene (96%) |
| PN-48S | 34588-40-4 | 2,3,6,7-Tetrachloronaphthalene |
| PN-50S | 67922-26-3 | 1,2,3,4,6-Pentachloronaphthalene |
| PN-52S | 53555-65-0 | 1,2,3,5,7-Pentachloronaphthalene |
| PN-53S | 150224-24-1 | 1,2,3,5,8-Pentachloronaphthalene |
| PN-66S | 103426-96-6 | 1,2,3,4,6,7-Hexachloronaphthalene |
| PN-69S | 103426-94-4 | 1,2,3,5,7,8-Hexachloronaphthalene |
| PN-72S | 103426-92-2 | 1,2,4,5,7,8-Hexachloronaphthalene |
| PN-73S | 58863-14-2 | 1,2,3,4,5,6,7-Heptachloronaphthalene |
| PN-75S | 2234-13-1 | Octachloronaphthalene |
| PCN-MXA | M/C | Native PCN Solution/Mixture |
| PCN-MXC | M/C | Native PCN Solution/Mixture |
| DPE-0 | 101-84-8 | Diphenyl ether |
| DPE-3 | 007005-72-3 | 4-Chlorodiphenyl ether |
| DPE-15 | 2444-89-5 | 4,4′-Dichlorodiphenyl ether |
| DPE-28 | 59039-21-3 | 2,4,4′-Trichlorodiphenyl ether |
| DPE-74 | 61328-45-8 | 2,4,4′,5-Tetrachlorodiphenyl ether |
| DPE-77 | 56348-72-2 | 3,3′,4,4′-Tetrachlorodiphenyl ether |
| DPE-99 | N/A | 2,2′,4,4′,5-Pentachlorodiphenyl ether |
| DPE-209 | 31710-30-2 | Decachlorodiphenyl ether |
| MCDE-0 | N/A | [13C12]Diphenyl ether |
| MCDE-3 | N/A | 4-Chloro[13C12]diphenyl ether |
| MCDE-12 | N/A | 3,4-Dichloro[13C12]diphenyl ether |
| MCDE-37 | N/A | 3,4,4′-Trichloro[13C12]diphenyl ether |
| MCDE-61 | N/A | 2,3,4,5-Tetrachloro[13C12]diphenyl ether |
| MCDE-86 | N/A | 2,2′,3,4,5-Pentachloro[13C12]diphenyl ether |
| MCDE-141 | N/A | 2,2′,3,4,5,5′-Hexachloro[13C12]diphenyl ether |
| MCDE-180 | N/A | 2,2′,3,4,4′,5,5′-Heptachloro[13C12]diphenyl ether |
| 8-M-237-CDD | N/A | 2,3,7-Trichloro-8-methyldibenzo-p-dioxin |
| 7-M-1234-CDD | N/A | 1,2,3,4-Tetrachloro-7-methyldibenzo-p-dioxin |
| 8-M-23-CDF | N/A | 2,3-Dichloro-8-methyldibenzofuran |
| 6-M-138-CDF | N/A | 1,3,8-Trichloro-6-methyldibenzofuran |
| 78-M-234-CDF | N/A | 2,3,4-Trichloro-7,8-dimethyldibenzofuran |
| 8-M-1247-CDF | N/A | 1,2,4,7-Tetrachloro-8-methyldibenzofuran |
| 6-M-1248-CDF | N/A | 1,2,4,8-Tetrachloro-6-methyldibenzofuran |
| CBS | M/C | Native Chlorobenzene Solution/Mixture |
| MCBS | M/C | Mass-Labelled Chlorobenzene Solution/Mixture |
| MBZ-1235 | N/A | 1,2,3,5-Tetrachloro[13C6]benzene |
| MCBZ-12345 | N/A | 1,2,3,4,5-Pentachloro[13C6]benzene |
| MBZ-123456 | 93952-14-8 | 13C6-Hexachlorobenzene |
| CPS | M/C | Native Chlorophenol Solution/Mixture |
| MCPS | M/C | Mass-Labelled Chlorophenol Solution/Mixture |
| MCP-25 | N/A | 2,5-Dichloro[13C6]phenol |
| MCP-246 | N/A | 2,4,6-Trichloro[13C6]phenol |
| MCP-345 | N/A | 3,4,5-Trichloro[13C6]phenol |
| MCP-23456 | N/A | Pentachloro[13C6]phenol |
| MEL | 108-78-1 | Melamine |
| CYA | 108-80-5 | Cyanuric Acid |
| M3-MEL | N/A | [13C3]-Melamine |
| M6-MEL | N/A | [13C3],[15N3]-Melamine |
| M3-CYA | N/A | [13C3]-Cyanuric Acid |
| M6-CYA | N/A | [13C3],[13N3]-Cyanuric Acid |
| BPA | 80-05-7 | Bisphenol A |
| BPAF | 1478-61-1 | Bisphenol AF |
| BPAP | 1571-75-1 | Bisphenol AP |
| BPB | 77-40-7 | Bisphenol B |
| BPF | 620-92-8 | Bisphenol F |
| BPP | 2167-51-3 | Bisphenol P |
| BPS | 80-09-1 | Bisphenol S |
| BPZ | 843-55-0 | Bisphenol Z |
| MBPA | 263261-65-0 | 13C12-Bisphenol A |
| TCDT-83 | 133513-17-4 | 2,3,7,8-Tetrachlorodibenzothiophene |
| TCDT-85 | 134705-49-0 | 2,4,6,8-Tetrachlorodibenzothiophene |
| MTCDT-85 | N/A | 2,4,6,8-Tetrachloro[13C12]dibenzothiophene |
| CCZ-3 | 2732-25-4 | 3-Chloro-9H-carbazole |
| CCZ-36 | 5599-71-3 | 3,6-Dichloro-9H-carbazole |
| CCZ-1368 | 58910-96-6 | 1,3,6,8-Tetrachloro-9H-carbazole |
| CCZ-2367 | N/A | 2,3,6,7-Tetrachloro-9H-carbazole |
| CBCZ-MXB | M/C | Native Halogenated Carbazoles Solution/Mixture |
| MCCZ-36 | N/A | 3,6-Dichloro-9H-[13C12]carbazole |
| MCCZ-1368 | N/A | 1,3,6,8-Tetrachloro-9H-[13C12]carbazole |
| MCCZ-MIX-A | M/C | Solution/Mix of Mass-Labelled Chlorinated Carbazoles |
| BCZ-3 | 1592-95-6 | 3-Bromo-9H-carbazole |
| BCZ-27 | 136630-39-2 | 2,7-Dibromo-9H-carbazole |
| BCZ-36 | 6825-20-3 | 3,6-Dibromo-9H-carbazole |
| BCZ-136 | 55119-10-3 | 1,3,6-Tribromo-9H-carbazole |
| BCZ-1368 | 55119-09-0 | 1,3,6,8-Tetrabromo-9H-carbazole |
| 1-B-36-CCZ | N/A | 1-Bromo-3,6-dichloro-9H-carbazole |
| 18-B-36-CCZ | N/A | 1,8-Dibromo-3,6-dichloro-9H-carbazole |
| WMS-01 | N/A | Reference Lake Sediment for Organic Contaminant Analysis |
| WMF-01 | N/A | Reference Freeze-Dried Fish Tissue for Organic Contaminant Analysis |
| CARP-2 | N/A | Reference Fish Tissue (homogenate) for Organic Contaminant Analysis |
| DFP-CVS-B10 | M/C | CS1/CS2/CS3/CS4/CS5/CS6 |
| DFP-CVS-B1 | M/C | Calibration Solutions for PCDD/PCDF/PCBs |
| DF-CVS-C10 | M/C | CS1/CS2/CS3/CS4/CS5/CS6 |
| DF-C10-CS8 | M/C | High Level Calibration Solution |
| PCB-CVS-B10 | M/C | CS1/CS2/CS3/CS4/CS5/CS6 |
| PCB-B10-CS8 | M/C | High Level Calibration Solution |
| TPCB-CVS-A | M/C | CSL/CS1/CS2/CS3/CS4/CS5 |
| DFP-LCS-B | M/C | Mass-Labelled PCDDs/PCDFs/DL-PCBs Solution/Mixture |
| DFP-LCS-B100 | M/C | Mass-Labelled PCDDs/PCDFs/DL-PCBs Solution/Mixture |
| DFP-LCS-B20 | M/C | Mass-Labelled PCDDs/PCDFs/DL-PCBs Solution/Mixture |
| DFP-IS-B10 | M/C | Mass-Labelled PCDD and PCB Syringe Spike Solution |
| DFP-SS-A10 | M/C | Mass-Labelled PCDD and PCB Sampling Spike Solution |
| DF-LCS-B | M/C | Mass-Labelled PCDDs/PCDFs Solution/Mixture |
| DF-LCS-B100 | M/C | Mass-Labelled PCDDs/PCDFs Solution/Mixture |
| DF-LCS-B20 | M/C | Mass-Labelled PCDDs/PCDFs Solution/Mixture |
| DF-IS-J | M/C | Mass-Labelled PCDDs Syringe Spike Solution |
| DF-IS-J100 | M/C | Mass-Labelled PCDDs Syringe Spike Solution |
| DF-IS-J20 | M/C | Mass-Labelled PCDDs Syringe Spike Solution |
| DF-SS-A | M/C | Mass-Labelled PCDD Sampling Spike Solution |
| DF-SS-A100 | M/C | Mass-Labelled PCDD Sampling Spike Solution |
| DF-SS-A20 | M/C | Mass-Labelled PCDD Sampling Spike Solution |
| PCB-LCS-A1 | M/C | Mass-Labelled PCBs Solution/Mixture |
| PCB-LCS-A100 | M/C | Mass-Labelled PCBs Solution/Mixture |
| PCB-LCS-A20 | M/C | Mass-Labelled PCBs Solution/Mixture |
| PCB-IS-C | M/C | Mass-Labelled PCBs Syringe Spike Solution |
| PCB-IS-C100 | M/C | Mass-Labelled PCBs Syringe Spike Solution |
| PCB-IS-C20 | M/C | Mass-Labelled PCBs Syringe Spike Solution |
| PCB-SS-A | M/C | Mass-Labelled PCB Sampling Spike Solution |
| PCB-SS-A100 | M/C | Mass-Labelled PCB Sampling Spike Solution |
| PCB-SS-A20 | M/C | Mass-Labelled PCB Sampling Spike Solution |
| TPCB-LCS-A100 | M/C | Mass-Labelled PCB Extractions Standard |
| TPCB-LCS-A20 | M/C | Mass-Labelled PCB Extractions Standard |
| TPCB-LCS-B100 | M/C | Mass-Labelled PCB Extractions Standard |
| TPCB-LCS-B20 | M/C | Mass-Labelled PCB Extractions Standard |
| TPCB-IS-A100 | M/C | Mass-Labelled PCB Recovery/Internal Standards |
| TPCB-IS-A20 | M/C | Mass-Labelled PCB Recovery/Internal Standards |
| TPCB-SS-A100 | M/C | Mass-Labelled PCB Sampling/Cleanup Standards |
| TPCB-SS-A20 | M/C | Mass-Labelled PCB Sampling/Cleanup Standards |
| DFP-ST-C10 | M/C | Native PCDDs/PCDFs/DL-PCBs Solution/Mixture |
| DF-ST-C | M/C | Native PCDD/PCDF Solution/Mixture |
| DF-ST-C10 | M/C | Native PCDDs/PCDFs Solution/Mixture |
| PCB-ST-C | M/C | Native PCB Solution/Mixture |
| PCB-ST-C20 | M/C | Native DL-PCBs Solution/Mixture |
| PCB-ST-D | M/C | Native PCB Solution/Mixture |
| OIL-CVS-B | M/C | CS1/CS2/CS3/CS4/CS5/CS6 |
| MBP-MXP | M/C | Mass-Labelled PCB Internal Standard Solution |
| BP-MXP | M/C | Native PCB Mixture Solution |
| BP-PG-MXA | M/C | Native PCB Mixture/Solution |
| MBP-PG-MXA | M/C | Mass-Labelled PCB Mixture/Solution |